]>
Commit | Line | Data |
---|---|---|
1 | diff -urN xbmc-11.0/lib/DllAvCodec.h xbmc-11.0-ffmpeg-1.0/lib/DllAvCodec.h | |
2 | --- xbmc-11.0/lib/DllAvCodec.h 2012-03-21 23:07:50.000000000 +0100 | |
3 | +++ xbmc-11.0-ffmpeg-1.0/lib/DllAvCodec.h 2012-11-08 23:16:18.536405054 +0100 | |
4 | @@ -24,7 +24,7 @@ | |
5 | #include "config.h" | |
6 | #endif | |
7 | #include "DynamicDll.h" | |
8 | -#include "DllAvCore.h" | |
9 | +#include "DllAvUtil.h" | |
10 | #include "utils/log.h" | |
11 | ||
12 | extern "C" { | |
13 | @@ -60,7 +60,6 @@ | |
14 | #endif | |
15 | ||
16 | /* From non-public audioconvert.h */ | |
17 | - int64_t avcodec_guess_channel_layout(int nb_channels, enum CodecID codec_id, const char *fmt_name); | |
18 | struct AVAudioConvert; | |
19 | typedef struct AVAudioConvert AVAudioConvert; | |
20 | AVAudioConvert *av_audio_convert_alloc(enum AVSampleFormat out_fmt, int out_channels, | |
21 | @@ -76,28 +75,6 @@ | |
22 | #endif | |
23 | } | |
24 | ||
25 | -/* Some convenience macros introduced at this particular revision of libavcodec. | |
26 | - */ | |
27 | -#if LIBAVCODEC_VERSION_INT < AV_VERSION_INT(52,25,0) | |
28 | -#define CH_LAYOUT_5POINT0_BACK (CH_LAYOUT_SURROUND|CH_BACK_LEFT|CH_BACK_RIGHT) | |
29 | -#define CH_LAYOUT_5POINT1_BACK (CH_LAYOUT_5POINT0_BACK|CH_LOW_FREQUENCY) | |
30 | -#undef CH_LAYOUT_7POINT1_WIDE | |
31 | -#define CH_LAYOUT_7POINT1_WIDE (CH_LAYOUT_5POINT1_BACK|\ | |
32 | - CH_FRONT_LEFT_OF_CENTER|CH_FRONT_RIGHT_OF_CENTER) | |
33 | -#endif | |
34 | - | |
35 | -#if LIBAVCODEC_VERSION_INT < AV_VERSION_INT(52,64,0) | |
36 | -// API added on: 2010-03-31 | |
37 | -#define AVMediaType CodecType | |
38 | -#define AVMEDIA_TYPE_UNKNOWN CODEC_TYPE_UNKNOWN | |
39 | -#define AVMEDIA_TYPE_VIDEO CODEC_TYPE_VIDEO | |
40 | -#define AVMEDIA_TYPE_AUDIO CODEC_TYPE_AUDIO | |
41 | -#define AVMEDIA_TYPE_DATA CODEC_TYPE_DATA | |
42 | -#define AVMEDIA_TYPE_SUBTITLE CODEC_TYPE_SUBTITLE | |
43 | -#define AVMEDIA_TYPE_ATTACHMENT CODEC_TYPE_ATTACHMENT | |
44 | -#define AVMEDIA_TYPE_NB CODEC_TYPE_NB | |
45 | -#endif | |
46 | - | |
47 | #include "threads/SingleLock.h" | |
48 | ||
49 | class DllAvCodecInterface | |
50 | @@ -106,20 +83,20 @@ | |
51 | virtual ~DllAvCodecInterface() {} | |
52 | virtual void avcodec_register_all(void)=0; | |
53 | virtual void avcodec_flush_buffers(AVCodecContext *avctx)=0; | |
54 | - virtual int avcodec_open_dont_call(AVCodecContext *avctx, AVCodec *codec)=0; | |
55 | + virtual int avcodec_open2_dont_call(AVCodecContext *avctx, AVCodec *codec, AVDictionary **options)=0; | |
56 | virtual AVCodec *avcodec_find_decoder(enum CodecID id)=0; | |
57 | virtual AVCodec *avcodec_find_encoder(enum CodecID id)=0; | |
58 | virtual int avcodec_close_dont_call(AVCodecContext *avctx)=0; | |
59 | virtual AVFrame *avcodec_alloc_frame(void)=0; | |
60 | virtual int avpicture_fill(AVPicture *picture, uint8_t *ptr, PixelFormat pix_fmt, int width, int height)=0; | |
61 | virtual int avcodec_decode_video2(AVCodecContext *avctx, AVFrame *picture, int *got_picture_ptr, AVPacket *avpkt)=0; | |
62 | - virtual int avcodec_decode_audio3(AVCodecContext *avctx, int16_t *samples, int *frame_size_ptr, AVPacket *avpkt)=0; | |
63 | + virtual int avcodec_decode_audio4(AVCodecContext *avctx, AVFrame *frame, int *got_frame_ptr, AVPacket *avpkt)=0; | |
64 | virtual int avcodec_decode_subtitle2(AVCodecContext *avctx, AVSubtitle *sub, int *got_sub_ptr, AVPacket *avpkt)=0; | |
65 | virtual int avcodec_encode_audio(AVCodecContext *avctx, uint8_t *buf, int buf_size, const short *samples)=0; | |
66 | virtual int avpicture_get_size(PixelFormat pix_fmt, int width, int height)=0; | |
67 | - virtual AVCodecContext *avcodec_alloc_context(void)=0; | |
68 | + virtual AVCodecContext *avcodec_alloc_context3(AVCodec *codec)=0; | |
69 | virtual void avcodec_string(char *buf, int buf_size, AVCodecContext *enc, int encode)=0; | |
70 | - virtual void avcodec_get_context_defaults(AVCodecContext *s)=0; | |
71 | + virtual void avcodec_get_context_defaults3(AVCodecContext *s, AVCodec *codec)=0; | |
72 | virtual AVCodecParserContext *av_parser_init(int codec_id)=0; | |
73 | virtual int av_parser_parse2(AVCodecParserContext *s,AVCodecContext *avctx, uint8_t **poutbuf, int *poutbuf_size, | |
74 | const uint8_t *buf, int buf_size, | |
75 | @@ -137,7 +114,6 @@ | |
76 | virtual enum PixelFormat avcodec_default_get_format(struct AVCodecContext *s, const enum PixelFormat *fmt)=0; | |
77 | virtual int avcodec_default_get_buffer(AVCodecContext *s, AVFrame *pic)=0; | |
78 | virtual void avcodec_default_release_buffer(AVCodecContext *s, AVFrame *pic)=0; | |
79 | - virtual int avcodec_thread_init(AVCodecContext *s, int thread_count)=0; | |
80 | virtual AVCodec *av_codec_next(AVCodec *c)=0; | |
81 | virtual AVAudioConvert *av_audio_convert_alloc(enum AVSampleFormat out_fmt, int out_channels, | |
82 | enum AVSampleFormat in_fmt , int in_channels, | |
83 | @@ -148,7 +124,6 @@ | |
84 | const void * const in[6], const int in_stride[6], int len)=0; | |
85 | virtual int av_dup_packet(AVPacket *pkt)=0; | |
86 | virtual void av_init_packet(AVPacket *pkt)=0; | |
87 | - virtual int64_t avcodec_guess_channel_layout(int nb_channels, enum CodecID codec_id, const char *fmt_name)=0; | |
88 | }; | |
89 | ||
90 | #if (defined USE_EXTERNAL_FFMPEG) | |
91 | @@ -166,12 +141,12 @@ | |
92 | ::avcodec_register_all(); | |
93 | } | |
94 | virtual void avcodec_flush_buffers(AVCodecContext *avctx) { ::avcodec_flush_buffers(avctx); } | |
95 | - virtual int avcodec_open(AVCodecContext *avctx, AVCodec *codec) | |
96 | + virtual int avcodec_open2(AVCodecContext *avctx, AVCodec *codec, AVDictionary **options) | |
97 | { | |
98 | CSingleLock lock(DllAvCodec::m_critSection); | |
99 | - return ::avcodec_open(avctx, codec); | |
100 | + return ::avcodec_open2(avctx, codec, options); | |
101 | } | |
102 | - virtual int avcodec_open_dont_call(AVCodecContext *avctx, AVCodec *codec) { *(int *)0x0 = 0; return 0; } | |
103 | + virtual int avcodec_open2_dont_call(AVCodecContext *avctx, AVCodec *codec, AVDictionary **options) { *(int *)0x0 = 0; return 0; } | |
104 | virtual int avcodec_close_dont_call(AVCodecContext *avctx) { *(int *)0x0 = 0; return 0; } | |
105 | virtual AVCodec *avcodec_find_decoder(enum CodecID id) { return ::avcodec_find_decoder(id); } | |
106 | virtual AVCodec *avcodec_find_encoder(enum CodecID id) { return ::avcodec_find_encoder(id); } | |
107 | @@ -182,33 +157,21 @@ | |
108 | } | |
109 | virtual AVFrame *avcodec_alloc_frame() { return ::avcodec_alloc_frame(); } | |
110 | virtual int avpicture_fill(AVPicture *picture, uint8_t *ptr, PixelFormat pix_fmt, int width, int height) { return ::avpicture_fill(picture, ptr, pix_fmt, width, height); } | |
111 | -#if LIBAVCODEC_VERSION_INT >= AV_VERSION_INT(52,23,0) | |
112 | - // API added on: 2009-04-07 | |
113 | virtual int avcodec_decode_video2(AVCodecContext *avctx, AVFrame *picture, int *got_picture_ptr, AVPacket *avpkt) { return ::avcodec_decode_video2(avctx, picture, got_picture_ptr, avpkt); } | |
114 | - virtual int avcodec_decode_audio3(AVCodecContext *avctx, int16_t *samples, int *frame_size_ptr, AVPacket *avpkt) { return ::avcodec_decode_audio3(avctx, samples, frame_size_ptr, avpkt); } | |
115 | + virtual int avcodec_decode_audio4(AVCodecContext *avctx, AVFrame *frame, int *got_frame_ptr, AVPacket *avpkt) { return ::avcodec_decode_audio4(avctx, frame, got_frame_ptr, avpkt); } | |
116 | virtual int avcodec_decode_subtitle2(AVCodecContext *avctx, AVSubtitle *sub, int *got_sub_ptr, AVPacket *avpkt) { return ::avcodec_decode_subtitle2(avctx, sub, got_sub_ptr, avpkt); } | |
117 | -#else | |
118 | - virtual int avcodec_decode_video2(AVCodecContext *avctx, AVFrame *picture, int *got_picture_ptr, AVPacket *avpkt) { return ::avcodec_decode_video(avctx, picture, got_picture_ptr, avpkt->data, avpkt->size); } | |
119 | - virtual int avcodec_decode_audio3(AVCodecContext *avctx, int16_t *samples, int *frame_size_ptr, AVPacket *avpkt) { return ::avcodec_decode_audio2(avctx, samples, frame_size_ptr, avpkt->data, avpkt->size); } | |
120 | - virtual int avcodec_decode_subtitle2(AVCodecContext *avctx, AVSubtitle *sub, int *got_sub_ptr, AVPacket *avpkt) { return ::avcodec_decode_subtitle(avctx, sub, got_sub_ptr, avpkt->data, avpkt->size); } | |
121 | -#endif | |
122 | virtual int avcodec_encode_audio(AVCodecContext *avctx, uint8_t *buf, int buf_size, const short *samples) { return ::avcodec_encode_audio(avctx, buf, buf_size, samples); } | |
123 | virtual int avpicture_get_size(PixelFormat pix_fmt, int width, int height) { return ::avpicture_get_size(pix_fmt, width, height); } | |
124 | - virtual AVCodecContext *avcodec_alloc_context() { return ::avcodec_alloc_context(); } | |
125 | + virtual AVCodecContext *avcodec_alloc_context3(AVCodec *codec) { return ::avcodec_alloc_context3(codec); } | |
126 | virtual void avcodec_string(char *buf, int buf_size, AVCodecContext *enc, int encode) { ::avcodec_string(buf, buf_size, enc, encode); } | |
127 | - virtual void avcodec_get_context_defaults(AVCodecContext *s) { ::avcodec_get_context_defaults(s); } | |
128 | + virtual void avcodec_get_context_defaults3(AVCodecContext *s, AVCodec *codec) { ::avcodec_get_context_defaults3(s, codec); } | |
129 | ||
130 | virtual AVCodecParserContext *av_parser_init(int codec_id) { return ::av_parser_init(codec_id); } | |
131 | virtual int av_parser_parse2(AVCodecParserContext *s,AVCodecContext *avctx, uint8_t **poutbuf, int *poutbuf_size, | |
132 | const uint8_t *buf, int buf_size, | |
133 | int64_t pts, int64_t dts, int64_t pos) | |
134 | { | |
135 | -#if LIBAVCODEC_VERSION_INT >= AV_VERSION_INT(52,21,0) | |
136 | - // API added on : 2009-03-05 | |
137 | return ::av_parser_parse2(s, avctx, poutbuf, poutbuf_size, buf, buf_size, pts, dts, pos); | |
138 | -#else | |
139 | - return ::av_parser_parse(s, avctx, poutbuf, poutbuf_size, buf, buf_size, pts, dts); | |
140 | -#endif | |
141 | } | |
142 | virtual void av_parser_close(AVCodecParserContext *s) { ::av_parser_close(s); } | |
143 | ||
144 | @@ -225,7 +188,6 @@ | |
145 | virtual int avcodec_default_get_buffer(AVCodecContext *s, AVFrame *pic) { return ::avcodec_default_get_buffer(s, pic); } | |
146 | virtual void avcodec_default_release_buffer(AVCodecContext *s, AVFrame *pic) { ::avcodec_default_release_buffer(s, pic); } | |
147 | virtual enum PixelFormat avcodec_default_get_format(struct AVCodecContext *s, const enum PixelFormat *fmt) { return ::avcodec_default_get_format(s, fmt); } | |
148 | - virtual int avcodec_thread_init(AVCodecContext *s, int thread_count) { return ::avcodec_thread_init(s, thread_count); } | |
149 | virtual AVCodec *av_codec_next(AVCodec *c) { return ::av_codec_next(c); } | |
150 | virtual AVAudioConvert *av_audio_convert_alloc(enum AVSampleFormat out_fmt, int out_channels, | |
151 | enum AVSampleFormat in_fmt , int in_channels, | |
152 | @@ -241,7 +203,6 @@ | |
153 | ||
154 | virtual int av_dup_packet(AVPacket *pkt) { return ::av_dup_packet(pkt); } | |
155 | virtual void av_init_packet(AVPacket *pkt) { return ::av_init_packet(pkt); } | |
156 | - virtual int64_t avcodec_guess_channel_layout(int nb_channels, enum CodecID codec_id, const char *fmt_name) { return ::avcodec_guess_channel_layout(nb_channels, codec_id, fmt_name); } | |
157 | ||
158 | // DLL faking. | |
159 | virtual bool ResolveExports() { return true; } | |
160 | @@ -256,17 +217,16 @@ | |
161 | { | |
162 | DECLARE_DLL_WRAPPER(DllAvCodec, DLL_PATH_LIBAVCODEC) | |
163 | DEFINE_FUNC_ALIGNED1(void, __cdecl, avcodec_flush_buffers, AVCodecContext*) | |
164 | - DEFINE_FUNC_ALIGNED2(int, __cdecl, avcodec_open_dont_call, AVCodecContext*, AVCodec *) | |
165 | + DEFINE_FUNC_ALIGNED3(int, __cdecl, avcodec_open2_dont_call, AVCodecContext*, AVCodec *, AVDictionary **) | |
166 | DEFINE_FUNC_ALIGNED4(int, __cdecl, avcodec_decode_video2, AVCodecContext*, AVFrame*, int*, AVPacket*) | |
167 | - DEFINE_FUNC_ALIGNED4(int, __cdecl, avcodec_decode_audio3, AVCodecContext*, int16_t*, int*, AVPacket*) | |
168 | + DEFINE_FUNC_ALIGNED4(int, __cdecl, avcodec_decode_audio4, AVCodecContext*, AVFrame*, int*, AVPacket*) | |
169 | DEFINE_FUNC_ALIGNED4(int, __cdecl, avcodec_decode_subtitle2, AVCodecContext*, AVSubtitle*, int*, AVPacket*) | |
170 | DEFINE_FUNC_ALIGNED4(int, __cdecl, avcodec_encode_audio, AVCodecContext*, uint8_t*, int, const short*) | |
171 | - DEFINE_FUNC_ALIGNED0(AVCodecContext*, __cdecl, avcodec_alloc_context) | |
172 | + DEFINE_FUNC_ALIGNED1(AVCodecContext*, __cdecl, avcodec_alloc_context3, AVCodec *) | |
173 | DEFINE_FUNC_ALIGNED1(AVCodecParserContext*, __cdecl, av_parser_init, int) | |
174 | DEFINE_FUNC_ALIGNED9(int, __cdecl, av_parser_parse2, AVCodecParserContext*,AVCodecContext*, uint8_t**, int*, const uint8_t*, int, int64_t, int64_t, int64_t) | |
175 | DEFINE_METHOD1(int, av_dup_packet, (AVPacket *p1)) | |
176 | DEFINE_METHOD1(void, av_init_packet, (AVPacket *p1)) | |
177 | - DEFINE_METHOD3(int64_t, avcodec_guess_channel_layout, (int p1, enum CodecID p2, const char *p3)) | |
178 | ||
179 | LOAD_SYMBOLS(); | |
180 | ||
181 | @@ -278,7 +238,7 @@ | |
182 | DEFINE_METHOD5(int, avpicture_fill, (AVPicture *p1, uint8_t *p2, PixelFormat p3, int p4, int p5)) | |
183 | DEFINE_METHOD3(int, avpicture_get_size, (PixelFormat p1, int p2, int p3)) | |
184 | DEFINE_METHOD4(void, avcodec_string, (char *p1, int p2, AVCodecContext *p3, int p4)) | |
185 | - DEFINE_METHOD1(void, avcodec_get_context_defaults, (AVCodecContext *p1)) | |
186 | + DEFINE_METHOD2(void, avcodec_get_context_defaults3, (AVCodecContext *p1, AVCodec *p2)) | |
187 | DEFINE_METHOD1(void, av_parser_close, (AVCodecParserContext *p1)) | |
188 | DEFINE_METHOD1(void, avpicture_free, (AVPicture *p1)) | |
189 | DEFINE_METHOD1(AVBitStreamFilterContext*, av_bitstream_filter_init, (const char *p1)) | |
190 | @@ -290,7 +250,6 @@ | |
191 | DEFINE_METHOD2(void, avcodec_default_release_buffer, (AVCodecContext *p1, AVFrame *p2)) | |
192 | DEFINE_METHOD2(enum PixelFormat, avcodec_default_get_format, (struct AVCodecContext *p1, const enum PixelFormat *p2)) | |
193 | ||
194 | - DEFINE_METHOD2(int, avcodec_thread_init, (AVCodecContext *p1, int p2)) | |
195 | DEFINE_METHOD1(AVCodec*, av_codec_next, (AVCodec *p1)) | |
196 | DEFINE_METHOD6(AVAudioConvert*, av_audio_convert_alloc, (enum AVSampleFormat p1, int p2, | |
197 | enum AVSampleFormat p3, int p4, | |
198 | @@ -301,7 +260,7 @@ | |
199 | const void * const p4[6], const int p5[6], int p6)) | |
200 | BEGIN_METHOD_RESOLVE() | |
201 | RESOLVE_METHOD(avcodec_flush_buffers) | |
202 | - RESOLVE_METHOD_RENAME(avcodec_open,avcodec_open_dont_call) | |
203 | + RESOLVE_METHOD_RENAME(avcodec_open2,avcodec_open2_dont_call) | |
204 | RESOLVE_METHOD_RENAME(avcodec_close,avcodec_close_dont_call) | |
205 | RESOLVE_METHOD(avcodec_find_decoder) | |
206 | RESOLVE_METHOD(avcodec_find_encoder) | |
207 | @@ -309,13 +268,13 @@ | |
208 | RESOLVE_METHOD_RENAME(avcodec_register_all, avcodec_register_all_dont_call) | |
209 | RESOLVE_METHOD(avpicture_fill) | |
210 | RESOLVE_METHOD(avcodec_decode_video2) | |
211 | - RESOLVE_METHOD(avcodec_decode_audio3) | |
212 | + RESOLVE_METHOD(avcodec_decode_audio4) | |
213 | RESOLVE_METHOD(avcodec_decode_subtitle2) | |
214 | RESOLVE_METHOD(avcodec_encode_audio) | |
215 | RESOLVE_METHOD(avpicture_get_size) | |
216 | - RESOLVE_METHOD(avcodec_alloc_context) | |
217 | + RESOLVE_METHOD(avcodec_alloc_context3) | |
218 | RESOLVE_METHOD(avcodec_string) | |
219 | - RESOLVE_METHOD(avcodec_get_context_defaults) | |
220 | + RESOLVE_METHOD(avcodec_get_context_defaults3) | |
221 | RESOLVE_METHOD(av_parser_init) | |
222 | RESOLVE_METHOD(av_parser_parse2) | |
223 | RESOLVE_METHOD(av_parser_close) | |
224 | @@ -328,26 +287,24 @@ | |
225 | RESOLVE_METHOD(avcodec_default_get_buffer) | |
226 | RESOLVE_METHOD(avcodec_default_release_buffer) | |
227 | RESOLVE_METHOD(avcodec_default_get_format) | |
228 | - RESOLVE_METHOD(avcodec_thread_init) | |
229 | RESOLVE_METHOD(av_codec_next) | |
230 | RESOLVE_METHOD(av_audio_convert_alloc) | |
231 | RESOLVE_METHOD(av_audio_convert_free) | |
232 | RESOLVE_METHOD(av_audio_convert) | |
233 | RESOLVE_METHOD(av_dup_packet) | |
234 | RESOLVE_METHOD(av_init_packet) | |
235 | - RESOLVE_METHOD(avcodec_guess_channel_layout) | |
236 | END_METHOD_RESOLVE() | |
237 | ||
238 | /* dependencies of libavcodec */ | |
239 | - DllAvCore m_dllAvCore; | |
240 | + DllAvUtil m_dllAvUtil; | |
241 | // DllAvUtil loaded implicitely by m_dllAvCore | |
242 | ||
243 | public: | |
244 | static CCriticalSection m_critSection; | |
245 | - int avcodec_open(AVCodecContext *avctx, AVCodec *codec) | |
246 | + int avcodec_open2(AVCodecContext *avctx, AVCodec *codec, AVDictionary **options) | |
247 | { | |
248 | CSingleLock lock(DllAvCodec::m_critSection); | |
249 | - return avcodec_open_dont_call(avctx,codec); | |
250 | + return avcodec_open2_dont_call(avctx,codec, options); | |
251 | } | |
252 | int avcodec_close(AVCodecContext *avctx) | |
253 | { | |
254 | @@ -361,7 +318,7 @@ | |
255 | } | |
256 | virtual bool Load() | |
257 | { | |
258 | - if (!m_dllAvCore.Load()) | |
259 | + if (!m_dllAvUtil.Load()) | |
260 | return false; | |
261 | return DllDynamic::Load(); | |
262 | } | |
263 | diff -urN xbmc-11.0/lib/DllAvCore.h xbmc-11.0-ffmpeg-1.0/lib/DllAvCore.h | |
264 | --- xbmc-11.0/lib/DllAvCore.h 2012-03-21 23:07:50.000000000 +0100 | |
265 | +++ xbmc-11.0-ffmpeg-1.0/lib/DllAvCore.h 1970-01-01 01:00:00.000000000 +0100 | |
266 | @@ -1,182 +0,0 @@ | |
267 | -#pragma once | |
268 | -/* | |
269 | - * Copyright (C) 2005-2010 Team XBMC | |
270 | - * http://www.xbmc.org | |
271 | - * | |
272 | - * This Program is free software; you can redistribute it and/or modify | |
273 | - * it under the terms of the GNU General Public License as published by | |
274 | - * the Free Software Foundation; either version 2, or (at your option) | |
275 | - * any later version. | |
276 | - * | |
277 | - * This Program is distributed in the hope that it will be useful, | |
278 | - * but WITHOUT ANY WARRANTY; without even the implied warranty of | |
279 | - * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the | |
280 | - * GNU General Public License for more details. | |
281 | - * | |
282 | - * You should have received a copy of the GNU General Public License | |
283 | - * along with XBMC; see the file COPYING. If not, write to the Free | |
284 | - * Software Foundation, Inc., 51 Franklin Street, Fifth Floor, | |
285 | - * Boston, MA 02110-1301, USA. | |
286 | - * http://www.gnu.org/copyleft/gpl.html | |
287 | - * | |
288 | - */ | |
289 | - | |
290 | -#if (defined HAVE_CONFIG_H) && (!defined WIN32) | |
291 | - #include "config.h" | |
292 | -#endif | |
293 | -#include "DynamicDll.h" | |
294 | -#include "DllAvUtil.h" | |
295 | -#include "utils/log.h" | |
296 | - | |
297 | -extern "C" { | |
298 | -#ifdef USE_EXTERNAL_FFMPEG | |
299 | - #ifdef HAVE_LIBAVUTIL_SAMPLEFMT_H | |
300 | - // libavcore was merged to libavutil on 2010-02-15 | |
301 | - #include <libavutil/audioconvert.h> | |
302 | - #include <libavutil/samplefmt.h> | |
303 | - #endif | |
304 | - | |
305 | - #ifdef HAVE_LIBAVCORE_AVCORE_H | |
306 | - #include <libavcore/avcore.h> | |
307 | - #endif | |
308 | - #ifdef HAVE_LIBAVCORE_SAMPLEFMT_H | |
309 | - #include <libavcore/samplefmt.h> | |
310 | - #endif | |
311 | - | |
312 | - /* Needed for old FFmpeg versions as used below */ | |
313 | - #ifdef HAVE_LIBAVCODEC_AVCODEC_H | |
314 | - #include <libavcodec/avcodec.h> | |
315 | - #else | |
316 | - #include <ffmpeg/avcodec.h> | |
317 | - #endif | |
318 | -#else | |
319 | - #include "libavcore/avcore.h" | |
320 | - #include "libavcore/samplefmt.h" | |
321 | -#endif | |
322 | -} | |
323 | - | |
324 | -/* Compatibility for old external FFmpeg versions. */ | |
325 | - | |
326 | -#ifdef USE_EXTERNAL_FFMPEG | |
327 | - | |
328 | -#ifndef LIBAVCORE_VERSION_INT | |
329 | -// API added on: 2010-07-21, removed on 2010-02-15 | |
330 | -#define LIBAVCORE_VERSION_INT 0 | |
331 | -#endif | |
332 | - | |
333 | -#ifndef AV_SAMPLE_FMT_NONE | |
334 | -// API added on: 2010-11-02 | |
335 | -#define AVSampleFormat SampleFormat | |
336 | -#define AV_SAMPLE_FMT_NONE SAMPLE_FMT_NONE | |
337 | -#define AV_SAMPLE_FMT_U8 SAMPLE_FMT_U8 | |
338 | -#define AV_SAMPLE_FMT_S16 SAMPLE_FMT_S16 | |
339 | -#define AV_SAMPLE_FMT_S32 SAMPLE_FMT_S32 | |
340 | -#define AV_SAMPLE_FMT_FLT SAMPLE_FMT_FLT | |
341 | -#define AV_SAMPLE_FMT_DBL SAMPLE_FMT_DBL | |
342 | -#endif | |
343 | - | |
344 | -#ifndef AV_CH_FRONT_LEFT | |
345 | -// API added on: 2010-11-21 | |
346 | -#define AV_CH_FRONT_LEFT CH_FRONT_LEFT | |
347 | -#define AV_CH_FRONT_RIGHT CH_FRONT_RIGHT | |
348 | -#define AV_CH_FRONT_CENTER CH_FRONT_CENTER | |
349 | -#define AV_CH_LOW_FREQUENCY CH_LOW_FREQUENCY | |
350 | -#define AV_CH_BACK_LEFT CH_BACK_LEFT | |
351 | -#define AV_CH_BACK_RIGHT CH_BACK_RIGHT | |
352 | -#define AV_CH_FRONT_LEFT_OF_CENTER CH_FRONT_LEFT_OF_CENTER | |
353 | -#define AV_CH_FRONT_RIGHT_OF_CENTER CH_FRONT_RIGHT_OF_CENTER | |
354 | -#define AV_CH_BACK_CENTER CH_BACK_CENTER | |
355 | -#define AV_CH_SIDE_LEFT CH_SIDE_LEFT | |
356 | -#define AV_CH_SIDE_RIGHT CH_SIDE_RIGHT | |
357 | -#define AV_CH_TOP_CENTER CH_TOP_CENTER | |
358 | -#define AV_CH_TOP_FRONT_LEFT CH_TOP_FRONT_LEFT | |
359 | -#define AV_CH_TOP_FRONT_CENTER CH_TOP_FRONT_CENTER | |
360 | -#define AV_CH_TOP_FRONT_RIGHT CH_TOP_FRONT_RIGHT | |
361 | -#define AV_CH_TOP_BACK_LEFT CH_TOP_BACK_LEFT | |
362 | -#define AV_CH_TOP_BACK_CENTER CH_TOP_BACK_CENTER | |
363 | -#define AV_CH_TOP_BACK_RIGHT CH_TOP_BACK_RIGHT | |
364 | -#define AV_CH_STEREO_LEFT CH_STEREO_LEFT | |
365 | -#define AV_CH_STEREO_RIGHT CH_STEREO_RIGHT | |
366 | - | |
367 | -#define AV_CH_LAYOUT_NATIVE CH_LAYOUT_NATIVE | |
368 | - | |
369 | -#define AV_CH_LAYOUT_MONO CH_LAYOUT_MONO | |
370 | -#define AV_CH_LAYOUT_STEREO CH_LAYOUT_STEREO | |
371 | -#define AV_CH_LAYOUT_2_1 CH_LAYOUT_2_1 | |
372 | -#define AV_CH_LAYOUT_SURROUND CH_LAYOUT_SURROUND | |
373 | -#define AV_CH_LAYOUT_4POINT0 CH_LAYOUT_4POINT0 | |
374 | -#define AV_CH_LAYOUT_2_2 CH_LAYOUT_2_2 | |
375 | -#define AV_CH_LAYOUT_QUAD CH_LAYOUT_QUAD | |
376 | -#define AV_CH_LAYOUT_5POINT0 CH_LAYOUT_5POINT0 | |
377 | -#define AV_CH_LAYOUT_5POINT1 CH_LAYOUT_5POINT1 | |
378 | -#define AV_CH_LAYOUT_5POINT0_BACK CH_LAYOUT_5POINT0_BACK | |
379 | -#define AV_CH_LAYOUT_5POINT1_BACK CH_LAYOUT_5POINT1_BACK | |
380 | -#define AV_CH_LAYOUT_7POINT0 CH_LAYOUT_7POINT0 | |
381 | -#define AV_CH_LAYOUT_7POINT1 CH_LAYOUT_7POINT1 | |
382 | -#define AV_CH_LAYOUT_7POINT1_WIDE CH_LAYOUT_7POINT1_WIDE | |
383 | -#define AV_CH_LAYOUT_STEREO_DOWNMIX CH_LAYOUT_STEREO_DOWNMIX | |
384 | -#endif | |
385 | - | |
386 | -#endif // USE_EXTERNAL_FFMPEG | |
387 | - | |
388 | -class DllAvCoreInterface | |
389 | -{ | |
390 | -public: | |
391 | - virtual ~DllAvCoreInterface() {} | |
392 | - virtual int av_get_bits_per_sample_fmt(enum AVSampleFormat sample_fmt) = 0; | |
393 | -}; | |
394 | - | |
395 | -#if (defined USE_EXTERNAL_FFMPEG) | |
396 | - | |
397 | -// Use direct layer | |
398 | -class DllAvCore : public DllDynamic, DllAvCoreInterface | |
399 | -{ | |
400 | -public: | |
401 | - virtual ~DllAvCore() {} | |
402 | -#if LIBAVCORE_VERSION_INT >= AV_VERSION_INT(0,12,0) || LIBAVUTIL_VERSION_INT >= AV_VERSION_INT(50,38,0) | |
403 | - // API added on: 2010-11-02, moved to libavutil on 2010-02-15 | |
404 | - virtual int av_get_bits_per_sample_fmt(enum AVSampleFormat sample_fmt) { return ::av_get_bits_per_sample_fmt(sample_fmt); } | |
405 | -#else | |
406 | - // from avcodec.h | |
407 | - virtual int av_get_bits_per_sample_fmt(enum AVSampleFormat sample_fmt) { return ::av_get_bits_per_sample_format(sample_fmt); } | |
408 | -#endif | |
409 | - | |
410 | - // DLL faking. | |
411 | - virtual bool ResolveExports() { return true; } | |
412 | - virtual bool Load() { | |
413 | -#if LIBAVCORE_VERSION_INT > 0 | |
414 | - CLog::Log(LOGDEBUG, "DllAvCore: Using libavcore system library"); | |
415 | -#endif | |
416 | - return true; | |
417 | - } | |
418 | - virtual void Unload() {} | |
419 | -}; | |
420 | - | |
421 | -#else | |
422 | - | |
423 | -class DllAvCore : public DllDynamic, DllAvCoreInterface | |
424 | -{ | |
425 | - DECLARE_DLL_WRAPPER(DllAvCore, DLL_PATH_LIBAVCORE) | |
426 | - | |
427 | - LOAD_SYMBOLS() | |
428 | - | |
429 | - DEFINE_METHOD1(int, av_get_bits_per_sample_fmt, (enum AVSampleFormat p1)) | |
430 | - | |
431 | - BEGIN_METHOD_RESOLVE() | |
432 | - RESOLVE_METHOD(av_get_bits_per_sample_fmt) | |
433 | - END_METHOD_RESOLVE() | |
434 | - | |
435 | - /* dependency of libavcore */ | |
436 | - DllAvUtil m_dllAvUtil; | |
437 | - | |
438 | -public: | |
439 | - virtual bool Load() | |
440 | - { | |
441 | - if (!m_dllAvUtil.Load()) | |
442 | - return false; | |
443 | - return DllDynamic::Load(); | |
444 | - } | |
445 | -}; | |
446 | - | |
447 | -#endif | |
448 | - | |
449 | diff -urN xbmc-11.0/lib/DllAvFilter.h xbmc-11.0-ffmpeg-1.0/lib/DllAvFilter.h | |
450 | --- xbmc-11.0/lib/DllAvFilter.h 2012-03-21 23:07:50.000000000 +0100 | |
451 | +++ xbmc-11.0-ffmpeg-1.0/lib/DllAvFilter.h 2012-11-08 23:16:12.336405273 +0100 | |
452 | @@ -24,8 +24,8 @@ | |
453 | #include "config.h" | |
454 | #endif | |
455 | #include "DynamicDll.h" | |
456 | -#include "DllAvCore.h" | |
457 | #include "DllAvCodec.h" | |
458 | +#include "DllSwResample.h" | |
459 | #include "utils/log.h" | |
460 | ||
461 | extern "C" { | |
462 | @@ -43,24 +43,17 @@ | |
463 | #if (defined USE_EXTERNAL_FFMPEG) | |
464 | #if (defined HAVE_LIBAVFILTER_AVFILTER_H) | |
465 | #include <libavfilter/avfiltergraph.h> | |
466 | + #include <libavfilter/buffersink.h> | |
467 | + #include <libavfilter/avcodec.h> | |
468 | #elif (defined HAVE_FFMPEG_AVFILTER_H) | |
469 | #include <ffmpeg/avfiltergraph.h> | |
470 | - #endif | |
471 | - /* for av_vsrc_buffer_add_frame */ | |
472 | - #if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,8,0) | |
473 | - #include <libavfilter/avcodec.h> | |
474 | - #elif LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,7,0) | |
475 | - int av_vsrc_buffer_add_frame(AVFilterContext *buffer_filter, | |
476 | - AVFrame *frame); | |
477 | - #elif LIBAVCODEC_VERSION_INT >= AV_VERSION_INT(53,3,0) | |
478 | - int av_vsrc_buffer_add_frame(AVFilterContext *buffer_filter, | |
479 | - AVFrame *frame, int64_t pts); | |
480 | - #else | |
481 | - int av_vsrc_buffer_add_frame(AVFilterContext *buffer_filter, | |
482 | - AVFrame *frame, int64_t pts, AVRational pixel_aspect); | |
483 | + #include <ffmpeg/buffersink.h> | |
484 | + #include <ffmpeg/avcodec.h> | |
485 | #endif | |
486 | #else | |
487 | #include "libavfilter/avfiltergraph.h" | |
488 | + #include "libavfilter/buffersink.h" | |
489 | + #include "libavfilter/avcodec.h" | |
490 | #endif | |
491 | } | |
492 | ||
493 | @@ -80,20 +73,16 @@ | |
494 | virtual void avfilter_inout_free(AVFilterInOut **inout)=0; | |
495 | virtual int avfilter_graph_parse(AVFilterGraph *graph, const char *filters, AVFilterInOut **inputs, AVFilterInOut **outputs, void *log_ctx)=0; | |
496 | virtual int avfilter_graph_config(AVFilterGraph *graphctx, void *log_ctx)=0; | |
497 | - virtual int avfilter_poll_frame(AVFilterLink *link)=0; | |
498 | - virtual int avfilter_request_frame(AVFilterLink *link)=0; | |
499 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,13,0) | |
500 | +#if LIBAVFILTER_VERSION_INT < AV_VERSION_INT(3,0,0) | |
501 | virtual int av_vsrc_buffer_add_frame(AVFilterContext *buffer_filter, AVFrame *frame, int flags)=0; | |
502 | -#elif LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,7,0) | |
503 | - virtual int av_vsrc_buffer_add_frame(AVFilterContext *buffer_filter, AVFrame *frame)=0; | |
504 | -#elif LIBAVCODEC_VERSION_INT >= AV_VERSION_INT(53,3,0) | |
505 | - virtual int av_vsrc_buffer_add_frame(AVFilterContext *buffer_filter, AVFrame *frame, int64_t pts)=0; | |
506 | #else | |
507 | - virtual int av_vsrc_buffer_add_frame(AVFilterContext *buffer_filter, AVFrame *frame, int64_t pts, AVRational pixel_aspect)=0; | |
508 | + virtual int av_buffersrc_add_frame(AVFilterContext *buffer_filter, AVFrame *frame, int flags)=0; | |
509 | #endif | |
510 | - virtual AVFilterBufferRef *avfilter_get_video_buffer(AVFilterLink *link, int perms, int w, int h)=0; | |
511 | virtual void avfilter_unref_buffer(AVFilterBufferRef *ref)=0; | |
512 | virtual int avfilter_link(AVFilterContext *src, unsigned srcpad, AVFilterContext *dst, unsigned dstpad)=0; | |
513 | + virtual int av_buffersink_get_buffer_ref(AVFilterContext *buffer_sink, AVFilterBufferRef **bufref, int flags)=0; | |
514 | + virtual AVBufferSinkParams *av_buffersink_params_alloc()=0; | |
515 | + virtual int av_buffersink_poll_frame(AVFilterContext *ctx)=0; | |
516 | }; | |
517 | ||
518 | #if (defined USE_EXTERNAL_FFMPEG) | |
519 | @@ -115,12 +104,7 @@ | |
520 | virtual void avfilter_graph_free(AVFilterGraph **graph) | |
521 | { | |
522 | CSingleLock lock(DllAvCodec::m_critSection); | |
523 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(1,76,0) | |
524 | ::avfilter_graph_free(graph); | |
525 | -#else | |
526 | - ::avfilter_graph_free(*graph); | |
527 | - *graph = NULL; | |
528 | -#endif | |
529 | } | |
530 | void avfilter_register_all() | |
531 | { | |
532 | @@ -133,56 +117,32 @@ | |
533 | virtual AVFilterInOut *avfilter_inout_alloc() | |
534 | { | |
535 | CSingleLock lock(DllAvCodec::m_critSection); | |
536 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,17,0) | |
537 | return ::avfilter_inout_alloc(); | |
538 | -#else | |
539 | - return (AVFilterInOut*)::av_mallocz(sizeof(AVFilterInOut)); | |
540 | -#endif | |
541 | } | |
542 | virtual void avfilter_inout_free(AVFilterInOut **inout) | |
543 | { | |
544 | CSingleLock lock(DllAvCodec::m_critSection); | |
545 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,17,0) | |
546 | ::avfilter_inout_free(inout); | |
547 | -#else | |
548 | - *inout = NULL; | |
549 | -#endif | |
550 | } | |
551 | virtual int avfilter_graph_parse(AVFilterGraph *graph, const char *filters, AVFilterInOut **inputs, AVFilterInOut **outputs, void *log_ctx) | |
552 | { | |
553 | CSingleLock lock(DllAvCodec::m_critSection); | |
554 | -#if ( LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(1,79,0) \ | |
555 | - && LIBAVFILTER_VERSION_INT < AV_VERSION_INT(2,0,0) ) \ | |
556 | - ||( LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,16,0)) | |
557 | return ::avfilter_graph_parse(graph, filters, inputs, outputs, log_ctx); | |
558 | -#elif LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,15,1) | |
559 | - return ::avfilter_graph_parse(graph, filters, *inputs, *outputs, log_ctx); | |
560 | -#else | |
561 | - return ::avfilter_graph_parse(graph, filters, *inputs, *outputs, (AVClass*)log_ctx); | |
562 | -#endif | |
563 | } | |
564 | virtual int avfilter_graph_config(AVFilterGraph *graphctx, void *log_ctx) | |
565 | { | |
566 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,15,1) | |
567 | return ::avfilter_graph_config(graphctx, log_ctx); | |
568 | -#else | |
569 | - return ::avfilter_graph_config(graphctx, (AVClass*)log_ctx); | |
570 | -#endif | |
571 | } | |
572 | - virtual int avfilter_poll_frame(AVFilterLink *link) { return ::avfilter_poll_frame(link); } | |
573 | - virtual int avfilter_request_frame(AVFilterLink *link) { return ::avfilter_request_frame(link); } | |
574 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,13,0) | |
575 | +#if LIBAVFILTER_VERSION_INT < AV_VERSION_INT(3,0,0) | |
576 | virtual int av_vsrc_buffer_add_frame(AVFilterContext *buffer_filter, AVFrame *frame, int flags) { return ::av_vsrc_buffer_add_frame(buffer_filter, frame, flags); } | |
577 | -#elif LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,7,0) | |
578 | - virtual int av_vsrc_buffer_add_frame(AVFilterContext *buffer_filter, AVFrame *frame) { return ::av_vsrc_buffer_add_frame(buffer_filter, frame); } | |
579 | -#elif LIBAVCODEC_VERSION_INT >= AV_VERSION_INT(53,3,0) | |
580 | - virtual int av_vsrc_buffer_add_frame(AVFilterContext *buffer_filter, AVFrame *frame, int64_t pts) { return ::av_vsrc_buffer_add_frame(buffer_filter, frame, pts); } | |
581 | #else | |
582 | - virtual int av_vsrc_buffer_add_frame(AVFilterContext *buffer_filter, AVFrame *frame, int64_t pts, AVRational pixel_aspect) { return ::av_vsrc_buffer_add_frame(buffer_filter, frame, pts, pixel_aspect); } | |
583 | + virtual int av_buffersrc_add_frame(AVFilterContext *buffer_filter, AVFrame* frame, int flags) { return ::av_buffersrc_add_frame(buffer_filter, frame, flags); } | |
584 | #endif | |
585 | - virtual AVFilterBufferRef *avfilter_get_video_buffer(AVFilterLink *link, int perms, int w, int h) { return ::avfilter_get_video_buffer(link, perms, w, h); } | |
586 | virtual void avfilter_unref_buffer(AVFilterBufferRef *ref) { ::avfilter_unref_buffer(ref); } | |
587 | virtual int avfilter_link(AVFilterContext *src, unsigned srcpad, AVFilterContext *dst, unsigned dstpad) { return ::avfilter_link(src, srcpad, dst, dstpad); } | |
588 | + virtual int av_buffersink_get_buffer_ref(AVFilterContext *buffer_sink, AVFilterBufferRef **bufref, int flags) { return ::av_buffersink_get_buffer_ref(buffer_sink, bufref, flags); } | |
589 | + virtual AVBufferSinkParams *av_buffersink_params_alloc() { return ::av_buffersink_params_alloc(); } | |
590 | + virtual int av_buffersink_poll_frame(AVFilterContext *ctx) { return av_buffersink_poll_frame(ctx); } | |
591 | // DLL faking. | |
592 | virtual bool ResolveExports() { return true; } | |
593 | virtual bool Load() { | |
594 | @@ -200,45 +160,25 @@ | |
595 | ||
596 | DEFINE_METHOD3(int, avfilter_open_dont_call, (AVFilterContext **p1, AVFilter *p2, const char *p3)) | |
597 | DEFINE_METHOD1(void, avfilter_free_dont_call, (AVFilterContext *p1)) | |
598 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(1,76,0) | |
599 | DEFINE_METHOD1(void, avfilter_graph_free_dont_call, (AVFilterGraph **p1)) | |
600 | -#else | |
601 | - DEFINE_METHOD1(void, avfilter_graph_free_dont_call, (AVFilterGraph *p1)) | |
602 | -#endif | |
603 | DEFINE_METHOD0(void, avfilter_register_all_dont_call) | |
604 | DEFINE_METHOD6(int, avfilter_graph_create_filter, (AVFilterContext **p1, AVFilter *p2, const char *p3, const char *p4, void *p5, AVFilterGraph *p6)) | |
605 | DEFINE_METHOD1(AVFilter*, avfilter_get_by_name, (const char *p1)) | |
606 | DEFINE_METHOD0(AVFilterGraph*, avfilter_graph_alloc) | |
607 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,17,0) | |
608 | DEFINE_METHOD0(AVFilterInOut*, avfilter_inout_alloc_dont_call) | |
609 | DEFINE_METHOD1(void, avfilter_inout_free_dont_call, (AVFilterInOut **p1)) | |
610 | -#endif | |
611 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,16,0) | |
612 | - DEFINE_METHOD5(int, avfilter_graph_parse_dont_call, (AVFilterGraph *p1, const char *p2, AVFilterInOut **p3, AVFilterInOut **p4, void *p5)) | |
613 | -#elif LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,15,1) | |
614 | - DEFINE_METHOD5(int, avfilter_graph_parse_dont_call, (AVFilterGraph *p1, const char *p2, AVFilterInOut *p3, AVFilterInOut *p4, void *p5)) | |
615 | -#else | |
616 | - DEFINE_METHOD5(int, avfilter_graph_parse_dont_call, (AVFilterGraph *p1, const char *p2, AVFilterInOut *p3, AVFilterInOut *p4, AVClass *p5)) | |
617 | -#endif | |
618 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,15,1) | |
619 | - DEFINE_METHOD2(int, avfilter_graph_config_dont_call, (AVFilterGraph *p1, void *p2)) | |
620 | -#else | |
621 | - DEFINE_METHOD2(int, avfilter_graph_config_dont_call, (AVFilterGraph *p1, AVClass *p2)) | |
622 | -#endif | |
623 | - DEFINE_FUNC_ALIGNED1(int, __cdecl, avfilter_poll_frame, AVFilterLink *) | |
624 | - DEFINE_FUNC_ALIGNED1(int, __cdecl, avfilter_request_frame, AVFilterLink*) | |
625 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,13,0) | |
626 | + DEFINE_FUNC_ALIGNED5(int, __cdecl, avfilter_graph_parse_dont_call, AVFilterGraph *, const char *, AVFilterInOut **, AVFilterInOut **, void *) | |
627 | + DEFINE_FUNC_ALIGNED2(int, __cdecl, avfilter_graph_config_dont_call, AVFilterGraph *, void *) | |
628 | +#if LIBAVFILTER_VERSION_INT < AV_VERSION_INT(3,0,0) | |
629 | DEFINE_METHOD3(int, av_vsrc_buffer_add_frame, (AVFilterContext *p1, AVFrame *p2, int p3)) | |
630 | -#elif LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,7,0) | |
631 | - DEFINE_METHOD2(int, av_vsrc_buffer_add_frame, (AVFilterContext *p1, AVFrame *p2)) | |
632 | -#elif LIBAVCODEC_VERSION_INT >= AV_VERSION_INT(53,3,0) | |
633 | - DEFINE_METHOD3(int, av_vsrc_buffer_add_frame, (AVFilterContext *p1, AVFrame *p2, int64_t p3)) | |
634 | #else | |
635 | - DEFINE_METHOD4(int, av_vsrc_buffer_add_frame, (AVFilterContext *p1, AVFrame *p2, int64_t p3, AVRational p4)) | |
636 | + DEFINE_METHOD3(int, av_buffersrc_add_frame, (AVFilterContext *p1, AVFrame *p2, int p3)) | |
637 | #endif | |
638 | - DEFINE_METHOD4(AVFilterBufferRef*, avfilter_get_video_buffer, (AVFilterLink *p1, int p2, int p3, int p4)) | |
639 | DEFINE_METHOD1(void, avfilter_unref_buffer, (AVFilterBufferRef *p1)) | |
640 | DEFINE_METHOD4(int, avfilter_link, (AVFilterContext *p1, unsigned p2, AVFilterContext *p3, unsigned p4)) | |
641 | + DEFINE_FUNC_ALIGNED3(int , __cdecl, av_buffersink_get_buffer_ref, AVFilterContext *, AVFilterBufferRef **, int); | |
642 | + DEFINE_FUNC_ALIGNED0(AVBufferSinkParams*, __cdecl, av_buffersink_params_alloc); | |
643 | + DEFINE_FUNC_ALIGNED1(int , __cdecl, av_buffersink_poll_frame, AVFilterContext *); | |
644 | ||
645 | BEGIN_METHOD_RESOLVE() | |
646 | RESOLVE_METHOD_RENAME(avfilter_open, avfilter_open_dont_call) | |
647 | @@ -248,22 +188,25 @@ | |
648 | RESOLVE_METHOD(avfilter_graph_create_filter) | |
649 | RESOLVE_METHOD(avfilter_get_by_name) | |
650 | RESOLVE_METHOD(avfilter_graph_alloc) | |
651 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,17,0) | |
652 | RESOLVE_METHOD_RENAME(avfilter_inout_alloc, avfilter_inout_alloc_dont_call) | |
653 | RESOLVE_METHOD_RENAME(avfilter_inout_free, avfilter_inout_free_dont_call) | |
654 | -#endif | |
655 | RESOLVE_METHOD_RENAME(avfilter_graph_parse, avfilter_graph_parse_dont_call) | |
656 | RESOLVE_METHOD_RENAME(avfilter_graph_config, avfilter_graph_config_dont_call) | |
657 | - RESOLVE_METHOD(avfilter_poll_frame) | |
658 | - RESOLVE_METHOD(avfilter_request_frame) | |
659 | +#if LIBAVFILTER_VERSION_INT < AV_VERSION_INT(3,0,0) | |
660 | RESOLVE_METHOD(av_vsrc_buffer_add_frame) | |
661 | - RESOLVE_METHOD(avfilter_get_video_buffer) | |
662 | +#else | |
663 | + RESOLVE_METHOD(av_buffersrc_add_frame) | |
664 | +#endif | |
665 | RESOLVE_METHOD(avfilter_unref_buffer) | |
666 | RESOLVE_METHOD(avfilter_link) | |
667 | + RESOLVE_METHOD(av_buffersink_get_buffer_ref) | |
668 | + RESOLVE_METHOD(av_buffersink_params_alloc) | |
669 | + RESOLVE_METHOD(av_buffersink_poll_frame) | |
670 | END_METHOD_RESOLVE() | |
671 | ||
672 | /* dependencies of libavfilter */ | |
673 | DllAvUtil m_dllAvUtil; | |
674 | + DllSwResample m_dllSwResample; | |
675 | ||
676 | public: | |
677 | int avfilter_open(AVFilterContext **filter_ctx, AVFilter *filter, const char *inst_name) | |
678 | @@ -279,12 +222,7 @@ | |
679 | void avfilter_graph_free(AVFilterGraph **graph) | |
680 | { | |
681 | CSingleLock lock(DllAvCodec::m_critSection); | |
682 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(1,76,0) | |
683 | avfilter_graph_free_dont_call(graph); | |
684 | -#else | |
685 | - avfilter_graph_free_dont_call(*graph); | |
686 | - m_dllAvUtil.av_freep(graph); | |
687 | -#endif | |
688 | } | |
689 | void avfilter_register_all() | |
690 | { | |
691 | @@ -294,45 +232,29 @@ | |
692 | AVFilterInOut* avfilter_inout_alloc() | |
693 | { | |
694 | CSingleLock lock(DllAvCodec::m_critSection); | |
695 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,17,0) | |
696 | return avfilter_inout_alloc_dont_call(); | |
697 | -#else | |
698 | - return (AVFilterInOut*)m_dllAvUtil.av_mallocz(sizeof(AVFilterInOut)); | |
699 | -#endif | |
700 | } | |
701 | int avfilter_graph_parse(AVFilterGraph *graph, const char *filters, AVFilterInOut **inputs, AVFilterInOut **outputs, void *log_ctx) | |
702 | { | |
703 | CSingleLock lock(DllAvCodec::m_critSection); | |
704 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,16,0) | |
705 | return avfilter_graph_parse_dont_call(graph, filters, inputs, outputs, log_ctx); | |
706 | -#elif LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,15,1) | |
707 | - return avfilter_graph_parse_dont_call(graph, filters, *inputs, *outputs, log_ctx); | |
708 | -#else | |
709 | - return avfilter_graph_parse_dont_call(graph, filters, *inputs, *outputs, (AVClass*)log_ctx); | |
710 | -#endif | |
711 | } | |
712 | void avfilter_inout_free(AVFilterInOut **inout) | |
713 | { | |
714 | CSingleLock lock(DllAvCodec::m_critSection); | |
715 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,17,0) | |
716 | avfilter_inout_free_dont_call(inout); | |
717 | -#else | |
718 | - *inout = NULL; | |
719 | -#endif | |
720 | } | |
721 | int avfilter_graph_config(AVFilterGraph *graphctx, void *log_ctx) | |
722 | { | |
723 | CSingleLock lock(DllAvCodec::m_critSection); | |
724 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,15,1) | |
725 | return avfilter_graph_config_dont_call(graphctx, log_ctx); | |
726 | -#else | |
727 | - return avfilter_graph_config_dont_call(graphctx, (AVClass*)log_ctx); | |
728 | -#endif | |
729 | } | |
730 | virtual bool Load() | |
731 | { | |
732 | if (!m_dllAvUtil.Load()) | |
733 | return false; | |
734 | + if (!m_dllSwResample.Load()) | |
735 | + return false; | |
736 | return DllDynamic::Load(); | |
737 | } | |
738 | }; | |
739 | diff -urN xbmc-11.0/lib/DllAvFormat.h xbmc-11.0-ffmpeg-1.0/lib/DllAvFormat.h | |
740 | --- xbmc-11.0/lib/DllAvFormat.h 2012-03-21 23:07:50.000000000 +0100 | |
741 | +++ xbmc-11.0-ffmpeg-1.0/lib/DllAvFormat.h 2012-11-08 23:16:03.529738917 +0100 | |
742 | @@ -62,54 +62,42 @@ | |
743 | virtual ~DllAvFormatInterface() {} | |
744 | virtual void av_register_all_dont_call(void)=0; | |
745 | virtual AVInputFormat *av_find_input_format(const char *short_name)=0; | |
746 | - virtual int url_feof(ByteIOContext *s)=0; | |
747 | - virtual AVMetadataTag *av_metadata_get(AVMetadata *m, const char *key, const AVMetadataTag *prev, int flags)=0; | |
748 | - virtual void av_close_input_file(AVFormatContext *s)=0; | |
749 | - virtual void av_close_input_stream(AVFormatContext *s)=0; | |
750 | + virtual int url_feof(AVIOContext *s)=0; | |
751 | + virtual void avformat_close_input(AVFormatContext **s)=0; | |
752 | virtual int av_read_frame(AVFormatContext *s, AVPacket *pkt)=0; | |
753 | virtual void av_read_frame_flush(AVFormatContext *s)=0; | |
754 | virtual int av_read_play(AVFormatContext *s)=0; | |
755 | virtual int av_read_pause(AVFormatContext *s)=0; | |
756 | virtual int av_seek_frame(AVFormatContext *s, int stream_index, int64_t timestamp, int flags)=0; | |
757 | #if (!defined USE_EXTERNAL_FFMPEG) | |
758 | - virtual int av_find_stream_info_dont_call(AVFormatContext *ic)=0; | |
759 | + virtual int avformat_find_stream_info_dont_call(AVFormatContext *ic, AVDictionary **options)=0; | |
760 | #endif | |
761 | - virtual int av_open_input_file(AVFormatContext **ic_ptr, const char *filename, AVInputFormat *fmt, int buf_size, AVFormatParameters *ap)=0; | |
762 | - virtual void url_set_interrupt_cb(URLInterruptCB *interrupt_cb)=0; | |
763 | - virtual int av_open_input_stream(AVFormatContext **ic_ptr, ByteIOContext *pb, const char *filename, AVInputFormat *fmt, AVFormatParameters *ap)=0; | |
764 | - virtual int init_put_byte(ByteIOContext *s, unsigned char *buffer, int buffer_size, int write_flag, void *opaque, | |
765 | + virtual int avformat_open_input(AVFormatContext **ps, const char *filename, AVInputFormat *fmt, AVDictionary **options)=0; | |
766 | + virtual AVIOContext *avio_alloc_context(unsigned char *buffer, int buffer_size, int write_flag, void *opaque, | |
767 | int (*read_packet)(void *opaque, uint8_t *buf, int buf_size), | |
768 | int (*write_packet)(void *opaque, uint8_t *buf, int buf_size), | |
769 | offset_t (*seek)(void *opaque, offset_t offset, int whence))=0; | |
770 | virtual AVInputFormat *av_probe_input_format(AVProbeData *pd, int is_opened)=0; | |
771 | virtual AVInputFormat *av_probe_input_format2(AVProbeData *pd, int is_opened, int *score_max)=0; | |
772 | - virtual int av_probe_input_buffer(ByteIOContext *pb, AVInputFormat **fmt, const char *filename, void *logctx, unsigned int offset, unsigned int max_probe_size)=0; | |
773 | - virtual void dump_format(AVFormatContext *ic, int index, const char *url, int is_output)=0; | |
774 | - virtual int url_fdopen(ByteIOContext **s, URLContext *h)=0; | |
775 | - virtual int url_fopen(ByteIOContext **s, const char *filename, int flags)=0; | |
776 | - virtual int url_fclose(ByteIOContext *s)=0; | |
777 | - virtual int url_open_dyn_buf(ByteIOContext **s)=0; | |
778 | - virtual int url_close_dyn_buf(ByteIOContext *s, uint8_t **pbuffer)=0; | |
779 | - virtual offset_t url_fseek(ByteIOContext *s, offset_t offset, int whence)=0; | |
780 | - virtual int get_buffer(ByteIOContext *s, unsigned char *buf, int size)=0; | |
781 | - virtual int get_partial_buffer(ByteIOContext *s, unsigned char *buf, int size)=0; | |
782 | - virtual void put_byte(ByteIOContext *s, int b)=0; | |
783 | - virtual void put_buffer(ByteIOContext *s, const unsigned char *buf, int size)=0; | |
784 | - virtual void put_be24(ByteIOContext *s, unsigned int val)=0; | |
785 | - virtual void put_be32(ByteIOContext *s, unsigned int val)=0; | |
786 | - virtual void put_be16(ByteIOContext *s, unsigned int val)=0; | |
787 | + virtual int av_probe_input_buffer(AVIOContext *pb, AVInputFormat **fmt, const char *filename, void *logctx, unsigned int offset, unsigned int max_probe_size)=0; | |
788 | + virtual void av_dump_format(AVFormatContext *ic, int index, const char *url, int is_output)=0; | |
789 | + virtual int avio_open(AVIOContext **s, const char *filename, int flags)=0; | |
790 | + virtual int avio_close(AVIOContext *s)=0; | |
791 | + virtual int avio_open_dyn_buf(AVIOContext **s)=0; | |
792 | + virtual int avio_close_dyn_buf(AVIOContext *s, uint8_t **pbuffer)=0; | |
793 | + virtual offset_t avio_seek(AVIOContext *s, offset_t offset, int whence)=0; | |
794 | + virtual int avio_read(AVIOContext *s, unsigned char *buf, int size)=0; | |
795 | + virtual void avio_w8(AVIOContext *s, int b)=0; | |
796 | + virtual void avio_write(AVIOContext *s, const unsigned char *buf, int size)=0; | |
797 | + virtual void avio_wb24(AVIOContext *s, unsigned int val)=0; | |
798 | + virtual void avio_wb32(AVIOContext *s, unsigned int val)=0; | |
799 | + virtual void avio_wb16(AVIOContext *s, unsigned int val)=0; | |
800 | virtual AVFormatContext *avformat_alloc_context(void)=0; | |
801 | - virtual AVStream *av_new_stream(AVFormatContext *s, int id)=0; | |
802 | + virtual AVStream *avformat_new_stream(AVFormatContext *s, AVCodec *c)=0; | |
803 | virtual AVOutputFormat *av_guess_format(const char *short_name, const char *filename, const char *mime_type)=0; | |
804 | - virtual int av_set_parameters(AVFormatContext *s, AVFormatParameters *ap)=0; | |
805 | - virtual ByteIOContext *av_alloc_put_byte(unsigned char *buffer, int buffer_size, int write_flag, void *opaque, | |
806 | - int (*read_packet)(void *opaque, uint8_t *buf, int buf_size), | |
807 | - int (*write_packet)(void *opaque, uint8_t *buf, int buf_size), | |
808 | - offset_t (*seek)(void *opaque, offset_t offset, int whence))=0; | |
809 | - virtual int av_write_header (AVFormatContext *s)=0; | |
810 | + virtual int avformat_write_header (AVFormatContext *s, AVDictionary **options)=0; | |
811 | virtual int av_write_trailer(AVFormatContext *s)=0; | |
812 | virtual int av_write_frame (AVFormatContext *s, AVPacket *pkt)=0; | |
813 | - virtual int av_metadata_set2(AVMetadata **pm, const char *key, const char *value, int flags)=0; | |
814 | }; | |
815 | ||
816 | #if (defined USE_EXTERNAL_FFMPEG) | |
817 | @@ -126,78 +114,45 @@ | |
818 | } | |
819 | virtual void av_register_all_dont_call() { *(int* )0x0 = 0; } | |
820 | virtual AVInputFormat *av_find_input_format(const char *short_name) { return ::av_find_input_format(short_name); } | |
821 | - virtual int url_feof(ByteIOContext *s) { return ::url_feof(s); } | |
822 | -#if LIBAVFORMAT_VERSION_INT >= AV_VERSION_INT(52,31,0) | |
823 | - // API added on: 2009-03-01 | |
824 | - virtual AVMetadataTag *av_metadata_get(AVMetadata *m, const char *key, const AVMetadataTag *prev, int flags){ return ::av_metadata_get(m, key, prev, flags); } | |
825 | -#else | |
826 | - virtual AVMetadataTag *av_metadata_get(AVMetadata *m, const char *key, const AVMetadataTag *prev, int flags){ return NULL; } | |
827 | -#endif | |
828 | - virtual void av_close_input_file(AVFormatContext *s) { ::av_close_input_file(s); } | |
829 | - virtual void av_close_input_stream(AVFormatContext *s) { ::av_close_input_stream(s); } | |
830 | + virtual int url_feof(AVIOContext *s) { return ::url_feof(s); } | |
831 | + virtual void avformat_close_input(AVFormatContext **s) { ::avformat_close_input(s); } | |
832 | virtual int av_read_frame(AVFormatContext *s, AVPacket *pkt) { return ::av_read_frame(s, pkt); } | |
833 | virtual void av_read_frame_flush(AVFormatContext *s) { ::av_read_frame_flush(s); } | |
834 | virtual int av_read_play(AVFormatContext *s) { return ::av_read_play(s); } | |
835 | virtual int av_read_pause(AVFormatContext *s) { return ::av_read_pause(s); } | |
836 | virtual int av_seek_frame(AVFormatContext *s, int stream_index, int64_t timestamp, int flags) { return ::av_seek_frame(s, stream_index, timestamp, flags); } | |
837 | - virtual int av_find_stream_info(AVFormatContext *ic) | |
838 | + virtual int avformat_find_stream_info(AVFormatContext *ic, AVDictionary **options) | |
839 | { | |
840 | CSingleLock lock(DllAvCodec::m_critSection); | |
841 | - return ::av_find_stream_info(ic); | |
842 | + return ::avformat_find_stream_info(ic, options); | |
843 | } | |
844 | - virtual int av_open_input_file(AVFormatContext **ic_ptr, const char *filename, AVInputFormat *fmt, int buf_size, AVFormatParameters *ap) { return ::av_open_input_file(ic_ptr, filename, fmt, buf_size, ap); } | |
845 | - virtual void url_set_interrupt_cb(URLInterruptCB *interrupt_cb) { ::url_set_interrupt_cb(interrupt_cb); } | |
846 | - virtual int av_open_input_stream(AVFormatContext **ic_ptr, ByteIOContext *pb, const char *filename, AVInputFormat *fmt, AVFormatParameters *ap) { return ::av_open_input_stream(ic_ptr, pb, filename, fmt, ap); } | |
847 | - virtual int init_put_byte(ByteIOContext *s, unsigned char *buffer, int buffer_size, int write_flag, void *opaque, | |
848 | + virtual int avformat_open_input(AVFormatContext **ps, const char *filename, AVInputFormat *fmt, AVDictionary **options) | |
849 | + { return ::avformat_open_input(ps, filename, fmt, options); } | |
850 | + virtual AVIOContext *avio_alloc_context(unsigned char *buffer, int buffer_size, int write_flag, void *opaque, | |
851 | int (*read_packet)(void *opaque, uint8_t *buf, int buf_size), | |
852 | int (*write_packet)(void *opaque, uint8_t *buf, int buf_size), | |
853 | - offset_t (*seek)(void *opaque, offset_t offset, int whence)) { return ::init_put_byte(s, buffer, buffer_size, write_flag, opaque, read_packet, write_packet, seek); } | |
854 | + offset_t (*seek)(void *opaque, offset_t offset, int whence)) { return ::avio_alloc_context(buffer, buffer_size, write_flag, opaque, read_packet, write_packet, seek); } | |
855 | virtual AVInputFormat *av_probe_input_format(AVProbeData *pd, int is_opened) {return ::av_probe_input_format(pd, is_opened); } | |
856 | virtual AVInputFormat *av_probe_input_format2(AVProbeData *pd, int is_opened, int *score_max) {*score_max = 100; return ::av_probe_input_format(pd, is_opened); } // Use av_probe_input_format, this is not exported by ffmpeg's headers | |
857 | -#if LIBAVFORMAT_VERSION_INT >= AV_VERSION_INT(52,98,0) | |
858 | - // API added on: 2010-02-08 | |
859 | - virtual int av_probe_input_buffer(ByteIOContext *pb, AVInputFormat **fmt, const char *filename, void *logctx, unsigned int offset, unsigned int max_probe_size) { return ::av_probe_input_buffer(pb, fmt, filename, logctx, offset, max_probe_size); } | |
860 | -#else | |
861 | - virtual int av_probe_input_buffer(ByteIOContext *pb, AVInputFormat **fmt, const char *filename, void *logctx, unsigned int offset, unsigned int max_probe_size) { return -1; } | |
862 | -#endif | |
863 | - virtual void dump_format(AVFormatContext *ic, int index, const char *url, int is_output) { ::dump_format(ic, index, url, is_output); } | |
864 | - virtual int url_fdopen(ByteIOContext **s, URLContext *h) { return ::url_fdopen(s, h); } | |
865 | - virtual int url_fopen(ByteIOContext **s, const char *filename, int flags) { return ::url_fopen(s, filename, flags); } | |
866 | - virtual int url_fclose(ByteIOContext *s) { return ::url_fclose(s); } | |
867 | - virtual int url_open_dyn_buf(ByteIOContext **s) { return ::url_open_dyn_buf(s); } | |
868 | - virtual int url_close_dyn_buf(ByteIOContext *s, uint8_t **pbuffer) { return ::url_close_dyn_buf(s, pbuffer); } | |
869 | - virtual offset_t url_fseek(ByteIOContext *s, offset_t offset, int whence) { return ::url_fseek(s, offset, whence); } | |
870 | - virtual int get_buffer(ByteIOContext *s, unsigned char *buf, int size) { return ::get_buffer(s, buf, size); } | |
871 | - virtual int get_partial_buffer(ByteIOContext *s, unsigned char *buf, int size) { return ::get_partial_buffer(s, buf, size); } | |
872 | - virtual void put_byte(ByteIOContext *s, int b) { ::put_byte(s, b); } | |
873 | - virtual void put_buffer(ByteIOContext *s, const unsigned char *buf, int size) { ::put_buffer(s, buf, size); } | |
874 | - virtual void put_be24(ByteIOContext *s, unsigned int val) { ::put_be24(s, val); } | |
875 | - virtual void put_be32(ByteIOContext *s, unsigned int val) { ::put_be32(s, val); } | |
876 | - virtual void put_be16(ByteIOContext *s, unsigned int val) { ::put_be16(s, val); } | |
877 | + virtual int av_probe_input_buffer(AVIOContext *pb, AVInputFormat **fmt, const char *filename, void *logctx, unsigned int offset, unsigned int max_probe_size) { return ::av_probe_input_buffer(pb, fmt, filename, logctx, offset, max_probe_size); } | |
878 | + virtual void av_dump_format(AVFormatContext *ic, int index, const char *url, int is_output) { ::av_dump_format(ic, index, url, is_output); } | |
879 | + virtual int avio_open(AVIOContext **s, const char *filename, int flags) { return ::avio_open(s, filename, flags); } | |
880 | + virtual int avio_close(AVIOContext *s) { return ::avio_close(s); } | |
881 | + virtual int avio_open_dyn_buf(AVIOContext **s) { return ::avio_open_dyn_buf(s); } | |
882 | + virtual int avio_close_dyn_buf(AVIOContext *s, uint8_t **pbuffer) { return ::avio_close_dyn_buf(s, pbuffer); } | |
883 | + virtual offset_t avio_seek(AVIOContext *s, offset_t offset, int whence) { return ::avio_seek(s, offset, whence); } | |
884 | + virtual int avio_read(AVIOContext *s, unsigned char *buf, int size) { return ::avio_read(s, buf, size); } | |
885 | + virtual void avio_w8(AVIOContext *s, int b) { ::avio_w8(s, b); } | |
886 | + virtual void avio_write(AVIOContext *s, const unsigned char *buf, int size) { ::avio_write(s, buf, size); } | |
887 | + virtual void avio_wb24(AVIOContext *s, unsigned int val) { ::avio_wb24(s, val); } | |
888 | + virtual void avio_wb32(AVIOContext *s, unsigned int val) { ::avio_wb32(s, val); } | |
889 | + virtual void avio_wb16(AVIOContext *s, unsigned int val) { ::avio_wb16(s, val); } | |
890 | virtual AVFormatContext *avformat_alloc_context() { return ::avformat_alloc_context(); } | |
891 | - virtual AVStream *av_new_stream(AVFormatContext *s, int id) { return ::av_new_stream(s, id); } | |
892 | -#if LIBAVFORMAT_VERSION_INT < (52<<16 | 45<<8) | |
893 | - virtual AVOutputFormat *av_guess_format(const char *short_name, const char *filename, const char *mime_type) { return ::guess_format(short_name, filename, mime_type); } | |
894 | -#else | |
895 | + virtual AVStream *avformat_new_stream(AVFormatContext *s, AVCodec *c) { return ::avformat_new_stream(s, c); } | |
896 | virtual AVOutputFormat *av_guess_format(const char *short_name, const char *filename, const char *mime_type) { return ::av_guess_format(short_name, filename, mime_type); } | |
897 | -#endif | |
898 | - virtual int av_set_parameters(AVFormatContext *s, AVFormatParameters *ap) { return ::av_set_parameters(s, ap); } | |
899 | - virtual ByteIOContext *av_alloc_put_byte(unsigned char *buffer, int buffer_size, int write_flag, void *opaque, | |
900 | - int (*read_packet)(void *opaque, uint8_t *buf, int buf_size), | |
901 | - int (*write_packet)(void *opaque, uint8_t *buf, int buf_size), | |
902 | - offset_t (*seek)(void *opaque, offset_t offset, int whence)) { return ::av_alloc_put_byte(buffer, buffer_size, write_flag, opaque, read_packet, write_packet, seek); } | |
903 | - virtual int av_write_header (AVFormatContext *s) { return ::av_write_header (s); } | |
904 | + virtual int avformat_write_header (AVFormatContext *s, AVDictionary **options) { return ::avformat_write_header (s, options); } | |
905 | virtual int av_write_trailer(AVFormatContext *s) { return ::av_write_trailer(s); } | |
906 | virtual int av_write_frame (AVFormatContext *s, AVPacket *pkt) { return ::av_write_frame(s, pkt); } | |
907 | -#if LIBAVFORMAT_VERSION_INT >= AV_VERSION_INT(52,43,0) | |
908 | - // API added on: 2009-12-13 | |
909 | - virtual int av_metadata_set2(AVMetadata **pm, const char *key, const char *value, int flags) { return ::av_metadata_set2(pm, key, value, flags); } | |
910 | -#elif LIBAVFORMAT_VERSION_INT >= AV_VERSION_INT(52,31,0) | |
911 | - // API added on: 2009-03-01 | |
912 | - virtual int av_metadata_set2(AVMetadata **pm, const char *key, const char *value, int flags) { return ::av_metadata_set(pm, key, value); } | |
913 | -#else | |
914 | - virtual int av_metadata_set2(AVMetadata **pm, const char *key, const char *value, int flags) { return -1; } | |
915 | -#endif | |
916 | ||
917 | // DLL faking. | |
918 | virtual bool ResolveExports() { return true; } | |
919 | @@ -218,108 +173,78 @@ | |
920 | ||
921 | DEFINE_METHOD0(void, av_register_all_dont_call) | |
922 | DEFINE_METHOD1(AVInputFormat*, av_find_input_format, (const char *p1)) | |
923 | - DEFINE_METHOD1(int, url_feof, (ByteIOContext *p1)) | |
924 | - DEFINE_METHOD4(AVMetadataTag*, av_metadata_get, (AVMetadata *p1, const char *p2, const AVMetadataTag *p3, int p4)) | |
925 | - DEFINE_METHOD1(void, av_close_input_file, (AVFormatContext *p1)) | |
926 | - DEFINE_METHOD1(void, av_close_input_stream, (AVFormatContext *p1)) | |
927 | + DEFINE_METHOD1(int, url_feof, (AVIOContext *p1)) | |
928 | + DEFINE_METHOD1(void, avformat_close_input, (AVFormatContext **p1)) | |
929 | DEFINE_METHOD1(int, av_read_play, (AVFormatContext *p1)) | |
930 | DEFINE_METHOD1(int, av_read_pause, (AVFormatContext *p1)) | |
931 | DEFINE_METHOD1(void, av_read_frame_flush, (AVFormatContext *p1)) | |
932 | DEFINE_FUNC_ALIGNED2(int, __cdecl, av_read_frame, AVFormatContext *, AVPacket *) | |
933 | DEFINE_FUNC_ALIGNED4(int, __cdecl, av_seek_frame, AVFormatContext*, int, int64_t, int) | |
934 | - DEFINE_FUNC_ALIGNED1(int, __cdecl, av_find_stream_info_dont_call, AVFormatContext*) | |
935 | - DEFINE_FUNC_ALIGNED5(int, __cdecl, av_open_input_file, AVFormatContext**, const char *, AVInputFormat *, int, AVFormatParameters *) | |
936 | - DEFINE_FUNC_ALIGNED5(int,__cdecl, av_open_input_stream, AVFormatContext **, ByteIOContext *, const char *, AVInputFormat *, AVFormatParameters *) | |
937 | + DEFINE_FUNC_ALIGNED2(int, __cdecl, avformat_find_stream_info_dont_call, AVFormatContext*, AVDictionary **) | |
938 | + DEFINE_FUNC_ALIGNED4(int, __cdecl, avformat_open_input, AVFormatContext **, const char *, AVInputFormat *, AVDictionary **) | |
939 | DEFINE_FUNC_ALIGNED2(AVInputFormat*, __cdecl, av_probe_input_format, AVProbeData*, int) | |
940 | DEFINE_FUNC_ALIGNED3(AVInputFormat*, __cdecl, av_probe_input_format2, AVProbeData*, int, int*) | |
941 | - DEFINE_FUNC_ALIGNED6(int, __cdecl, av_probe_input_buffer, ByteIOContext *, AVInputFormat **, const char *, void *, unsigned int, unsigned int) | |
942 | - DEFINE_FUNC_ALIGNED3(int, __cdecl, get_buffer, ByteIOContext*, unsigned char *, int) | |
943 | - DEFINE_FUNC_ALIGNED3(int, __cdecl, get_partial_buffer, ByteIOContext*, unsigned char *, int) | |
944 | - DEFINE_FUNC_ALIGNED2(void, __cdecl, put_byte, ByteIOContext*, int) | |
945 | - DEFINE_FUNC_ALIGNED3(void, __cdecl, put_buffer, ByteIOContext*, const unsigned char *, int) | |
946 | - DEFINE_FUNC_ALIGNED2(void, __cdecl, put_be24, ByteIOContext*, unsigned int) | |
947 | - DEFINE_FUNC_ALIGNED2(void, __cdecl, put_be32, ByteIOContext*, unsigned int) | |
948 | - DEFINE_FUNC_ALIGNED2(void, __cdecl, put_be16, ByteIOContext*, unsigned int) | |
949 | - DEFINE_METHOD1(void, url_set_interrupt_cb, (URLInterruptCB *p1)) | |
950 | - DEFINE_METHOD8(int, init_put_byte, (ByteIOContext *p1, unsigned char *p2, int p3, int p4, void *p5, | |
951 | + DEFINE_FUNC_ALIGNED6(int, __cdecl, av_probe_input_buffer, AVIOContext *, AVInputFormat **, const char *, void *, unsigned int, unsigned int) | |
952 | + DEFINE_FUNC_ALIGNED3(int, __cdecl, avio_read, AVIOContext*, unsigned char *, int) | |
953 | + DEFINE_FUNC_ALIGNED2(void, __cdecl, avio_w8, AVIOContext*, int) | |
954 | + DEFINE_FUNC_ALIGNED3(void, __cdecl, avio_write, AVIOContext*, const unsigned char *, int) | |
955 | + DEFINE_FUNC_ALIGNED2(void, __cdecl, avio_wb24, AVIOContext*, unsigned int) | |
956 | + DEFINE_FUNC_ALIGNED2(void, __cdecl, avio_wb32, AVIOContext*, unsigned int) | |
957 | + DEFINE_FUNC_ALIGNED2(void, __cdecl, avio_wb16, AVIOContext*, unsigned int) | |
958 | + DEFINE_METHOD7(AVIOContext *, avio_alloc_context, (unsigned char *p1, int p2, int p3, void *p4, | |
959 | + int (*p5)(void *opaque, uint8_t *buf, int buf_size), | |
960 | int (*p6)(void *opaque, uint8_t *buf, int buf_size), | |
961 | - int (*p7)(void *opaque, uint8_t *buf, int buf_size), | |
962 | - offset_t (*p8)(void *opaque, offset_t offset, int whence))) | |
963 | - DEFINE_METHOD4(void, dump_format, (AVFormatContext *p1, int p2, const char *p3, int p4)) | |
964 | - DEFINE_METHOD2(int, url_fdopen, (ByteIOContext **p1, URLContext *p2)) | |
965 | - DEFINE_METHOD3(int, url_fopen, (ByteIOContext **p1, const char *p2, int p3)) | |
966 | - DEFINE_METHOD1(int, url_fclose, (ByteIOContext *p1)) | |
967 | - DEFINE_METHOD1(int, url_open_dyn_buf, (ByteIOContext **p1)) | |
968 | - DEFINE_METHOD2(int, url_close_dyn_buf, (ByteIOContext *p1, uint8_t **p2)) | |
969 | - DEFINE_METHOD3(offset_t, url_fseek, (ByteIOContext *p1, offset_t p2, int p3)) | |
970 | + offset_t (*p7)(void *opaque, offset_t offset, int whence))) | |
971 | + DEFINE_METHOD4(void, av_dump_format, (AVFormatContext *p1, int p2, const char *p3, int p4)) | |
972 | + DEFINE_METHOD3(int, avio_open, (AVIOContext **p1, const char *p2, int p3)) | |
973 | + DEFINE_METHOD1(int, avio_close, (AVIOContext *p1)) | |
974 | + DEFINE_METHOD1(int, avio_open_dyn_buf, (AVIOContext **p1)) | |
975 | + DEFINE_METHOD2(int, avio_close_dyn_buf, (AVIOContext *p1, uint8_t **p2)) | |
976 | + DEFINE_METHOD3(offset_t, avio_seek, (AVIOContext *p1, offset_t p2, int p3)) | |
977 | DEFINE_METHOD0(AVFormatContext *, avformat_alloc_context) | |
978 | - DEFINE_METHOD2(AVStream *, av_new_stream, (AVFormatContext *p1, int p2)) | |
979 | -#if LIBAVFORMAT_VERSION_INT < (52<<16 | 45<<8) | |
980 | - DEFINE_METHOD3(AVOutputFormat *, guess_format, (const char *p1, const char *p2, const char *p3)) | |
981 | -#else | |
982 | + DEFINE_METHOD2(AVStream *, avformat_new_stream, (AVFormatContext *p1, AVCodec *p2)) | |
983 | DEFINE_METHOD3(AVOutputFormat *, av_guess_format, (const char *p1, const char *p2, const char *p3)) | |
984 | -#endif | |
985 | - DEFINE_METHOD2(int, av_set_parameters, (AVFormatContext *p1, AVFormatParameters *p2)); | |
986 | - DEFINE_METHOD7(ByteIOContext *, av_alloc_put_byte, (unsigned char *p1, int p2, int p3, void *p4, | |
987 | - int(*p5)(void *opaque, uint8_t *buf, int buf_size), | |
988 | - int(*p6)(void *opaque, uint8_t *buf, int buf_size), | |
989 | - offset_t(*p7)(void *opaque, offset_t offset, int whence))) | |
990 | - DEFINE_METHOD1(int, av_write_header , (AVFormatContext *p1)) | |
991 | + DEFINE_METHOD2(int, avformat_write_header , (AVFormatContext *p1, AVDictionary **p2)) | |
992 | DEFINE_METHOD1(int, av_write_trailer, (AVFormatContext *p1)) | |
993 | DEFINE_METHOD2(int, av_write_frame , (AVFormatContext *p1, AVPacket *p2)) | |
994 | - DEFINE_METHOD4(int, av_metadata_set2, (AVMetadata **p1, const char *p2, const char *p3, int p4)); | |
995 | BEGIN_METHOD_RESOLVE() | |
996 | RESOLVE_METHOD_RENAME(av_register_all, av_register_all_dont_call) | |
997 | RESOLVE_METHOD(av_find_input_format) | |
998 | RESOLVE_METHOD(url_feof) | |
999 | - RESOLVE_METHOD(av_metadata_get) | |
1000 | - RESOLVE_METHOD(av_close_input_file) | |
1001 | - RESOLVE_METHOD(av_close_input_stream) | |
1002 | + RESOLVE_METHOD(avformat_close_input) | |
1003 | RESOLVE_METHOD(av_read_frame) | |
1004 | RESOLVE_METHOD(av_read_play) | |
1005 | RESOLVE_METHOD(av_read_pause) | |
1006 | - RESOLVE_METHOD_RENAME(ff_read_frame_flush, av_read_frame_flush) | |
1007 | + RESOLVE_METHOD(av_read_frame_flush) | |
1008 | RESOLVE_METHOD(av_seek_frame) | |
1009 | - RESOLVE_METHOD_RENAME(av_find_stream_info, av_find_stream_info_dont_call) | |
1010 | - RESOLVE_METHOD(av_open_input_file) | |
1011 | - RESOLVE_METHOD(url_set_interrupt_cb) | |
1012 | - RESOLVE_METHOD(av_open_input_stream) | |
1013 | - RESOLVE_METHOD(init_put_byte) | |
1014 | + RESOLVE_METHOD_RENAME(avformat_find_stream_info, avformat_find_stream_info_dont_call) | |
1015 | + RESOLVE_METHOD(avformat_open_input) | |
1016 | + RESOLVE_METHOD(avio_alloc_context) | |
1017 | RESOLVE_METHOD(av_probe_input_format) | |
1018 | RESOLVE_METHOD(av_probe_input_format2) | |
1019 | RESOLVE_METHOD(av_probe_input_buffer) | |
1020 | - RESOLVE_METHOD(dump_format) | |
1021 | - RESOLVE_METHOD(url_fdopen) | |
1022 | - RESOLVE_METHOD(url_fopen) | |
1023 | - RESOLVE_METHOD(url_fclose) | |
1024 | - RESOLVE_METHOD(url_open_dyn_buf) | |
1025 | - RESOLVE_METHOD(url_close_dyn_buf) | |
1026 | - RESOLVE_METHOD(url_fseek) | |
1027 | - RESOLVE_METHOD(get_buffer) | |
1028 | - RESOLVE_METHOD(get_partial_buffer) | |
1029 | - RESOLVE_METHOD(put_byte) | |
1030 | - RESOLVE_METHOD(put_buffer) | |
1031 | - RESOLVE_METHOD(put_be24) | |
1032 | - RESOLVE_METHOD(put_be32) | |
1033 | - RESOLVE_METHOD(put_be16) | |
1034 | + RESOLVE_METHOD(av_dump_format) | |
1035 | + RESOLVE_METHOD(avio_open) | |
1036 | + RESOLVE_METHOD(avio_close) | |
1037 | + RESOLVE_METHOD(avio_open_dyn_buf) | |
1038 | + RESOLVE_METHOD(avio_close_dyn_buf) | |
1039 | + RESOLVE_METHOD(avio_seek) | |
1040 | + RESOLVE_METHOD(avio_read) | |
1041 | + RESOLVE_METHOD(avio_w8) | |
1042 | + RESOLVE_METHOD(avio_write) | |
1043 | + RESOLVE_METHOD(avio_wb24) | |
1044 | + RESOLVE_METHOD(avio_wb32) | |
1045 | + RESOLVE_METHOD(avio_wb16) | |
1046 | RESOLVE_METHOD(avformat_alloc_context) | |
1047 | - RESOLVE_METHOD(av_new_stream) | |
1048 | -#if LIBAVFORMAT_VERSION_INT < (52<<16 | 45<<8) | |
1049 | - RESOLVE_METHOD(guess_format) | |
1050 | -#else | |
1051 | + RESOLVE_METHOD(avformat_new_stream) | |
1052 | RESOLVE_METHOD(av_guess_format) | |
1053 | -#endif | |
1054 | - RESOLVE_METHOD(av_set_parameters) | |
1055 | - RESOLVE_METHOD(av_alloc_put_byte) | |
1056 | - RESOLVE_METHOD(av_write_header) | |
1057 | + RESOLVE_METHOD(avformat_write_header) | |
1058 | RESOLVE_METHOD(av_write_trailer) | |
1059 | RESOLVE_METHOD(av_write_frame) | |
1060 | - RESOLVE_METHOD(av_metadata_set2) | |
1061 | END_METHOD_RESOLVE() | |
1062 | ||
1063 | /* dependencies of libavformat */ | |
1064 | DllAvCodec m_dllAvCodec; | |
1065 | - // DllAvCore loaded implicitely by m_dllAvCodec | |
1066 | // DllAvUtil loaded implicitely by m_dllAvCodec | |
1067 | ||
1068 | public: | |
1069 | @@ -328,10 +253,10 @@ | |
1070 | CSingleLock lock(DllAvCodec::m_critSection); | |
1071 | av_register_all_dont_call(); | |
1072 | } | |
1073 | - int av_find_stream_info(AVFormatContext *ic) | |
1074 | + int avformat_find_stream_info(AVFormatContext *ic, AVDictionary **options) | |
1075 | { | |
1076 | CSingleLock lock(DllAvCodec::m_critSection); | |
1077 | - return(av_find_stream_info_dont_call(ic)); | |
1078 | + return avformat_find_stream_info_dont_call(ic, options); | |
1079 | } | |
1080 | ||
1081 | virtual bool Load() | |
1082 | diff -urN xbmc-11.0/lib/DllAvUtil.h xbmc-11.0-ffmpeg-1.0/lib/DllAvUtil.h | |
1083 | --- xbmc-11.0/lib/DllAvUtil.h 2012-03-21 23:07:50.000000000 +0100 | |
1084 | +++ xbmc-11.0-ffmpeg-1.0/lib/DllAvUtil.h 2012-11-08 23:16:18.536405054 +0100 | |
1085 | @@ -65,6 +65,7 @@ | |
1086 | #include "libavutil/opt.h" | |
1087 | #include "libavutil/mem.h" | |
1088 | #include "libavutil/fifo.h" | |
1089 | + #include "libavutil/samplefmt.h" | |
1090 | #endif | |
1091 | } | |
1092 | ||
1093 | @@ -89,7 +90,7 @@ | |
1094 | virtual int64_t av_rescale_q(int64_t a, AVRational bq, AVRational cq)=0; | |
1095 | virtual const AVCRC* av_crc_get_table(AVCRCId crc_id)=0; | |
1096 | virtual uint32_t av_crc(const AVCRC *ctx, uint32_t crc, const uint8_t *buffer, size_t length)=0; | |
1097 | - virtual int av_set_string3(void *obj, const char *name, const char *val, int alloc, const AVOption **o_out)=0; | |
1098 | + virtual int av_opt_set(void *obj, const char *name, const char *val, int search_flags)=0; | |
1099 | virtual AVFifoBuffer *av_fifo_alloc(unsigned int size) = 0; | |
1100 | virtual void av_fifo_free(AVFifoBuffer *f) = 0; | |
1101 | virtual void av_fifo_reset(AVFifoBuffer *f) = 0; | |
1102 | @@ -97,6 +98,11 @@ | |
1103 | virtual int av_fifo_generic_read(AVFifoBuffer *f, void *dest, int buf_size, void (*func)(void*, void*, int)) = 0; | |
1104 | virtual int av_fifo_generic_write(AVFifoBuffer *f, void *src, int size, int (*func)(void*, void*, int)) = 0; | |
1105 | virtual char *av_strdup(const char *s)=0; | |
1106 | + virtual int av_get_bytes_per_sample(enum AVSampleFormat p1) = 0; | |
1107 | + virtual AVDictionaryEntry *av_dict_get(AVDictionary *m, const char *key, const AVDictionaryEntry *prev, int flags) = 0; | |
1108 | + virtual int av_dict_set(AVDictionary **pm, const char *key, const char *value, int flags)=0; | |
1109 | + virtual int av_samples_get_buffer_size (int *linesize, int nb_channels, int nb_samples, enum AVSampleFormat sample_fmt, int align) = 0; | |
1110 | + virtual int64_t av_get_default_channel_layout(int nb_channels)=0; | |
1111 | }; | |
1112 | ||
1113 | #if (defined USE_EXTERNAL_FFMPEG) | |
1114 | @@ -117,12 +123,7 @@ | |
1115 | virtual int64_t av_rescale_q(int64_t a, AVRational bq, AVRational cq) { return ::av_rescale_q(a, bq, cq); } | |
1116 | virtual const AVCRC* av_crc_get_table(AVCRCId crc_id) { return ::av_crc_get_table(crc_id); } | |
1117 | virtual uint32_t av_crc(const AVCRC *ctx, uint32_t crc, const uint8_t *buffer, size_t length) { return ::av_crc(ctx, crc, buffer, length); } | |
1118 | -#if LIBAVCODEC_VERSION_INT >= AV_VERSION_INT(52,7,0) | |
1119 | - // API added on: 2008-12-16 | |
1120 | - virtual int av_set_string3(void *obj, const char *name, const char *val, int alloc, const AVOption **o_out) { return ::av_set_string3(obj, name, val, alloc, o_out); } | |
1121 | -#else | |
1122 | - virtual int av_set_string3(void *obj, const char *name, const char *val, int alloc, const AVOption **o_out) { return AVERROR(ENOENT); } | |
1123 | -#endif | |
1124 | + virtual int av_opt_set(void *obj, const char *name, const char *val, int search_flags) { return ::av_opt_set(obj, name, val, search_flags); } | |
1125 | virtual AVFifoBuffer *av_fifo_alloc(unsigned int size) {return ::av_fifo_alloc(size); } | |
1126 | virtual void av_fifo_free(AVFifoBuffer *f) { ::av_fifo_free(f); } | |
1127 | virtual void av_fifo_reset(AVFifoBuffer *f) { ::av_fifo_reset(f); } | |
1128 | @@ -132,6 +133,13 @@ | |
1129 | virtual int av_fifo_generic_write(AVFifoBuffer *f, void *src, int size, int (*func)(void*, void*, int)) | |
1130 | { return ::av_fifo_generic_write(f, src, size, func); } | |
1131 | virtual char *av_strdup(const char *s) { return ::av_strdup(s); } | |
1132 | + virtual int av_get_bytes_per_sample(enum AVSampleFormat p1) | |
1133 | + { return ::av_get_bytes_per_sample(p1); } | |
1134 | + virtual AVDictionaryEntry *av_dict_get(AVDictionary *m, const char *key, const AVDictionaryEntry *prev, int flags){ return ::av_dict_get(m, key, prev, flags); } | |
1135 | + virtual int av_dict_set(AVDictionary **pm, const char *key, const char *value, int flags) { return ::av_dict_set(pm, key, value, flags); } | |
1136 | + virtual int av_samples_get_buffer_size (int *linesize, int nb_channels, int nb_samples, enum AVSampleFormat sample_fmt, int align) | |
1137 | + { return ::av_samples_get_buffer_size(linesize, nb_channels, nb_samples, sample_fmt, align); } | |
1138 | + virtual int64_t av_get_default_channel_layout(int nb_channels) { return ::av_get_default_channel_layout(nb_channels); } | |
1139 | ||
1140 | // DLL faking. | |
1141 | virtual bool ResolveExports() { return true; } | |
1142 | @@ -160,7 +168,7 @@ | |
1143 | DEFINE_METHOD3(int64_t, av_rescale_q, (int64_t p1, AVRational p2, AVRational p3)); | |
1144 | DEFINE_METHOD1(const AVCRC*, av_crc_get_table, (AVCRCId p1)) | |
1145 | DEFINE_METHOD4(uint32_t, av_crc, (const AVCRC *p1, uint32_t p2, const uint8_t *p3, size_t p4)); | |
1146 | - DEFINE_METHOD5(int, av_set_string3, (void *p1, const char *p2, const char *p3, int p4, const AVOption **p5)); | |
1147 | + DEFINE_METHOD4(int, av_opt_set, (void *p1, const char *p2, const char *p3, int p4)); | |
1148 | DEFINE_METHOD1(AVFifoBuffer*, av_fifo_alloc, (unsigned int p1)) | |
1149 | DEFINE_METHOD1(void, av_fifo_free, (AVFifoBuffer *p1)) | |
1150 | DEFINE_METHOD1(void, av_fifo_reset, (AVFifoBuffer *p1)) | |
1151 | @@ -168,6 +176,11 @@ | |
1152 | DEFINE_METHOD4(int, av_fifo_generic_read, (AVFifoBuffer *p1, void *p2, int p3, void (*p4)(void*, void*, int))) | |
1153 | DEFINE_METHOD4(int, av_fifo_generic_write, (AVFifoBuffer *p1, void *p2, int p3, int (*p4)(void*, void*, int))) | |
1154 | DEFINE_METHOD1(char*, av_strdup, (const char *p1)) | |
1155 | + DEFINE_METHOD1(int, av_get_bytes_per_sample, (enum AVSampleFormat p1)) | |
1156 | + DEFINE_METHOD4(AVDictionaryEntry *, av_dict_get, (AVDictionary *p1, const char *p2, const AVDictionaryEntry *p3, int p4)) | |
1157 | + DEFINE_METHOD4(int, av_dict_set, (AVDictionary **p1, const char *p2, const char *p3, int p4)); | |
1158 | + DEFINE_METHOD5(int, av_samples_get_buffer_size, (int *p1, int p2, int p3, enum AVSampleFormat p4, int p5)) | |
1159 | + DEFINE_METHOD1(int64_t, av_get_default_channel_layout, (int p1)) | |
1160 | ||
1161 | public: | |
1162 | BEGIN_METHOD_RESOLVE() | |
1163 | @@ -181,7 +194,7 @@ | |
1164 | RESOLVE_METHOD(av_rescale_q) | |
1165 | RESOLVE_METHOD(av_crc_get_table) | |
1166 | RESOLVE_METHOD(av_crc) | |
1167 | - RESOLVE_METHOD(av_set_string3) | |
1168 | + RESOLVE_METHOD(av_opt_set) | |
1169 | RESOLVE_METHOD(av_fifo_alloc) | |
1170 | RESOLVE_METHOD(av_fifo_free) | |
1171 | RESOLVE_METHOD(av_fifo_reset) | |
1172 | @@ -189,6 +202,11 @@ | |
1173 | RESOLVE_METHOD(av_fifo_generic_read) | |
1174 | RESOLVE_METHOD(av_fifo_generic_write) | |
1175 | RESOLVE_METHOD(av_strdup) | |
1176 | + RESOLVE_METHOD(av_get_bytes_per_sample) | |
1177 | + RESOLVE_METHOD(av_dict_get) | |
1178 | + RESOLVE_METHOD(av_dict_set) | |
1179 | + RESOLVE_METHOD(av_samples_get_buffer_size) | |
1180 | + RESOLVE_METHOD(av_get_default_channel_layout) | |
1181 | END_METHOD_RESOLVE() | |
1182 | }; | |
1183 | ||
1184 | diff -urN xbmc-11.0/lib/DllSwResample.h xbmc-11.0-ffmpeg-1.0/lib/DllSwResample.h | |
1185 | --- xbmc-11.0/lib/DllSwResample.h 1970-01-01 01:00:00.000000000 +0100 | |
1186 | +++ xbmc-11.0-ffmpeg-1.0/lib/DllSwResample.h 2012-11-08 23:15:55.399739205 +0100 | |
1187 | @@ -0,0 +1,87 @@ | |
1188 | +#pragma once | |
1189 | +/* | |
1190 | + * Copyright (C) 2005-2010 Team XBMC | |
1191 | + * http://www.xbmc.org | |
1192 | + * | |
1193 | + * This Program is free software; you can redistribute it and/or modify | |
1194 | + * it under the terms of the GNU General Public License as published by | |
1195 | + * the Free Software Foundation; either version 2, or (at your option) | |
1196 | + * any later version. | |
1197 | + * | |
1198 | + * This Program is distributed in the hope that it will be useful, | |
1199 | + * but WITHOUT ANY WARRANTY; without even the implied warranty of | |
1200 | + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the | |
1201 | + * GNU General Public License for more details. | |
1202 | + * | |
1203 | + * You should have received a copy of the GNU General Public License | |
1204 | + * along with XBMC; see the file COPYING. If not, write to | |
1205 | + * the Free Software Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. | |
1206 | + * http://www.gnu.org/copyleft/gpl.html | |
1207 | + * | |
1208 | + */ | |
1209 | + | |
1210 | +#if (defined HAVE_CONFIG_H) && (!defined WIN32) | |
1211 | + #include "config.h" | |
1212 | +#endif | |
1213 | +#include "DynamicDll.h" | |
1214 | + | |
1215 | +extern "C" { | |
1216 | +#ifndef HAVE_MMX | |
1217 | +#define HAVE_MMX | |
1218 | +#endif | |
1219 | +#ifndef __STDC_CONSTANT_MACROS | |
1220 | +#define __STDC_CONSTANT_MACROS | |
1221 | +#endif | |
1222 | +#ifndef __GNUC__ | |
1223 | +#pragma warning(disable:4244) | |
1224 | +#endif | |
1225 | +#if (defined USE_EXTERNAL_FFMPEG) | |
1226 | + #include <libswresample/swresample.h> | |
1227 | +#else | |
1228 | + #include "libswresample/swresample.h" | |
1229 | +#endif | |
1230 | +} | |
1231 | + | |
1232 | + | |
1233 | +#if (defined USE_EXTERNAL_FFMPEG) | |
1234 | + | |
1235 | +// Use direct mapping | |
1236 | +class DllSwResample : public DllDynamic | |
1237 | +{ | |
1238 | +public: | |
1239 | + virtual ~DllSwResample() {} | |
1240 | + | |
1241 | + // DLL faking. | |
1242 | + virtual bool ResolveExports() { return true; } | |
1243 | + virtual bool Load() { | |
1244 | + CLog::Log(LOGDEBUG, "DllAvFormat: Using libswresample system library"); | |
1245 | + return true; | |
1246 | + } | |
1247 | + virtual void Unload() {} | |
1248 | +}; | |
1249 | + | |
1250 | +#else | |
1251 | + | |
1252 | +class DllSwResample : public DllDynamic | |
1253 | +{ | |
1254 | + DECLARE_DLL_WRAPPER(DllSwResample, DLL_PATH_LIBSWRESAMPLE) | |
1255 | + | |
1256 | + LOAD_SYMBOLS() | |
1257 | + | |
1258 | + BEGIN_METHOD_RESOLVE() | |
1259 | + END_METHOD_RESOLVE() | |
1260 | + | |
1261 | + /* dependencies of libavformat */ | |
1262 | + DllAvUtil m_dllAvUtil; | |
1263 | + | |
1264 | +public: | |
1265 | + | |
1266 | + virtual bool Load() | |
1267 | + { | |
1268 | + if (!m_dllAvUtil.Load()) | |
1269 | + return false; | |
1270 | + return DllDynamic::Load(); | |
1271 | + } | |
1272 | +}; | |
1273 | + | |
1274 | +#endif | |
1275 | diff -urN xbmc-11.0/lib/Makefile.in xbmc-11.0-ffmpeg-1.0/lib/Makefile.in | |
1276 | --- xbmc-11.0/lib/Makefile.in 2012-03-21 23:07:50.000000000 +0100 | |
1277 | +++ xbmc-11.0-ffmpeg-1.0/lib/Makefile.in 2012-11-08 23:15:55.399739205 +0100 | |
1278 | @@ -17,6 +17,14 @@ | |
1279 | WRAPPER=@abs_top_srcdir@/xbmc/cores/DllLoader/exports/wrapper.o | |
1280 | WRAPPER_MACH_ALIAS=@abs_top_srcdir@/xbmc/cores/DllLoader/exports/wrapper_mach_alias | |
1281 | ||
1282 | +AVFORMAT_SO=avformat-53-$(ARCH).so | |
1283 | +AVCODEC_SO=avcodec-53-$(ARCH).so | |
1284 | +AVUTIL_SO=avutil-51-$(ARCH).so | |
1285 | +AVFILTER_SO=avfilter-2-$(ARCH).so | |
1286 | +SWSCALE_SO=swscale-2-$(ARCH).so | |
1287 | +POSTPROC_SO=postproc-52-$(ARCH).so | |
1288 | +SWRESAMPLE_SO=swresample-0-$(ARCH).so | |
1289 | + | |
1290 | DIRS= | |
1291 | ifneq (@USE_EXTERNAL_FFMPEG@,1) | |
1292 | DIRS+=ffmpeg | |
1293 | @@ -24,13 +32,13 @@ | |
1294 | ||
1295 | LIBS= | |
1296 | ifneq (@USE_EXTERNAL_FFMPEG@,1) | |
1297 | - LIBS+=avutil-50-$(ARCH).so \ | |
1298 | - avcodec-52-$(ARCH).so \ | |
1299 | - avcore-0-$(ARCH).so \ | |
1300 | - avformat-52-$(ARCH).so \ | |
1301 | - postproc-51-$(ARCH).so \ | |
1302 | - avfilter-1-$(ARCH).so \ | |
1303 | - swscale-0-$(ARCH).so | |
1304 | + LIBS+=$(AVUTIL_SO) \ | |
1305 | + $(AVCODEC_SO) \ | |
1306 | + $(AVFORMAT_SO) \ | |
1307 | + $(POSTPROC_SO) \ | |
1308 | + $(AVFILTER_SO) \ | |
1309 | + $(SWSCALE_SO) \ | |
1310 | + $(SWRESAMPLE_SO) | |
1311 | endif | |
1312 | ||
1313 | ifneq (,$(findstring powerpc,$(ARCH))) | |
1314 | @@ -54,90 +62,90 @@ | |
1315 | BUNDLE1_O = -lbundle1.o | |
1316 | endif | |
1317 | ||
1318 | -$(SYSDIR)/avutil-50-$(ARCH).so: $(WRAPPER) ffmpeg/libavutil/libavutil.dylib | |
1319 | +$(SYSDIR)/$(AVUTIL_SO): $(WRAPPER) ffmpeg/libavutil/libavutil.dylib | |
1320 | $(LD) $(LDFLAGS) -alias_list $(WRAPPER_MACH_ALIAS) -o $@ \ | |
1321 | $(WRAPPER) ffmpeg/libavutil/*.o \ | |
1322 | ffmpeg/libavutil/$(ARCH_DIR)/*.o $(BUNDLE1_O) | |
1323 | ||
1324 | -$(SYSDIR)/avcodec-52-$(ARCH).so: $(WRAPPER) ffmpeg/libavcodec/libavcodec.dylib | |
1325 | +$(SYSDIR)/$(AVCODEC_SO): $(WRAPPER) ffmpeg/libavcodec/libavcodec.dylib | |
1326 | $(LD) $(LDFLAGS) -alias_list $(WRAPPER_MACH_ALIAS) -o $@ \ | |
1327 | $(WRAPPER) ffmpeg/libavcodec/*.o \ | |
1328 | ffmpeg/libavcodec/$(ARCH_DIR)/*.o $(BUNDLE1_O) | |
1329 | ||
1330 | -$(SYSDIR)/avcore-0-$(ARCH).so: $(WRAPPER) ffmpeg/libavcore/libavcore.dylib | |
1331 | - $(LD) $(LDFLAGS) -alias_list $(WRAPPER_MACH_ALIAS) -o $@ \ | |
1332 | - $(WRAPPER) ffmpeg/libavcore/*.o $(BUNDLE1_O) | |
1333 | - | |
1334 | -$(SYSDIR)/avformat-52-$(ARCH).so: $(WRAPPER) ffmpeg/libavformat/libavformat.dylib | |
1335 | +$(SYSDIR)/$(AVFORMAT_SO): $(WRAPPER) ffmpeg/libavformat/libavformat.dylib | |
1336 | $(LD) $(LDFLAGS) -alias_list $(WRAPPER_MACH_ALIAS) -o $@ \ | |
1337 | $(WRAPPER) ffmpeg/libavformat/*.o $(BUNDLE1_O) | |
1338 | ||
1339 | ifeq ($(findstring x86,$(ARCH_DIR)), x86) | |
1340 | -$(SYSDIR)/avfilter-1-$(ARCH).so: $(WRAPPER) ffmpeg/libavfilter/libavfilter.dylib | |
1341 | +$(SYSDIR)/$(AVFILTER_SO): $(WRAPPER) ffmpeg/libavfilter/libavfilter.dylib | |
1342 | $(LD) $(LDFLAGS) -alias_list $(WRAPPER_MACH_ALIAS) -o $@ \ | |
1343 | $(WRAPPER) ffmpeg/libavfilter/$(ARCH_DIR)/*.o \ | |
1344 | ffmpeg/libavfilter/*.o $(BUNDLE1_O) | |
1345 | else # No libavfilter/ppc or libavfilter/arm | |
1346 | -$(SYSDIR)/avfilter-1-$(ARCH).so: $(WRAPPER) ffmpeg/libavfilter/libavfilter.dylib | |
1347 | +$(SYSDIR)/$(AVFILTER_SO): $(WRAPPER) ffmpeg/libavfilter/libavfilter.dylib | |
1348 | $(LD) $(LDFLAGS) -alias_list $(WRAPPER_MACH_ALIAS) -o $@ \ | |
1349 | $(WRAPPER) ffmpeg/libavfilter/*.o $(BUNDLE1_O) | |
1350 | endif | |
1351 | ||
1352 | ifneq ($(findstring arm,$(ARCH)), arm) | |
1353 | -$(SYSDIR)/swscale-0-$(ARCH).so: $(WRAPPER) ffmpeg/libswscale/libswscale.dylib | |
1354 | +$(SYSDIR)/$(SWSCALE_SO): $(WRAPPER) ffmpeg/libswscale/libswscale.dylib | |
1355 | $(LD) $(LDFLAGS) -alias_list $(WRAPPER_MACH_ALIAS) -o $@ \ | |
1356 | $(WRAPPER) ffmpeg/libswscale/*.o \ | |
1357 | ffmpeg/libswscale/$(ARCH_DIR)/*.o $(BUNDLE1_O) | |
1358 | else # No ARM version of swscale available yet. | |
1359 | -$(SYSDIR)/swscale-0-$(ARCH).so: $(WRAPPER) ffmpeg/libswscale/libswscale.dylib | |
1360 | +$(SYSDIR)/$(SWSCALE_SO): $(WRAPPER) ffmpeg/libswscale/libswscale.dylib | |
1361 | $(LD) $(LDFLAGS) -alias_list $(WRAPPER_MACH_ALIAS) -o $@ \ | |
1362 | $(WRAPPER) ffmpeg/libswscale/*.o | |
1363 | endif | |
1364 | ||
1365 | -$(SYSDIR)/postproc-51-$(ARCH).so: $(WRAPPER) ffmpeg/libpostproc/libpostproc.dylib | |
1366 | +$(SYSDIR)/$(POSTPROC_SO): $(WRAPPER) ffmpeg/libpostproc/libpostproc.dylib | |
1367 | $(LD) $(LDFLAGS) -alias_list $(WRAPPER_MACH_ALIAS) -o $@ \ | |
1368 | $(WRAPPER) ffmpeg/libpostproc/*.o $(BUNDLE1_O) | |
1369 | ||
1370 | +$(SYSDIR)/$(SWRESAMPLE_SO): $(WRAPPER) ffmpeg/libswresample/libswresample.dylib | |
1371 | + $(LD) $(LDFLAGS) -alias_list $(WRAPPER_MACH_ALIAS) -o $@ \ | |
1372 | + $(WRAPPER) ffmpeg/libswresample/*.o $(BUNDLE1_O) | |
1373 | + | |
1374 | ffmpeg/libavutil/libavutil.dylib : ffmpeg; | |
1375 | ffmpeg/libavcodec/libavcodec.dylib : ffmpeg; | |
1376 | -ffmpeg/libavcore/libavcore.dylib : ffmpeg; | |
1377 | ffmpeg/libavformat/libavformat.dylib : ffmpeg; | |
1378 | ffmpeg/libavformat/libavfilter.dylib : ffmpeg; | |
1379 | ffmpeg/libswscale/libswscale.dylib : ffmpeg; | |
1380 | ffmpeg/libpostproc/libpostproc.dylib : ffmpeg; | |
1381 | +ffmpeg/libswresample/libswresample.dylib : ffmpeg; | |
1382 | ffmpeg: | |
1383 | $(MAKE) -C $@ | |
1384 | ||
1385 | else | |
1386 | ||
1387 | -$(SYSDIR)/avutil-50-$(ARCH).so: ffmpeg/libavutil/libavutil.so | |
1388 | +$(SYSDIR)/$(AVUTIL_SO): ffmpeg/libavutil/libavutil.so | |
1389 | cp ffmpeg/libavutil/libavutil.so $@ | |
1390 | ||
1391 | -$(SYSDIR)/avcodec-52-$(ARCH).so: $(WRAPPER) ffmpeg/libavcodec/libavcodec.so | |
1392 | +$(SYSDIR)/$(AVCODEC_SO): $(WRAPPER) ffmpeg/libavcodec/libavcodec.so | |
1393 | cp ffmpeg/libavcodec/libavcodec.so $@ | |
1394 | ||
1395 | -$(SYSDIR)/avcore-0-$(ARCH).so: $(WRAPPER) ffmpeg/libavcore/libavcore.so | |
1396 | - cp ffmpeg/libavcore/libavcore.so $@ | |
1397 | - | |
1398 | -$(SYSDIR)/avformat-52-$(ARCH).so: $(WRAPPER) ffmpeg/libavformat/libavformat.so | |
1399 | +$(SYSDIR)/$(AVFORMAT_SO): $(WRAPPER) ffmpeg/libavformat/libavformat.so | |
1400 | cp ffmpeg/libavformat/libavformat.so $@ | |
1401 | ||
1402 | -$(SYSDIR)/avfilter-1-$(ARCH).so: $(WRAPPER) ffmpeg/libavfilter/libavfilter.so | |
1403 | +$(SYSDIR)/$(AVFILTER_SO): $(WRAPPER) ffmpeg/libavfilter/libavfilter.so | |
1404 | cp ffmpeg/libavfilter/libavfilter.so $@ | |
1405 | ||
1406 | -$(SYSDIR)/swscale-0-$(ARCH).so: $(WRAPPER) ffmpeg/libswscale/libswscale.so | |
1407 | +$(SYSDIR)/$(SWSCALE_SO): $(WRAPPER) ffmpeg/libswscale/libswscale.so | |
1408 | cp ffmpeg/libswscale/libswscale.so $@ | |
1409 | ||
1410 | -$(SYSDIR)/postproc-51-$(ARCH).so: $(WRAPPER) ffmpeg/libpostproc/libpostproc.so | |
1411 | +$(SYSDIR)/$(POSTPROC_SO): $(WRAPPER) ffmpeg/libpostproc/libpostproc.so | |
1412 | cp ffmpeg/libpostproc/libpostproc.so $@ | |
1413 | ||
1414 | +$(SYSDIR)/$(SWRESAMPLE_SO): $(WRAPPER) ffmpeg/libswresample/libswresample.so | |
1415 | + cp ffmpeg/libswresample/libswresample.so $@ | |
1416 | + | |
1417 | ffmpeg/libavutil/libavutil.so : ffmpeg; | |
1418 | ffmpeg/libavcodec/libavcodec.so : ffmpeg; | |
1419 | -ffmpeg/libavcore/libavcore.so : ffmpeg; | |
1420 | ffmpeg/libavformat/libavformat.so : ffmpeg; | |
1421 | ffmpeg/libavfilter/libavfilter.so : ffmpeg; | |
1422 | ffmpeg/libswscale/libswscale.so : ffmpeg; | |
1423 | ffmpeg/libpostproc/libpostproc.so : ffmpeg; | |
1424 | +ffmpeg/libswresample/libswresample.so : ffmpeg; | |
1425 | ffmpeg: | |
1426 | $(MAKE) -C $@ | |
1427 | ||
1428 | diff -urN xbmc-11.0/lib/xbmc-dll-symbols/DllAvFormat.c xbmc-11.0-ffmpeg-1.0/lib/xbmc-dll-symbols/DllAvFormat.c | |
1429 | --- xbmc-11.0/lib/xbmc-dll-symbols/DllAvFormat.c 2012-03-21 23:07:50.000000000 +0100 | |
1430 | +++ xbmc-11.0-ffmpeg-1.0/lib/xbmc-dll-symbols/DllAvFormat.c 2012-11-08 23:15:47.383072821 +0100 | |
1431 | @@ -28,6 +28,7 @@ | |
1432 | #include <libavformat/avformat.h> | |
1433 | ||
1434 | /* Taken from libavformat/utils.c */ | |
1435 | +#if LIBAVFORMAT_VERSION_INT < AV_VERSION_INT(54,0,0) | |
1436 | static void flush_packet_queue(AVFormatContext *s) | |
1437 | { | |
1438 | AVPacketList *pktl; | |
1439 | @@ -53,6 +54,27 @@ | |
1440 | s->raw_packet_buffer_remaining_size = RAW_PACKET_BUFFER_SIZE; | |
1441 | #endif | |
1442 | } | |
1443 | +#else | |
1444 | +static void free_packet_buffer(AVPacketList **pkt_buf, AVPacketList **pkt_buf_end) | |
1445 | +{ | |
1446 | + while (*pkt_buf) { | |
1447 | + AVPacketList *pktl = *pkt_buf; | |
1448 | + *pkt_buf = pktl->next; | |
1449 | + av_free_packet(&pktl->pkt); | |
1450 | + av_freep(&pktl); | |
1451 | + } | |
1452 | + *pkt_buf_end = NULL; | |
1453 | +} | |
1454 | +/* XXX: suppress the packet queue */ | |
1455 | +static void flush_packet_queue(AVFormatContext *s) | |
1456 | +{ | |
1457 | + free_packet_buffer(&s->parse_queue, &s->parse_queue_end); | |
1458 | + free_packet_buffer(&s->packet_buffer, &s->packet_buffer_end); | |
1459 | + free_packet_buffer(&s->raw_packet_buffer, &s->raw_packet_buffer_end); | |
1460 | + | |
1461 | + s->raw_packet_buffer_remaining_size = RAW_PACKET_BUFFER_SIZE; | |
1462 | +} | |
1463 | +#endif | |
1464 | ||
1465 | /* Taken from libavformat/utils.c */ | |
1466 | void av_read_frame_flush(AVFormatContext *s) | |
1467 | @@ -62,7 +84,9 @@ | |
1468 | ||
1469 | flush_packet_queue(s); | |
1470 | ||
1471 | +#if LIBAVFORMAT_VERSION_INT < AV_VERSION_INT(54,0,0) | |
1472 | s->cur_st = NULL; | |
1473 | +#endif | |
1474 | ||
1475 | /* for each stream, reset read state */ | |
1476 | for(i = 0; i < s->nb_streams; i++) { | |
1477 | @@ -71,14 +95,25 @@ | |
1478 | if (st->parser) { | |
1479 | av_parser_close(st->parser); | |
1480 | st->parser = NULL; | |
1481 | +#if LIBAVFORMAT_VERSION_INT < AV_VERSION_INT(54,0,0) | |
1482 | av_free_packet(&st->cur_pkt); | |
1483 | +#endif | |
1484 | } | |
1485 | st->last_IP_pts = AV_NOPTS_VALUE; | |
1486 | +#if LIBAVFORMAT_VERSION_INT < AV_VERSION_INT(54,0,0) | |
1487 | st->cur_dts = AV_NOPTS_VALUE; /* we set the current DTS to an unspecified origin */ | |
1488 | st->reference_dts = AV_NOPTS_VALUE; | |
1489 | /* fail safe */ | |
1490 | st->cur_ptr = NULL; | |
1491 | st->cur_len = 0; | |
1492 | +#else | |
1493 | +#define RELATIVE_TS_BASE (INT64_MAX - (1LL<<48)) | |
1494 | + if(st->first_dts == AV_NOPTS_VALUE) st->cur_dts = RELATIVE_TS_BASE; | |
1495 | + else st->cur_dts = AV_NOPTS_VALUE; /* we set the current DTS to an unspecified origin */ | |
1496 | + st->reference_dts = AV_NOPTS_VALUE; | |
1497 | + | |
1498 | + st->probe_packets = MAX_PROBE_PACKETS; | |
1499 | +#endif | |
1500 | ||
1501 | for(j=0; j<MAX_REORDER_DELAY+1; j++) | |
1502 | st->pts_buffer[j]= AV_NOPTS_VALUE; | |
1503 | diff -urN xbmc-11.0/xbmc/cdrip/EncoderFFmpeg.cpp xbmc-11.0-ffmpeg-1.0/xbmc/cdrip/EncoderFFmpeg.cpp | |
1504 | --- xbmc-11.0/xbmc/cdrip/EncoderFFmpeg.cpp 2012-03-21 23:07:50.000000000 +0100 | |
1505 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cdrip/EncoderFFmpeg.cpp 2012-11-08 23:16:18.536405054 +0100 | |
1506 | @@ -59,11 +59,7 @@ | |
1507 | ||
1508 | CStdString filename = URIUtils::GetFileName(strFile); | |
1509 | AVOutputFormat *fmt = NULL; | |
1510 | -#if LIBAVFORMAT_VERSION_MAJOR < 52 | |
1511 | - fmt = m_dllAvFormat.guess_format(NULL, filename.c_str(), NULL); | |
1512 | -#else | |
1513 | fmt = m_dllAvFormat.av_guess_format(NULL, filename.c_str(), NULL); | |
1514 | -#endif | |
1515 | if (!fmt) | |
1516 | { | |
1517 | CLog::Log(LOGERROR, "CEncoderFFmpeg::Init - Unable to guess the output format for the file %s", filename.c_str()); | |
1518 | @@ -82,7 +78,7 @@ | |
1519 | } | |
1520 | ||
1521 | m_Format = m_dllAvFormat.avformat_alloc_context(); | |
1522 | - m_Format->pb = m_dllAvFormat.av_alloc_put_byte(m_BCBuffer, sizeof(m_BCBuffer), URL_RDONLY, this, NULL, MuxerReadPacket, NULL); | |
1523 | + m_Format->pb = m_dllAvFormat.avio_alloc_context(m_BCBuffer, sizeof(m_BCBuffer), AVIO_FLAG_READ, this, NULL, MuxerReadPacket, NULL); | |
1524 | if (!m_Format->pb) | |
1525 | { | |
1526 | m_dllAvUtil.av_freep(&m_Format); | |
1527 | @@ -93,17 +89,8 @@ | |
1528 | m_Format->oformat = fmt; | |
1529 | m_Format->bit_rate = g_guiSettings.GetInt("audiocds.bitrate") * 1000; | |
1530 | ||
1531 | - /* setup the muxer */ | |
1532 | - if (m_dllAvFormat.av_set_parameters(m_Format, NULL) != 0) | |
1533 | - { | |
1534 | - m_dllAvUtil.av_freep(&m_Format->pb); | |
1535 | - m_dllAvUtil.av_freep(&m_Format); | |
1536 | - CLog::Log(LOGERROR, "CEncoderFFmpeg::Init - Failed to set the muxer parameters"); | |
1537 | - return false; | |
1538 | - } | |
1539 | - | |
1540 | /* add a stream to it */ | |
1541 | - m_Stream = m_dllAvFormat.av_new_stream(m_Format, 1); | |
1542 | + m_Stream = m_dllAvFormat.avformat_new_stream(m_Format, codec); | |
1543 | if (!m_Stream) | |
1544 | { | |
1545 | m_dllAvUtil.av_freep(&m_Format->pb); | |
1546 | @@ -119,7 +106,7 @@ | |
1547 | m_CodecCtx->bit_rate = m_Format->bit_rate; | |
1548 | m_CodecCtx->sample_rate = iInRate; | |
1549 | m_CodecCtx->channels = iInChannels; | |
1550 | - m_CodecCtx->channel_layout = m_dllAvCodec.avcodec_guess_channel_layout(iInChannels, codec->id, NULL); | |
1551 | + m_CodecCtx->channel_layout = m_dllAvUtil.av_get_default_channel_layout(iInChannels); | |
1552 | m_CodecCtx->time_base = (AVRational){1, iInRate}; | |
1553 | ||
1554 | if(fmt->flags & AVFMT_GLOBALHEADER) | |
1555 | @@ -144,7 +131,7 @@ | |
1556 | return false; | |
1557 | } | |
1558 | ||
1559 | - if (m_dllAvCodec.avcodec_open(m_CodecCtx, codec)) | |
1560 | + if (m_dllAvCodec.avcodec_open2(m_CodecCtx, codec, NULL)) | |
1561 | { | |
1562 | CLog::Log(LOGERROR, "CEncoderFFmpeg::Init - Failed to open the codec"); | |
1563 | m_dllAvUtil.av_freep(&m_Stream); | |
1564 | @@ -179,7 +166,7 @@ | |
1565 | SetTag("encoder" , "XBMC FFmpeg Encoder"); | |
1566 | ||
1567 | /* write the header */ | |
1568 | - if (m_dllAvFormat.av_write_header(m_Format) != 0) | |
1569 | + if (m_dllAvFormat.avformat_write_header(m_Format, NULL) != 0) | |
1570 | { | |
1571 | CLog::Log(LOGERROR, "CEncoderFFmpeg::Init - Failed to write the header"); | |
1572 | delete[] m_Buffer; | |
1573 | @@ -194,7 +181,7 @@ | |
1574 | ||
1575 | void CEncoderFFmpeg::SetTag(const CStdString tag, const CStdString value) | |
1576 | { | |
1577 | - m_dllAvFormat.av_metadata_set2(&m_Format->metadata, tag.c_str(), value.c_str(), 0); | |
1578 | + m_dllAvUtil.av_dict_set(&m_Format->metadata, tag.c_str(), value.c_str(), 0); | |
1579 | } | |
1580 | ||
1581 | int CEncoderFFmpeg::MuxerReadPacket(void *opaque, uint8_t *buf, int buf_size) | |
1582 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/DVDAudioCodecFFmpeg.cpp xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/DVDAudioCodecFFmpeg.cpp | |
1583 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/DVDAudioCodecFFmpeg.cpp 2012-03-21 23:07:50.000000000 +0100 | |
1584 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/DVDAudioCodecFFmpeg.cpp 2012-11-08 23:16:18.536405054 +0100 | |
1585 | @@ -29,10 +29,6 @@ | |
1586 | ||
1587 | CDVDAudioCodecFFmpeg::CDVDAudioCodecFFmpeg() : CDVDAudioCodec() | |
1588 | { | |
1589 | - m_iBufferSize1 = 0; | |
1590 | - m_pBuffer1 = (BYTE*)_aligned_malloc(AVCODEC_MAX_AUDIO_FRAME_SIZE + FF_INPUT_BUFFER_PADDING_SIZE, 16); | |
1591 | - memset(m_pBuffer1, 0, AVCODEC_MAX_AUDIO_FRAME_SIZE + FF_INPUT_BUFFER_PADDING_SIZE); | |
1592 | - | |
1593 | m_iBufferSize2 = 0; | |
1594 | m_pBuffer2 = (BYTE*)_aligned_malloc(AVCODEC_MAX_AUDIO_FRAME_SIZE + FF_INPUT_BUFFER_PADDING_SIZE, 16); | |
1595 | memset(m_pBuffer2, 0, AVCODEC_MAX_AUDIO_FRAME_SIZE + FF_INPUT_BUFFER_PADDING_SIZE); | |
1596 | @@ -45,11 +41,11 @@ | |
1597 | m_channelMap[0] = PCM_INVALID; | |
1598 | m_channels = 0; | |
1599 | m_layout = 0; | |
1600 | + m_pFrame1 = NULL; | |
1601 | } | |
1602 | ||
1603 | CDVDAudioCodecFFmpeg::~CDVDAudioCodecFFmpeg() | |
1604 | { | |
1605 | - _aligned_free(m_pBuffer1); | |
1606 | _aligned_free(m_pBuffer2); | |
1607 | Dispose(); | |
1608 | } | |
1609 | @@ -59,12 +55,10 @@ | |
1610 | AVCodec* pCodec; | |
1611 | m_bOpenedCodec = false; | |
1612 | ||
1613 | - if (!m_dllAvCore.Load() || !m_dllAvUtil.Load() || !m_dllAvCodec.Load()) | |
1614 | + if (!m_dllAvUtil.Load() || !m_dllAvCodec.Load()) | |
1615 | return false; | |
1616 | ||
1617 | m_dllAvCodec.avcodec_register_all(); | |
1618 | - m_pCodecContext = m_dllAvCodec.avcodec_alloc_context(); | |
1619 | - m_dllAvCodec.avcodec_get_context_defaults(m_pCodecContext); | |
1620 | ||
1621 | pCodec = m_dllAvCodec.avcodec_find_decoder(hints.codec); | |
1622 | if (!pCodec) | |
1623 | @@ -73,6 +67,7 @@ | |
1624 | return false; | |
1625 | } | |
1626 | ||
1627 | + m_pCodecContext = m_dllAvCodec.avcodec_alloc_context3(pCodec); | |
1628 | m_pCodecContext->debug_mv = 0; | |
1629 | m_pCodecContext->debug = 0; | |
1630 | m_pCodecContext->workaround_bugs = 1; | |
1631 | @@ -97,13 +92,14 @@ | |
1632 | memcpy(m_pCodecContext->extradata, hints.extradata, hints.extrasize); | |
1633 | } | |
1634 | ||
1635 | - if (m_dllAvCodec.avcodec_open(m_pCodecContext, pCodec) < 0) | |
1636 | + if (m_dllAvCodec.avcodec_open2(m_pCodecContext, pCodec, NULL) < 0) | |
1637 | { | |
1638 | CLog::Log(LOGDEBUG,"CDVDAudioCodecFFmpeg::Open() Unable to open codec"); | |
1639 | Dispose(); | |
1640 | return false; | |
1641 | } | |
1642 | ||
1643 | + m_pFrame1 = m_dllAvCodec.avcodec_alloc_frame(); | |
1644 | m_bOpenedCodec = true; | |
1645 | m_iSampleFormat = AV_SAMPLE_FMT_NONE; | |
1646 | return true; | |
1647 | @@ -111,6 +107,9 @@ | |
1648 | ||
1649 | void CDVDAudioCodecFFmpeg::Dispose() | |
1650 | { | |
1651 | + if (m_pFrame1) m_dllAvUtil.av_free(m_pFrame1); | |
1652 | + m_pFrame1 = NULL; | |
1653 | + | |
1654 | if (m_pConvert) | |
1655 | { | |
1656 | m_dllAvCodec.av_audio_convert_free(m_pConvert); | |
1657 | @@ -135,7 +134,7 @@ | |
1658 | ||
1659 | int CDVDAudioCodecFFmpeg::Decode(BYTE* pData, int iSize) | |
1660 | { | |
1661 | - int iBytesUsed; | |
1662 | + int iBytesUsed, got_frame; | |
1663 | if (!m_pCodecContext) return -1; | |
1664 | ||
1665 | m_iBufferSize1 = AVCODEC_MAX_AUDIO_FRAME_SIZE ; | |
1666 | @@ -145,10 +144,13 @@ | |
1667 | m_dllAvCodec.av_init_packet(&avpkt); | |
1668 | avpkt.data = pData; | |
1669 | avpkt.size = iSize; | |
1670 | - iBytesUsed = m_dllAvCodec.avcodec_decode_audio3( m_pCodecContext | |
1671 | - , (int16_t*)m_pBuffer1 | |
1672 | - , &m_iBufferSize1 | |
1673 | + iBytesUsed = m_dllAvCodec.avcodec_decode_audio4( m_pCodecContext | |
1674 | + , m_pFrame1 | |
1675 | + , &got_frame | |
1676 | , &avpkt); | |
1677 | + if (iBytesUsed < 0 || !got_frame) | |
1678 | + return iBytesUsed; | |
1679 | + m_iBufferSize1 = m_dllAvUtil.av_samples_get_buffer_size(NULL, m_pCodecContext->channels, m_pFrame1->nb_samples, m_pCodecContext->sample_fmt, 1); | |
1680 | ||
1681 | /* some codecs will attempt to consume more data than what we gave */ | |
1682 | if (iBytesUsed > iSize) | |
1683 | @@ -184,9 +186,9 @@ | |
1684 | return iBytesUsed; | |
1685 | } | |
1686 | ||
1687 | - const void *ibuf[6] = { m_pBuffer1 }; | |
1688 | + const void *ibuf[6] = { m_pFrame1->data[0] }; | |
1689 | void *obuf[6] = { m_pBuffer2 }; | |
1690 | - int istr[6] = { m_dllAvCore.av_get_bits_per_sample_fmt(m_pCodecContext->sample_fmt)/8 }; | |
1691 | + int istr[6] = { m_dllAvUtil.av_get_bytes_per_sample(m_pCodecContext->sample_fmt) }; | |
1692 | int ostr[6] = { 2 }; | |
1693 | int len = m_iBufferSize1 / istr[0]; | |
1694 | if(m_dllAvCodec.av_audio_convert(m_pConvert, obuf, ostr, ibuf, istr, len) < 0) | |
1695 | @@ -208,7 +210,7 @@ | |
1696 | { | |
1697 | if(m_iBufferSize1) | |
1698 | { | |
1699 | - *dst = m_pBuffer1; | |
1700 | + *dst = m_pFrame1->data[0]; | |
1701 | return m_iBufferSize1; | |
1702 | } | |
1703 | if(m_iBufferSize2) | |
1704 | @@ -273,7 +275,7 @@ | |
1705 | else | |
1706 | { | |
1707 | CLog::Log(LOGINFO, "CDVDAudioCodecFFmpeg::GetChannelMap - FFmpeg reported %d channels, but the layout contains %d ignoring", m_pCodecContext->channels, bits); | |
1708 | - layout = m_dllAvCodec.avcodec_guess_channel_layout(m_pCodecContext->channels, m_pCodecContext->codec_id, NULL); | |
1709 | + layout = m_dllAvUtil.av_get_default_channel_layout(m_pCodecContext->channels); | |
1710 | } | |
1711 | ||
1712 | int index = 0; | |
1713 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/DVDAudioCodecFFmpeg.h xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/DVDAudioCodecFFmpeg.h | |
1714 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/DVDAudioCodecFFmpeg.h 2012-03-21 23:07:50.000000000 +0100 | |
1715 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/DVDAudioCodecFFmpeg.h 2012-11-08 23:16:03.529738917 +0100 | |
1716 | @@ -23,7 +23,6 @@ | |
1717 | ||
1718 | #include "DVDAudioCodec.h" | |
1719 | #include "DllAvCodec.h" | |
1720 | -#include "DllAvCore.h" | |
1721 | #include "DllAvFormat.h" | |
1722 | #include "DllAvUtil.h" | |
1723 | ||
1724 | @@ -51,7 +50,7 @@ | |
1725 | enum AVSampleFormat m_iSampleFormat; | |
1726 | enum PCMChannels m_channelMap[PCM_MAX_CH + 1]; | |
1727 | ||
1728 | - BYTE *m_pBuffer1; | |
1729 | + AVFrame* m_pFrame1; | |
1730 | int m_iBufferSize1; | |
1731 | ||
1732 | BYTE *m_pBuffer2; | |
1733 | @@ -64,7 +63,6 @@ | |
1734 | int64_t m_layout; | |
1735 | ||
1736 | DllAvCodec m_dllAvCodec; | |
1737 | - DllAvCore m_dllAvCore; | |
1738 | DllAvUtil m_dllAvUtil; | |
1739 | ||
1740 | void BuildChannelMap(); | |
1741 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/DVDAudioCodecPassthroughFFmpeg.cpp xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/DVDAudioCodecPassthroughFFmpeg.cpp | |
1742 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/DVDAudioCodecPassthroughFFmpeg.cpp 2012-03-21 23:07:50.000000000 +0100 | |
1743 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/DVDAudioCodecPassthroughFFmpeg.cpp 2012-11-08 23:16:03.529738917 +0100 | |
1744 | @@ -79,11 +79,7 @@ | |
1745 | /* get the muxer */ | |
1746 | AVOutputFormat *fOut = NULL; | |
1747 | ||
1748 | -#if LIBAVFORMAT_VERSION_MAJOR < 52 | |
1749 | - fOut = m_dllAvFormat.guess_format(muxerName.c_str(), NULL, NULL); | |
1750 | -#else | |
1751 | fOut = m_dllAvFormat.av_guess_format(muxerName.c_str(), NULL, NULL); | |
1752 | -#endif | |
1753 | if (!fOut) | |
1754 | { | |
1755 | CLog::Log(LOGERROR, "CDVDAudioCodecPassthroughFFmpeg::SetupMuxer - Failed to get the FFmpeg %s muxer", muxerName.c_str()); | |
1756 | @@ -103,7 +99,7 @@ | |
1757 | muxer.m_pFormat->oformat = fOut; | |
1758 | ||
1759 | /* allocate a put_byte struct so we can grab the output */ | |
1760 | - muxer.m_pFormat->pb = m_dllAvFormat.av_alloc_put_byte(muxer.m_BCBuffer, sizeof(muxer.m_BCBuffer), URL_RDONLY, &muxer, NULL, MuxerReadPacket, NULL); | |
1761 | + muxer.m_pFormat->pb = m_dllAvFormat.avio_alloc_context(muxer.m_BCBuffer, sizeof(muxer.m_BCBuffer), AVIO_FLAG_READ, &muxer, NULL, MuxerReadPacket, NULL); | |
1762 | if (!muxer.m_pFormat->pb) | |
1763 | { | |
1764 | CLog::Log(LOGERROR, "CDVDAudioCodecPassthroughFFmpeg::SetupMuxer - Failed to allocate ByteIOContext"); | |
1765 | @@ -112,21 +108,10 @@ | |
1766 | } | |
1767 | ||
1768 | /* this is streamed, no file, and ignore the index */ | |
1769 | - muxer.m_pFormat->pb->is_streamed = 1; | |
1770 | + muxer.m_pFormat->pb->seekable = 0; | |
1771 | muxer.m_pFormat->flags |= AVFMT_NOFILE | AVFMT_FLAG_IGNIDX; | |
1772 | muxer.m_pFormat->bit_rate = hints.bitrate; | |
1773 | ||
1774 | - /* setup the muxer */ | |
1775 | - if (m_dllAvFormat.av_set_parameters(muxer.m_pFormat, NULL) != 0) | |
1776 | - { | |
1777 | - CLog::Log(LOGERROR, "CDVDAudioCodecPassthroughFFmpeg::SetupMuxer - Failed to set the %s muxer parameters", muxerName.c_str()); | |
1778 | - Dispose(); | |
1779 | - return false; | |
1780 | - } | |
1781 | - | |
1782 | -#if LIBAVFORMAT_VERSION_INT >= AV_VERSION_INT(52,92,0) | |
1783 | - // API added on: 2011-01-02 | |
1784 | - | |
1785 | /* While this is strictly only needed on big-endian systems, we do it on | |
1786 | * both to avoid as much dead code as possible. | |
1787 | * CoreAudio (at least on the cases we've seen) wants IEC 61937 in | |
1788 | @@ -138,8 +123,7 @@ | |
1789 | #endif | |
1790 | ||
1791 | /* request output of wanted endianness */ | |
1792 | - if (!fOut->priv_class || m_dllAvUtil.av_set_string3(muxer.m_pFormat->priv_data, "spdif_flags", spdifFlags, 0, NULL) != 0) | |
1793 | -#endif | |
1794 | + if (!fOut->priv_class || m_dllAvUtil.av_opt_set(muxer.m_pFormat->priv_data, "spdif_flags", spdifFlags, 0) != 0) | |
1795 | { | |
1796 | #if defined(WORDS_BIGENDIAN) && !defined(__APPLE__) | |
1797 | CLog::Log(LOGERROR, "CDVDAudioCodecPassthroughFFmpeg::SetupMuxer - Unable to set big-endian stream mode (FFmpeg too old?), disabling passthrough"); | |
1798 | @@ -149,7 +133,7 @@ | |
1799 | } | |
1800 | ||
1801 | /* add a stream to it */ | |
1802 | - muxer.m_pStream = m_dllAvFormat.av_new_stream(muxer.m_pFormat, 1); | |
1803 | + muxer.m_pStream = m_dllAvFormat.avformat_new_stream(muxer.m_pFormat, NULL); | |
1804 | if (!muxer.m_pStream) | |
1805 | { | |
1806 | CLog::Log(LOGERROR, "CDVDAudioCodecPassthroughFFmpeg::SetupMuxer - Failed to allocate AVStream context"); | |
1807 | @@ -159,8 +143,6 @@ | |
1808 | ||
1809 | ||
1810 | /* set the stream's parameters */ | |
1811 | - muxer.m_pStream->stream_copy = 1; | |
1812 | - | |
1813 | m_SampleRate = hints.samplerate; | |
1814 | if(!m_SampleRate && hints.codec == CODEC_ID_AC3) | |
1815 | m_SampleRate = 48000; | |
1816 | @@ -176,7 +158,7 @@ | |
1817 | codec->extradata_size = hints.extrasize; | |
1818 | memcpy(codec->extradata, hints.extradata, hints.extrasize); | |
1819 | ||
1820 | - muxer.m_WroteHeader = m_dllAvFormat.av_write_header(muxer.m_pFormat) == 0; | |
1821 | + muxer.m_WroteHeader = m_dllAvFormat.avformat_write_header(muxer.m_pFormat, NULL) == 0; | |
1822 | if (!muxer.m_WroteHeader) | |
1823 | { | |
1824 | CLog::Log(LOGERROR, "CDVDAudioCodecPassthrough::SetupMuxer - Failed to write the frame header"); | |
1825 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/Encoders/DVDAudioEncoderFFmpeg.cpp xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/Encoders/DVDAudioEncoderFFmpeg.cpp | |
1826 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/Encoders/DVDAudioEncoderFFmpeg.cpp 2012-03-21 23:07:50.000000000 +0100 | |
1827 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/Encoders/DVDAudioEncoderFFmpeg.cpp 2012-11-08 23:16:03.533072250 +0100 | |
1828 | @@ -55,7 +55,7 @@ | |
1829 | bool CDVDAudioEncoderFFmpeg::Initialize(unsigned int channels, enum PCMChannels *channelMap, unsigned int bitsPerSample, unsigned int sampleRate) | |
1830 | { | |
1831 | Reset(); | |
1832 | - if (!channelMap || !m_dllAvUtil.Load() || !m_dllAvCore.Load() || !m_dllAvCodec.Load()) | |
1833 | + if (!channelMap || !m_dllAvUtil.Load() || !m_dllAvCodec.Load()) | |
1834 | return false; | |
1835 | ||
1836 | m_dllAvCodec.avcodec_register_all(); | |
1837 | @@ -65,7 +65,7 @@ | |
1838 | return false; | |
1839 | ||
1840 | /* always assume 6 channels, 5.1... m_remap will give us what we want */ | |
1841 | - m_CodecCtx = m_dllAvCodec.avcodec_alloc_context(); | |
1842 | + m_CodecCtx = m_dllAvCodec.avcodec_alloc_context3(codec); | |
1843 | m_CodecCtx->bit_rate = AC3_ENCODE_BITRATE; | |
1844 | m_CodecCtx->sample_rate = sampleRate; | |
1845 | m_CodecCtx->channels = 6; | |
1846 | @@ -104,7 +104,7 @@ | |
1847 | } | |
1848 | } | |
1849 | ||
1850 | - if (m_dllAvCodec.avcodec_open(m_CodecCtx, codec)) | |
1851 | + if (m_dllAvCodec.avcodec_open2(m_CodecCtx, codec, NULL)) | |
1852 | { | |
1853 | m_dllAvUtil.av_freep(&m_CodecCtx); | |
1854 | return false; | |
1855 | @@ -149,7 +149,7 @@ | |
1856 | ||
1857 | if (m_AudioConvert) | |
1858 | m_TmpBuffer2 = new uint8_t[m_NeededFrames * m_CodecCtx->channels * | |
1859 | - m_dllAvCore.av_get_bits_per_sample_fmt(m_CodecCtx->sample_fmt) / 8]; | |
1860 | + m_dllAvUtil.av_get_bytes_per_sample(m_CodecCtx->sample_fmt)]; | |
1861 | ||
1862 | return true; | |
1863 | } | |
1864 | @@ -186,7 +186,7 @@ | |
1865 | void *convInBuf[] = { m_TmpBuffer }; | |
1866 | int convInStr[] = { m_BitsPerSample / 8 }; | |
1867 | void *convOutBuf[] = { m_TmpBuffer2 }; | |
1868 | - int convOutStr[] = { m_dllAvCore.av_get_bits_per_sample_fmt(m_CodecCtx->sample_fmt) / 8 }; | |
1869 | + int convOutStr[] = { m_dllAvUtil.av_get_bytes_per_sample(m_CodecCtx->sample_fmt) }; | |
1870 | if (m_dllAvCodec.av_audio_convert(m_AudioConvert, convOutBuf, convOutStr, | |
1871 | convInBuf, convInStr, m_NeededFrames * m_CodecCtx->channels) < 0) { | |
1872 | CLog::Log(LOGERROR, "CDVDAudioEncoderFFmpeg: Audio conversion failed"); | |
1873 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/Encoders/DVDAudioEncoderFFmpeg.h xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/Encoders/DVDAudioEncoderFFmpeg.h | |
1874 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/Encoders/DVDAudioEncoderFFmpeg.h 2012-03-21 23:07:50.000000000 +0100 | |
1875 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Audio/Encoders/DVDAudioEncoderFFmpeg.h 2012-11-08 23:15:55.399739205 +0100 | |
1876 | @@ -43,7 +43,6 @@ | |
1877 | virtual int GetData(uint8_t **data); | |
1878 | private: | |
1879 | DllAvCodec m_dllAvCodec; | |
1880 | - DllAvCore m_dllAvCore; | |
1881 | DllAvUtil m_dllAvUtil; | |
1882 | ||
1883 | AVCodecContext *m_CodecCtx; | |
1884 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Overlay/DVDOverlayCodecFFmpeg.cpp xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Overlay/DVDOverlayCodecFFmpeg.cpp | |
1885 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Overlay/DVDOverlayCodecFFmpeg.cpp 2012-03-21 23:07:50.000000000 +0100 | |
1886 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Overlay/DVDOverlayCodecFFmpeg.cpp 2012-11-08 23:16:03.533072250 +0100 | |
1887 | @@ -49,7 +49,14 @@ | |
1888 | ||
1889 | m_dllAvCodec.avcodec_register_all(); | |
1890 | ||
1891 | - m_pCodecContext = m_dllAvCodec.avcodec_alloc_context(); | |
1892 | + AVCodec* pCodec = m_dllAvCodec.avcodec_find_decoder(hints.codec); | |
1893 | + if (!pCodec) | |
1894 | + { | |
1895 | + CLog::Log(LOGDEBUG,"%s - Unable to find codec %d", __FUNCTION__, hints.codec); | |
1896 | + return false; | |
1897 | + } | |
1898 | + | |
1899 | + m_pCodecContext = m_dllAvCodec.avcodec_alloc_context3(pCodec); | |
1900 | m_pCodecContext->debug_mv = 0; | |
1901 | m_pCodecContext->debug = 0; | |
1902 | m_pCodecContext->workaround_bugs = FF_BUG_AUTODETECT; | |
1903 | @@ -100,14 +107,7 @@ | |
1904 | delete[] parse_extra; | |
1905 | } | |
1906 | ||
1907 | - AVCodec* pCodec = m_dllAvCodec.avcodec_find_decoder(hints.codec); | |
1908 | - if (!pCodec) | |
1909 | - { | |
1910 | - CLog::Log(LOGDEBUG,"%s - Unable to find codec %d", __FUNCTION__, hints.codec); | |
1911 | - return false; | |
1912 | - } | |
1913 | - | |
1914 | - if (m_dllAvCodec.avcodec_open(m_pCodecContext, pCodec) < 0) | |
1915 | + if (m_dllAvCodec.avcodec_open2(m_pCodecContext, pCodec, NULL) < 0) | |
1916 | { | |
1917 | CLog::Log(LOGDEBUG,"CDVDVideoCodecFFmpeg::Open() Unable to open codec"); | |
1918 | return false; | |
1919 | @@ -134,19 +134,12 @@ | |
1920 | { | |
1921 | for(unsigned i=0;i<sub.num_rects;i++) | |
1922 | { | |
1923 | -#if LIBAVCODEC_VERSION_INT >= (52<<10) | |
1924 | if(sub.rects[i]) | |
1925 | { | |
1926 | m_dllAvUtil.av_free(sub.rects[i]->pict.data[0]); | |
1927 | m_dllAvUtil.av_free(sub.rects[i]->pict.data[1]); | |
1928 | m_dllAvUtil.av_freep(&sub.rects[i]); | |
1929 | } | |
1930 | -#else | |
1931 | - if(sub.rects[i].bitmap) | |
1932 | - m_dllAvUtil.av_freep(&sub.rects[i].bitmap); | |
1933 | - if(m_Subtitle.rects[i].rgba_palette) | |
1934 | - m_dllAvUtil.av_freep(&sub.rects[i].rgba_palette); | |
1935 | -#endif | |
1936 | } | |
1937 | if(sub.rects) | |
1938 | m_dllAvUtil.av_freep(&sub.rects); | |
1939 | @@ -294,7 +287,6 @@ | |
1940 | overlay->source_width = m_width; | |
1941 | overlay->source_height = m_height; | |
1942 | ||
1943 | -#if LIBAVCODEC_VERSION_INT >= (52<<10) | |
1944 | BYTE* s = rect.pict.data[0]; | |
1945 | BYTE* t = overlay->data; | |
1946 | for(int i=0;i<rect.h;i++) | |
1947 | @@ -310,21 +302,6 @@ | |
1948 | m_dllAvUtil.av_free(rect.pict.data[0]); | |
1949 | m_dllAvUtil.av_free(rect.pict.data[1]); | |
1950 | m_dllAvUtil.av_freep(&m_Subtitle.rects[m_SubtitleIndex]); | |
1951 | -#else | |
1952 | - BYTE* s = rect.bitmap; | |
1953 | - BYTE* t = overlay->data; | |
1954 | - for(int i=0;i<rect.h;i++) | |
1955 | - { | |
1956 | - memcpy(t, s, rect.w); | |
1957 | - s += rect.linesize; | |
1958 | - t += overlay->linesize; | |
1959 | - } | |
1960 | - | |
1961 | - memcpy(overlay->palette, rect.rgba_palette, rect.nb_colors*4); | |
1962 | - | |
1963 | - m_dllAvUtil.av_freep(&rect.bitmap); | |
1964 | - m_dllAvUtil.av_freep(&rect.rgba_palette); | |
1965 | -#endif | |
1966 | m_SubtitleIndex++; | |
1967 | ||
1968 | return overlay; | |
1969 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecFFmpeg.cpp xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecFFmpeg.cpp | |
1970 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecFFmpeg.cpp 2012-03-21 23:07:50.000000000 +0100 | |
1971 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecFFmpeg.cpp 2012-11-08 23:16:12.336405273 +0100 | |
1972 | @@ -123,12 +123,11 @@ | |
1973 | CDVDVideoCodecFFmpeg::CDVDVideoCodecFFmpeg() : CDVDVideoCodec() | |
1974 | { | |
1975 | m_pCodecContext = NULL; | |
1976 | - m_pConvertFrame = NULL; | |
1977 | m_pFrame = NULL; | |
1978 | m_pFilterGraph = NULL; | |
1979 | m_pFilterIn = NULL; | |
1980 | m_pFilterOut = NULL; | |
1981 | - m_pFilterLink = NULL; | |
1982 | + m_pBufferRef = NULL; | |
1983 | ||
1984 | m_iPictureWidth = 0; | |
1985 | m_iPictureHeight = 0; | |
1986 | @@ -163,9 +162,13 @@ | |
1987 | m_dllAvFilter.avfilter_register_all(); | |
1988 | ||
1989 | m_bSoftware = hints.software; | |
1990 | - m_pCodecContext = m_dllAvCodec.avcodec_alloc_context(); | |
1991 | + | |
1992 | + m_formats.push_back(PIX_FMT_YUV420P); | |
1993 | + m_formats.push_back(PIX_FMT_YUVJ420P); | |
1994 | + m_formats.push_back(PIX_FMT_NONE); /* always add none to get a terminated list in ffmpeg world */ | |
1995 | ||
1996 | pCodec = NULL; | |
1997 | + m_pCodecContext = NULL; | |
1998 | ||
1999 | if (hints.codec == CODEC_ID_H264) | |
2000 | { | |
2001 | @@ -196,6 +199,7 @@ | |
2002 | ||
2003 | CLog::Log(LOGNOTICE,"CDVDVideoCodecFFmpeg::Open() Creating VDPAU(%ix%i, %d)",hints.width, hints.height, hints.codec); | |
2004 | CVDPAU* vdp = new CVDPAU(); | |
2005 | + m_pCodecContext = m_dllAvCodec.avcodec_alloc_context3(pCodec); | |
2006 | m_pCodecContext->codec_id = hints.codec; | |
2007 | m_pCodecContext->width = hints.width; | |
2008 | m_pCodecContext->height = hints.height; | |
2009 | @@ -207,7 +211,7 @@ | |
2010 | m_pCodecContext->codec_id = CODEC_ID_NONE; // ffmpeg will complain if this has been set | |
2011 | break; | |
2012 | } | |
2013 | - m_pCodecContext->codec_id = CODEC_ID_NONE; // ffmpeg will complain if this has been set | |
2014 | + m_dllAvUtil.av_freep(&m_pCodecContext); | |
2015 | CLog::Log(LOGNOTICE,"CDVDVideoCodecFFmpeg::Open() Failed to get VDPAU device"); | |
2016 | vdp->Release(); | |
2017 | } | |
2018 | @@ -226,6 +230,9 @@ | |
2019 | ||
2020 | CLog::Log(LOGNOTICE,"CDVDVideoCodecFFmpeg::Open() Using codec: %s",pCodec->long_name ? pCodec->long_name : pCodec->name); | |
2021 | ||
2022 | + if(m_pCodecContext == NULL) | |
2023 | + m_pCodecContext = m_dllAvCodec.avcodec_alloc_context3(pCodec); | |
2024 | + | |
2025 | m_pCodecContext->opaque = (void*)this; | |
2026 | m_pCodecContext->debug_mv = 0; | |
2027 | m_pCodecContext->debug = 0; | |
2028 | @@ -238,9 +245,7 @@ | |
2029 | m_pCodecContext->flags &= CODEC_FLAG_EMU_EDGE; | |
2030 | #else | |
2031 | if (pCodec->id != CODEC_ID_H264 && pCodec->capabilities & CODEC_CAP_DR1 | |
2032 | -#if LIBAVCODEC_VERSION_INT >= AV_VERSION_INT(52,69,0) | |
2033 | && pCodec->id != CODEC_ID_VP8 | |
2034 | -#endif | |
2035 | ) | |
2036 | m_pCodecContext->flags |= CODEC_FLAG_EMU_EDGE; | |
2037 | #endif | |
2038 | @@ -272,16 +277,16 @@ | |
2039 | if (it->m_name == "surfaces") | |
2040 | m_uSurfacesCount = std::atoi(it->m_value.c_str()); | |
2041 | else | |
2042 | - m_dllAvUtil.av_set_string3(m_pCodecContext, it->m_name.c_str(), it->m_value.c_str(), 0, NULL); | |
2043 | + m_dllAvUtil.av_opt_set(m_pCodecContext, it->m_name.c_str(), it->m_value.c_str(), 0); | |
2044 | } | |
2045 | ||
2046 | int num_threads = std::min(8 /*MAX_THREADS*/, g_cpuInfo.getCPUCount()); | |
2047 | if( num_threads > 1 && !hints.software && m_pHardware == NULL // thumbnail extraction fails when run threaded | |
2048 | && ( pCodec->id == CODEC_ID_H264 | |
2049 | || pCodec->id == CODEC_ID_MPEG4 )) | |
2050 | - m_dllAvCodec.avcodec_thread_init(m_pCodecContext, num_threads); | |
2051 | + m_pCodecContext->thread_count = num_threads; | |
2052 | ||
2053 | - if (m_dllAvCodec.avcodec_open(m_pCodecContext, pCodec) < 0) | |
2054 | + if (m_dllAvCodec.avcodec_open2(m_pCodecContext, pCodec, NULL) < 0) | |
2055 | { | |
2056 | CLog::Log(LOGDEBUG,"CDVDVideoCodecFFmpeg::Open() Unable to open codec"); | |
2057 | return false; | |
2058 | @@ -306,13 +311,6 @@ | |
2059 | if (m_pFrame) m_dllAvUtil.av_free(m_pFrame); | |
2060 | m_pFrame = NULL; | |
2061 | ||
2062 | - if (m_pConvertFrame) | |
2063 | - { | |
2064 | - m_dllAvCodec.avpicture_free(m_pConvertFrame); | |
2065 | - m_dllAvUtil.av_free(m_pConvertFrame); | |
2066 | - } | |
2067 | - m_pConvertFrame = NULL; | |
2068 | - | |
2069 | if (m_pCodecContext) | |
2070 | { | |
2071 | if (m_pCodecContext->codec) m_dllAvCodec.avcodec_close(m_pCodecContext); | |
2072 | @@ -458,9 +456,6 @@ | |
2073 | return VC_ERROR; | |
2074 | } | |
2075 | ||
2076 | - if (len != iSize && m_pCodecContext->skip_frame != AVDISCARD_NONREF) | |
2077 | - CLog::Log(LOGWARNING, "%s - avcodec_decode_video didn't consume the full packet. size: %d, consumed: %d", __FUNCTION__, iSize, len); | |
2078 | - | |
2079 | if (!iGotPicture) | |
2080 | return VC_BUFFER; | |
2081 | ||
2082 | @@ -478,67 +473,32 @@ | |
2083 | if(m_pCodecContext->codec_id == CODEC_ID_H264) | |
2084 | m_started = true; | |
2085 | ||
2086 | - if(m_pCodecContext->pix_fmt != PIX_FMT_YUV420P | |
2087 | - && m_pCodecContext->pix_fmt != PIX_FMT_YUVJ420P | |
2088 | - && m_pHardware == NULL) | |
2089 | - { | |
2090 | - if (!m_dllSwScale.IsLoaded() && !m_dllSwScale.Load()) | |
2091 | - return VC_ERROR; | |
2092 | - | |
2093 | - if (!m_pConvertFrame) | |
2094 | - { | |
2095 | - // Allocate an AVFrame structure | |
2096 | - m_pConvertFrame = (AVPicture*)m_dllAvUtil.av_mallocz(sizeof(AVPicture)); | |
2097 | - // Due to a bug in swsscale we need to allocate one extra line of data | |
2098 | - if(m_dllAvCodec.avpicture_alloc( m_pConvertFrame | |
2099 | - , PIX_FMT_YUV420P | |
2100 | - , m_pCodecContext->width | |
2101 | - , m_pCodecContext->height+1) < 0) | |
2102 | - { | |
2103 | - m_dllAvUtil.av_free(m_pConvertFrame); | |
2104 | - m_pConvertFrame = NULL; | |
2105 | - return VC_ERROR; | |
2106 | - } | |
2107 | - } | |
2108 | + if(m_pHardware == NULL) | |
2109 | + { | |
2110 | + bool need_scale = std::find( m_formats.begin() | |
2111 | + , m_formats.end() | |
2112 | + , m_pCodecContext->pix_fmt) == m_formats.end(); | |
2113 | ||
2114 | - // convert the picture | |
2115 | - struct SwsContext *context = m_dllSwScale.sws_getContext(m_pCodecContext->width, m_pCodecContext->height, | |
2116 | - m_pCodecContext->pix_fmt, m_pCodecContext->width, m_pCodecContext->height, | |
2117 | - PIX_FMT_YUV420P, SWS_FAST_BILINEAR | SwScaleCPUFlags(), NULL, NULL, NULL); | |
2118 | + bool need_reopen = false; | |
2119 | + if(!m_filters.Equals(m_filters_next)) | |
2120 | + need_reopen = true; | |
2121 | ||
2122 | - if(context == NULL) | |
2123 | + if(m_pFilterIn) | |
2124 | { | |
2125 | - CLog::Log(LOGERROR, "CDVDVideoCodecFFmpeg::Decode - unable to obtain sws context for w:%i, h:%i, pixfmt: %i", m_pCodecContext->width, m_pCodecContext->height, m_pCodecContext->pix_fmt); | |
2126 | - return VC_ERROR; | |
2127 | + if(m_pFilterIn->outputs[0]->format != m_pCodecContext->pix_fmt | |
2128 | + || m_pFilterIn->outputs[0]->w != m_pCodecContext->width | |
2129 | + || m_pFilterIn->outputs[0]->h != m_pCodecContext->height) | |
2130 | + need_reopen = true; | |
2131 | } | |
2132 | ||
2133 | - m_dllSwScale.sws_scale(context | |
2134 | - , m_pFrame->data | |
2135 | - , m_pFrame->linesize | |
2136 | - , 0 | |
2137 | - , m_pCodecContext->height | |
2138 | - , m_pConvertFrame->data | |
2139 | - , m_pConvertFrame->linesize); | |
2140 | - | |
2141 | - m_dllSwScale.sws_freeContext(context); | |
2142 | - } | |
2143 | - else | |
2144 | - { | |
2145 | - // no need to convert, just free any existing convert buffers | |
2146 | - if (m_pConvertFrame) | |
2147 | + // try to setup new filters | |
2148 | + if (need_reopen || (need_scale && m_pFilterGraph == NULL)) | |
2149 | { | |
2150 | - m_dllAvCodec.avpicture_free(m_pConvertFrame); | |
2151 | - m_dllAvUtil.av_free(m_pConvertFrame); | |
2152 | - m_pConvertFrame = NULL; | |
2153 | - } | |
2154 | - } | |
2155 | + m_filters = m_filters_next; | |
2156 | ||
2157 | - // try to setup new filters | |
2158 | - if (!m_filters.Equals(m_filters_next)) | |
2159 | - { | |
2160 | - m_filters = m_filters_next; | |
2161 | - if(FilterOpen(m_filters) < 0) | |
2162 | - FilterClose(); | |
2163 | + if(FilterOpen(m_filters, need_scale) < 0) | |
2164 | + FilterClose(); | |
2165 | + } | |
2166 | } | |
2167 | ||
2168 | int result; | |
2169 | @@ -564,12 +524,6 @@ | |
2170 | if (m_pHardware) | |
2171 | m_pHardware->Reset(); | |
2172 | ||
2173 | - if (m_pConvertFrame) | |
2174 | - { | |
2175 | - m_dllAvCodec.avpicture_free(m_pConvertFrame); | |
2176 | - m_dllAvUtil.av_free(m_pConvertFrame); | |
2177 | - m_pConvertFrame = NULL; | |
2178 | - } | |
2179 | m_filters = ""; | |
2180 | FilterClose(); | |
2181 | } | |
2182 | @@ -579,10 +533,10 @@ | |
2183 | pDvdVideoPicture->iWidth = m_pCodecContext->width; | |
2184 | pDvdVideoPicture->iHeight = m_pCodecContext->height; | |
2185 | ||
2186 | - if(m_pFilterLink) | |
2187 | + if(m_pBufferRef) | |
2188 | { | |
2189 | - pDvdVideoPicture->iWidth = m_pFilterLink->cur_buf->video->w; | |
2190 | - pDvdVideoPicture->iHeight = m_pFilterLink->cur_buf->video->h; | |
2191 | + pDvdVideoPicture->iWidth = m_pBufferRef->video->w; | |
2192 | + pDvdVideoPicture->iHeight = m_pBufferRef->video->h; | |
2193 | } | |
2194 | ||
2195 | /* crop of 10 pixels if demuxer asked it */ | |
2196 | @@ -598,12 +552,8 @@ | |
2197 | ||
2198 | /* use variable in the frame */ | |
2199 | AVRational pixel_aspect = m_pCodecContext->sample_aspect_ratio; | |
2200 | - if (m_pFilterLink) | |
2201 | -#ifdef HAVE_AVFILTERBUFFERREFVIDEOPROPS_SAMPLE_ASPECT_RATIO | |
2202 | - pixel_aspect = m_pFilterLink->cur_buf->video->sample_aspect_ratio; | |
2203 | -#else | |
2204 | - pixel_aspect = m_pFilterLink->cur_buf->video->pixel_aspect; | |
2205 | -#endif | |
2206 | + if (m_pBufferRef) | |
2207 | + pixel_aspect = m_pBufferRef->video->sample_aspect_ratio; | |
2208 | ||
2209 | if (pixel_aspect.num == 0) | |
2210 | aspect_ratio = 0; | |
2211 | @@ -632,8 +582,6 @@ | |
2212 | pDvdVideoPicture->iFlags = DVP_FLAG_ALLOCATED; | |
2213 | pDvdVideoPicture->iFlags |= m_pFrame->interlaced_frame ? DVP_FLAG_INTERLACED : 0; | |
2214 | pDvdVideoPicture->iFlags |= m_pFrame->top_field_first ? DVP_FLAG_TOP_FIELD_FIRST: 0; | |
2215 | - if(m_pCodecContext->pix_fmt == PIX_FMT_YUVJ420P) | |
2216 | - pDvdVideoPicture->color_range = 1; | |
2217 | ||
2218 | pDvdVideoPicture->chroma_position = m_pCodecContext->chroma_sample_location; | |
2219 | pDvdVideoPicture->color_primaries = m_pCodecContext->color_primaries; | |
2220 | @@ -677,14 +625,6 @@ | |
2221 | if(!GetPictureCommon(pDvdVideoPicture)) | |
2222 | return false; | |
2223 | ||
2224 | - if(m_pConvertFrame) | |
2225 | - { | |
2226 | - for (int i = 0; i < 4; i++) | |
2227 | - pDvdVideoPicture->data[i] = m_pConvertFrame->data[i]; | |
2228 | - for (int i = 0; i < 4; i++) | |
2229 | - pDvdVideoPicture->iLineSize[i] = m_pConvertFrame->linesize[i]; | |
2230 | - } | |
2231 | - else | |
2232 | { | |
2233 | for (int i = 0; i < 4; i++) | |
2234 | pDvdVideoPicture->data[i] = m_pFrame->data[i]; | |
2235 | @@ -693,20 +633,38 @@ | |
2236 | } | |
2237 | ||
2238 | pDvdVideoPicture->iFlags |= pDvdVideoPicture->data[0] ? 0 : DVP_FLAG_DROPPED; | |
2239 | - pDvdVideoPicture->format = DVDVideoPicture::FMT_YUV420P; | |
2240 | pDvdVideoPicture->extended_format = 0; | |
2241 | + pDvdVideoPicture->color_range = 0; | |
2242 | + | |
2243 | + PixelFormat pix_fmt; | |
2244 | + if(m_pBufferRef) | |
2245 | + pix_fmt = (PixelFormat)m_pBufferRef->format; | |
2246 | + else | |
2247 | + pix_fmt = m_pCodecContext->pix_fmt; | |
2248 | + | |
2249 | + switch(pix_fmt) | |
2250 | + { | |
2251 | + case PIX_FMT_YUVJ420P: | |
2252 | + pDvdVideoPicture->format = DVDVideoPicture::FMT_YUV420P; | |
2253 | + pDvdVideoPicture->color_range = 1; | |
2254 | + break; | |
2255 | + default: | |
2256 | + pDvdVideoPicture->format = DVDVideoPicture::FMT_YUV420P; | |
2257 | + break; | |
2258 | + } | |
2259 | ||
2260 | return true; | |
2261 | } | |
2262 | ||
2263 | -int CDVDVideoCodecFFmpeg::FilterOpen(const CStdString& filters) | |
2264 | +int CDVDVideoCodecFFmpeg::FilterOpen(const CStdString& filters, bool scale) | |
2265 | { | |
2266 | int result; | |
2267 | + AVBufferSinkParams *buffersink_params; | |
2268 | ||
2269 | if (m_pFilterGraph) | |
2270 | FilterClose(); | |
2271 | ||
2272 | - if (filters.IsEmpty()) | |
2273 | + if (filters.IsEmpty() && !scale) | |
2274 | return 0; | |
2275 | ||
2276 | if (!(m_pFilterGraph = m_dllAvFilter.avfilter_graph_alloc())) | |
2277 | @@ -715,17 +673,8 @@ | |
2278 | return -1; | |
2279 | } | |
2280 | ||
2281 | - // CrHasher HACK (if an alternative becomes available use it!): In order to display the output | |
2282 | - // produced by a combination of filters we insert "nullsink" as the last filter and we use | |
2283 | - // its input pin as our output pin. | |
2284 | - // | |
2285 | - // input --> .. --> last_filter --> [in] nullsink [null] [in] --> output | |
2286 | - // | | | |
2287 | - // | | | |
2288 | - // +------------------------+ | |
2289 | - // | |
2290 | AVFilter* srcFilter = m_dllAvFilter.avfilter_get_by_name("buffer"); | |
2291 | - AVFilter* outFilter = m_dllAvFilter.avfilter_get_by_name("nullsink"); // should be last filter in the graph for now | |
2292 | + AVFilter* outFilter = m_dllAvFilter.avfilter_get_by_name("buffersink"); // should be last filter in the graph for now | |
2293 | ||
2294 | CStdString args; | |
2295 | ||
2296 | @@ -744,11 +693,19 @@ | |
2297 | return result; | |
2298 | } | |
2299 | ||
2300 | - if ((result = m_dllAvFilter.avfilter_graph_create_filter(&m_pFilterOut, outFilter, "out", NULL, NULL/*nullsink=>NULL*/, m_pFilterGraph)) < 0) | |
2301 | + buffersink_params = m_dllAvFilter.av_buffersink_params_alloc(); | |
2302 | + buffersink_params->pixel_fmts = &m_formats[0]; | |
2303 | +#ifdef FF_API_OLD_VSINK_API | |
2304 | + if ((result = m_dllAvFilter.avfilter_graph_create_filter(&m_pFilterOut, outFilter, "out", NULL, (void*)buffersink_params->pixel_fmts, m_pFilterGraph)) < 0) | |
2305 | +#else | |
2306 | + if ((result = m_dllAvFilter.avfilter_graph_create_filter(&m_pFilterOut, outFilter, "out", NULL, buffersink_params, m_pFilterGraph)) < 0) | |
2307 | +#endif | |
2308 | { | |
2309 | + m_dllAvUtil.av_freep(&buffersink_params); | |
2310 | CLog::Log(LOGERROR, "CDVDVideoCodecFFmpeg::FilterOpen - avfilter_graph_create_filter: out"); | |
2311 | return result; | |
2312 | } | |
2313 | + m_dllAvUtil.av_freep(&buffersink_params); | |
2314 | ||
2315 | if (!filters.empty()) | |
2316 | { | |
2317 | @@ -794,6 +751,12 @@ | |
2318 | ||
2319 | void CDVDVideoCodecFFmpeg::FilterClose() | |
2320 | { | |
2321 | + if(m_pBufferRef) | |
2322 | + { | |
2323 | + m_dllAvFilter.avfilter_unref_buffer(m_pBufferRef); | |
2324 | + m_pBufferRef = NULL; | |
2325 | + } | |
2326 | + | |
2327 | if (m_pFilterGraph) | |
2328 | { | |
2329 | m_dllAvFilter.avfilter_graph_free(&m_pFilterGraph); | |
2330 | @@ -801,7 +764,6 @@ | |
2331 | // Disposed by above code | |
2332 | m_pFilterIn = NULL; | |
2333 | m_pFilterOut = NULL; | |
2334 | - m_pFilterLink = NULL; | |
2335 | } | |
2336 | } | |
2337 | ||
2338 | @@ -809,48 +771,41 @@ | |
2339 | { | |
2340 | int result, frames; | |
2341 | ||
2342 | - m_pFilterLink = m_pFilterOut->inputs[0]; | |
2343 | - | |
2344 | if (frame) | |
2345 | { | |
2346 | -#if LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,13,0) | |
2347 | +#if LIBAVFILTER_VERSION_INT < AV_VERSION_INT(3,0,0) | |
2348 | result = m_dllAvFilter.av_vsrc_buffer_add_frame(m_pFilterIn, frame, 0); | |
2349 | -#elif LIBAVFILTER_VERSION_INT >= AV_VERSION_INT(2,7,0) | |
2350 | - result = m_dllAvFilter.av_vsrc_buffer_add_frame(m_pFilterIn, frame); | |
2351 | -#elif LIBAVCODEC_VERSION_INT >= AV_VERSION_INT(53,3,0) | |
2352 | - result = m_dllAvFilter.av_vsrc_buffer_add_frame(m_pFilterIn, frame, frame->pts); | |
2353 | #else | |
2354 | - result = m_dllAvFilter.av_vsrc_buffer_add_frame(m_pFilterIn, frame, frame->pts, m_pCodecContext->sample_aspect_ratio); | |
2355 | + result = m_dllAvFilter.av_buffersrc_add_frame(m_pFilterIn, frame, 0); | |
2356 | #endif | |
2357 | - | |
2358 | if (result < 0) | |
2359 | { | |
2360 | +#if LIBAVFILTER_VERSION_INT < AV_VERSION_INT(3,0,0) | |
2361 | CLog::Log(LOGERROR, "CDVDVideoCodecFFmpeg::FilterProcess - av_vsrc_buffer_add_frame"); | |
2362 | +#else | |
2363 | + CLog::Log(LOGERROR, "CDVDVideoCodecFFmpeg::FilterProcess - av_buffersrc_add_frame"); | |
2364 | +#endif | |
2365 | return VC_ERROR; | |
2366 | } | |
2367 | } | |
2368 | ||
2369 | - if ((frames = m_dllAvFilter.avfilter_poll_frame(m_pFilterLink)) < 0) | |
2370 | + if(m_pBufferRef) | |
2371 | + { | |
2372 | + m_dllAvFilter.avfilter_unref_buffer(m_pBufferRef); | |
2373 | + m_pBufferRef = NULL; | |
2374 | + } | |
2375 | + | |
2376 | + if ((frames = m_dllAvFilter.av_buffersink_poll_frame(m_pFilterOut)) < 0) | |
2377 | { | |
2378 | - CLog::Log(LOGERROR, "CDVDVideoCodecFFmpeg::FilterProcess - avfilter_poll_frame"); | |
2379 | + CLog::Log(LOGERROR, "CDVDVideoCodecFFmpeg::FilterProcess - av_buffersink_poll_frame"); | |
2380 | return VC_ERROR; | |
2381 | } | |
2382 | ||
2383 | if (frames > 0) | |
2384 | { | |
2385 | - if (m_pFilterLink->cur_buf) | |
2386 | - { | |
2387 | - m_dllAvFilter.avfilter_unref_buffer(m_pFilterLink->cur_buf); | |
2388 | - m_pFilterLink->cur_buf = NULL; | |
2389 | - } | |
2390 | - | |
2391 | - if ((result = m_dllAvFilter.avfilter_request_frame(m_pFilterLink)) < 0) | |
2392 | - { | |
2393 | - CLog::Log(LOGERROR, "CDVDVideoCodecFFmpeg::FilterProcess - avfilter_request_frame"); | |
2394 | - return VC_ERROR; | |
2395 | - } | |
2396 | ||
2397 | - if (!m_pFilterLink->cur_buf) | |
2398 | + result = m_dllAvFilter.av_buffersink_get_buffer_ref(m_pFilterOut, &m_pBufferRef, 0); | |
2399 | + if(!m_pBufferRef) | |
2400 | { | |
2401 | CLog::Log(LOGERROR, "CDVDVideoCodecFFmpeg::FilterProcess - cur_buf"); | |
2402 | return VC_ERROR; | |
2403 | @@ -861,11 +816,11 @@ | |
2404 | else | |
2405 | m_pFrame->repeat_pict = -(frames - 1); | |
2406 | ||
2407 | - m_pFrame->interlaced_frame = m_pFilterLink->cur_buf->video->interlaced; | |
2408 | - m_pFrame->top_field_first = m_pFilterLink->cur_buf->video->top_field_first; | |
2409 | + m_pFrame->interlaced_frame = m_pBufferRef->video->interlaced; | |
2410 | + m_pFrame->top_field_first = m_pBufferRef->video->top_field_first; | |
2411 | ||
2412 | - memcpy(m_pFrame->linesize, m_pFilterLink->cur_buf->linesize, 4*sizeof(int)); | |
2413 | - memcpy(m_pFrame->data , m_pFilterLink->cur_buf->data , 4*sizeof(uint8_t*)); | |
2414 | + memcpy(m_pFrame->linesize, m_pBufferRef->linesize, 4*sizeof(int)); | |
2415 | + memcpy(m_pFrame->data , m_pBufferRef->data , 4*sizeof(uint8_t*)); | |
2416 | ||
2417 | if(frames > 1) | |
2418 | return VC_PICTURE; | |
2419 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecFFmpeg.h xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecFFmpeg.h | |
2420 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecFFmpeg.h 2012-03-21 23:07:50.000000000 +0100 | |
2421 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecFFmpeg.h 2012-11-08 23:16:03.533072250 +0100 | |
2422 | @@ -75,20 +75,19 @@ | |
2423 | protected: | |
2424 | static enum PixelFormat GetFormat(struct AVCodecContext * avctx, const PixelFormat * fmt); | |
2425 | ||
2426 | - int FilterOpen(const CStdString& filters); | |
2427 | + int FilterOpen(const CStdString& filters, bool scale); | |
2428 | void FilterClose(); | |
2429 | int FilterProcess(AVFrame* frame); | |
2430 | ||
2431 | AVFrame* m_pFrame; | |
2432 | AVCodecContext* m_pCodecContext; | |
2433 | ||
2434 | - AVPicture* m_pConvertFrame; | |
2435 | CStdString m_filters; | |
2436 | CStdString m_filters_next; | |
2437 | AVFilterGraph* m_pFilterGraph; | |
2438 | AVFilterContext* m_pFilterIn; | |
2439 | AVFilterContext* m_pFilterOut; | |
2440 | - AVFilterLink* m_pFilterLink; | |
2441 | + AVFilterBufferRef* m_pBufferRef; | |
2442 | ||
2443 | int m_iPictureWidth; | |
2444 | int m_iPictureHeight; | |
2445 | @@ -109,4 +108,5 @@ | |
2446 | int m_iLastKeyframe; | |
2447 | double m_dts; | |
2448 | bool m_started; | |
2449 | + std::vector<PixelFormat> m_formats; | |
2450 | }; | |
2451 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecVDA.cpp xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecVDA.cpp | |
2452 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecVDA.cpp 2012-03-21 23:07:50.000000000 +0100 | |
2453 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecVDA.cpp 2012-11-08 23:16:03.533072250 +0100 | |
2454 | @@ -525,8 +525,8 @@ | |
2455 | { | |
2456 | while (!*(nal_start++)); | |
2457 | nal_end = avc_find_startcode(nal_start, end); | |
2458 | - av_format_ctx->put_be32(pb, nal_end - nal_start); | |
2459 | - av_format_ctx->put_buffer(pb, nal_start, nal_end - nal_start); | |
2460 | + av_format_ctx->avio_wb32(pb, nal_end - nal_start); | |
2461 | + av_format_ctx->avio_write(pb, nal_start, nal_end - nal_start); | |
2462 | size += 4 + nal_end - nal_start; | |
2463 | nal_start = nal_end; | |
2464 | } | |
2465 | @@ -537,14 +537,14 @@ | |
2466 | const uint8_t *buf_in, uint8_t **buf, int *size) | |
2467 | { | |
2468 | ByteIOContext *pb; | |
2469 | - int ret = av_format_ctx->url_open_dyn_buf(&pb); | |
2470 | + int ret = av_format_ctx->avio_open_dyn_buf(&pb); | |
2471 | if (ret < 0) | |
2472 | return ret; | |
2473 | ||
2474 | avc_parse_nal_units(av_format_ctx, pb, buf_in, *size); | |
2475 | ||
2476 | av_util_ctx->av_freep(buf); | |
2477 | - *size = av_format_ctx->url_close_dyn_buf(pb, buf); | |
2478 | + *size = av_format_ctx->avio_close_dyn_buf(pb, buf); | |
2479 | return 0; | |
2480 | } | |
2481 | ||
2482 | @@ -590,26 +590,26 @@ | |
2483 | } | |
2484 | assert(sps); | |
2485 | ||
2486 | - av_format_ctx->put_byte(pb, 1); /* version */ | |
2487 | - av_format_ctx->put_byte(pb, sps[1]); /* profile */ | |
2488 | - av_format_ctx->put_byte(pb, sps[2]); /* profile compat */ | |
2489 | - av_format_ctx->put_byte(pb, sps[3]); /* level */ | |
2490 | - av_format_ctx->put_byte(pb, 0xff); /* 6 bits reserved (111111) + 2 bits nal size length - 1 (11) */ | |
2491 | - av_format_ctx->put_byte(pb, 0xe1); /* 3 bits reserved (111) + 5 bits number of sps (00001) */ | |
2492 | + av_format_ctx->avio_w8(pb, 1); /* version */ | |
2493 | + av_format_ctx->avio_w8(pb, sps[1]); /* profile */ | |
2494 | + av_format_ctx->avio_w8(pb, sps[2]); /* profile compat */ | |
2495 | + av_format_ctx->avio_w8(pb, sps[3]); /* level */ | |
2496 | + av_format_ctx->avio_w8(pb, 0xff); /* 6 bits reserved (111111) + 2 bits nal size length - 1 (11) */ | |
2497 | + av_format_ctx->avio_w8(pb, 0xe1); /* 3 bits reserved (111) + 5 bits number of sps (00001) */ | |
2498 | ||
2499 | - av_format_ctx->put_be16(pb, sps_size); | |
2500 | - av_format_ctx->put_buffer(pb, sps, sps_size); | |
2501 | + av_format_ctx->avio_wb16(pb, sps_size); | |
2502 | + av_format_ctx->avio_write(pb, sps, sps_size); | |
2503 | if (pps) | |
2504 | { | |
2505 | - av_format_ctx->put_byte(pb, 1); /* number of pps */ | |
2506 | - av_format_ctx->put_be16(pb, pps_size); | |
2507 | - av_format_ctx->put_buffer(pb, pps, pps_size); | |
2508 | + av_format_ctx->avio_w8(pb, 1); /* number of pps */ | |
2509 | + av_format_ctx->avio_wb16(pb, pps_size); | |
2510 | + av_format_ctx->avio_write(pb, pps, pps_size); | |
2511 | } | |
2512 | av_util_ctx->av_free(start); | |
2513 | } | |
2514 | else | |
2515 | { | |
2516 | - av_format_ctx->put_buffer(pb, data, len); | |
2517 | + av_format_ctx->avio_write(pb, data, len); | |
2518 | } | |
2519 | } | |
2520 | return 0; | |
2521 | @@ -706,7 +706,7 @@ | |
2522 | } | |
2523 | ||
2524 | ByteIOContext *pb; | |
2525 | - if (m_dllAvFormat->url_open_dyn_buf(&pb) < 0) | |
2526 | + if (m_dllAvFormat->avio_open_dyn_buf(&pb) < 0) | |
2527 | { | |
2528 | return false; | |
2529 | } | |
2530 | @@ -717,7 +717,7 @@ | |
2531 | // unhook from ffmpeg's extradata | |
2532 | extradata = NULL; | |
2533 | // extract the avcC atom data into extradata then write it into avcCData for VDADecoder | |
2534 | - extrasize = m_dllAvFormat->url_close_dyn_buf(pb, &extradata); | |
2535 | + extrasize = m_dllAvFormat->avio_close_dyn_buf(pb, &extradata); | |
2536 | // CFDataCreate makes a copy of extradata contents | |
2537 | avcCData = CFDataCreate(kCFAllocatorDefault, (const uint8_t*)extradata, extrasize); | |
2538 | // done with the converted extradata, we MUST free using av_free | |
2539 | @@ -948,12 +948,12 @@ | |
2540 | int demuxer_bytes; | |
2541 | uint8_t *demuxer_content; | |
2542 | ||
2543 | - if(m_dllAvFormat->url_open_dyn_buf(&pb) < 0) | |
2544 | + if(m_dllAvFormat->avio_open_dyn_buf(&pb) < 0) | |
2545 | { | |
2546 | return VC_ERROR; | |
2547 | } | |
2548 | demuxer_bytes = avc_parse_nal_units(m_dllAvFormat, pb, pData, iSize); | |
2549 | - demuxer_bytes = m_dllAvFormat->url_close_dyn_buf(pb, &demuxer_content); | |
2550 | + demuxer_bytes = m_dllAvFormat->avio_close_dyn_buf(pb, &demuxer_content); | |
2551 | avc_demux = CFDataCreate(kCFAllocatorDefault, demuxer_content, demuxer_bytes); | |
2552 | m_dllAvUtil->av_free(demuxer_content); | |
2553 | } | |
2554 | @@ -961,7 +961,7 @@ | |
2555 | { | |
2556 | // convert demuxer packet from 3 byte NAL sizes to 4 byte | |
2557 | ByteIOContext *pb; | |
2558 | - if (m_dllAvFormat->url_open_dyn_buf(&pb) < 0) | |
2559 | + if (m_dllAvFormat->avio_open_dyn_buf(&pb) < 0) | |
2560 | return VC_ERROR; | |
2561 | ||
2562 | uint32_t nal_size; | |
2563 | @@ -970,14 +970,14 @@ | |
2564 | while (nal_start < end) | |
2565 | { | |
2566 | nal_size = VDA_RB24(nal_start); | |
2567 | - m_dllAvFormat->put_be32(pb, nal_size); | |
2568 | + m_dllAvFormat->avio_wb32(pb, nal_size); | |
2569 | nal_start += 3; | |
2570 | - m_dllAvFormat->put_buffer(pb, nal_start, nal_size); | |
2571 | + m_dllAvFormat->avio_write(pb, nal_start, nal_size); | |
2572 | nal_start += nal_size; | |
2573 | } | |
2574 | ||
2575 | uint8_t *demuxer_content; | |
2576 | - int demuxer_bytes = m_dllAvFormat->url_close_dyn_buf(pb, &demuxer_content); | |
2577 | + int demuxer_bytes = m_dllAvFormat->avio_close_dyn_buf(pb, &demuxer_content); | |
2578 | avc_demux = CFDataCreate(kCFAllocatorDefault, demuxer_content, demuxer_bytes); | |
2579 | m_dllAvUtil->av_free(demuxer_content); | |
2580 | } | |
2581 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecVideoToolBox.cpp xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecVideoToolBox.cpp | |
2582 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecVideoToolBox.cpp 2012-03-21 23:07:50.000000000 +0100 | |
2583 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Video/DVDVideoCodecVideoToolBox.cpp 2012-11-08 23:16:03.533072250 +0100 | |
2584 | @@ -474,7 +474,7 @@ | |
2585 | { | |
2586 | b |= 0x80; | |
2587 | } | |
2588 | - av_format_ctx->put_byte(pb, b); | |
2589 | + av_format_ctx->avio_w8(pb, b); | |
2590 | } | |
2591 | ||
2592 | return numBytes; | |
2593 | @@ -482,37 +482,37 @@ | |
2594 | ||
2595 | void quicktime_write_esds(DllAvFormat *av_format_ctx, ByteIOContext *pb, quicktime_esds_t *esds) | |
2596 | { | |
2597 | - av_format_ctx->put_byte(pb, 0); // Version | |
2598 | - av_format_ctx->put_be24(pb, 0); // Flags | |
2599 | + av_format_ctx->avio_w8(pb, 0); // Version | |
2600 | + av_format_ctx->avio_wb24(pb, 0); // Flags | |
2601 | ||
2602 | // elementary stream descriptor tag | |
2603 | - av_format_ctx->put_byte(pb, 0x03); | |
2604 | + av_format_ctx->avio_w8(pb, 0x03); | |
2605 | quicktime_write_mp4_descr_length(av_format_ctx, pb, | |
2606 | 3 + 5 + (13 + 5 + esds->decoderConfigLen) + 3, false); | |
2607 | // 3 bytes + 5 bytes for tag | |
2608 | - av_format_ctx->put_be16(pb, esds->esid); | |
2609 | - av_format_ctx->put_byte(pb, esds->stream_priority); | |
2610 | + av_format_ctx->avio_wb16(pb, esds->esid); | |
2611 | + av_format_ctx->avio_w8(pb, esds->stream_priority); | |
2612 | ||
2613 | // decoder configuration description tag | |
2614 | - av_format_ctx->put_byte(pb, 0x04); | |
2615 | + av_format_ctx->avio_w8(pb, 0x04); | |
2616 | quicktime_write_mp4_descr_length(av_format_ctx, pb, | |
2617 | 13 + 5 + esds->decoderConfigLen, false); | |
2618 | // 13 bytes + 5 bytes for tag | |
2619 | - av_format_ctx->put_byte(pb, esds->objectTypeId); // objectTypeIndication | |
2620 | - av_format_ctx->put_byte(pb, esds->streamType); // streamType | |
2621 | - av_format_ctx->put_be24(pb, esds->bufferSizeDB); // buffer size | |
2622 | - av_format_ctx->put_be32(pb, esds->maxBitrate); // max bitrate | |
2623 | - av_format_ctx->put_be32(pb, esds->avgBitrate); // average bitrate | |
2624 | + av_format_ctx->avio_w8(pb, esds->objectTypeId); // objectTypeIndication | |
2625 | + av_format_ctx->avio_w8(pb, esds->streamType); // streamType | |
2626 | + av_format_ctx->avio_wb24(pb, esds->bufferSizeDB); // buffer size | |
2627 | + av_format_ctx->avio_wb32(pb, esds->maxBitrate); // max bitrate | |
2628 | + av_format_ctx->avio_wb32(pb, esds->avgBitrate); // average bitrate | |
2629 | ||
2630 | // decoder specific description tag | |
2631 | - av_format_ctx->put_byte(pb, 0x05); | |
2632 | + av_format_ctx->avio_w8(pb, 0x05); | |
2633 | quicktime_write_mp4_descr_length(av_format_ctx, pb, esds->decoderConfigLen, false); | |
2634 | - av_format_ctx->put_buffer(pb, esds->decoderConfig, esds->decoderConfigLen); | |
2635 | + av_format_ctx->avio_write(pb, esds->decoderConfig, esds->decoderConfigLen); | |
2636 | ||
2637 | // sync layer configuration descriptor tag | |
2638 | - av_format_ctx->put_byte(pb, 0x06); // tag | |
2639 | - av_format_ctx->put_byte(pb, 0x01); // length | |
2640 | - av_format_ctx->put_byte(pb, 0x7F); // no SL | |
2641 | + av_format_ctx->avio_w8(pb, 0x06); // tag | |
2642 | + av_format_ctx->avio_w8(pb, 0x01); // length | |
2643 | + av_format_ctx->avio_w8(pb, 0x7F); // no SL | |
2644 | ||
2645 | /* no IPI_DescrPointer */ | |
2646 | /* no IP_IdentificationDataSet */ | |
2647 | @@ -666,8 +666,8 @@ | |
2648 | { | |
2649 | while (!*(nal_start++)); | |
2650 | nal_end = avc_find_startcode(nal_start, end); | |
2651 | - av_format_ctx->put_be32(pb, nal_end - nal_start); | |
2652 | - av_format_ctx->put_buffer(pb, nal_start, nal_end - nal_start); | |
2653 | + av_format_ctx->avio_wb32(pb, nal_end - nal_start); | |
2654 | + av_format_ctx->avio_write(pb, nal_start, nal_end - nal_start); | |
2655 | size += 4 + nal_end - nal_start; | |
2656 | nal_start = nal_end; | |
2657 | } | |
2658 | @@ -678,14 +678,14 @@ | |
2659 | const uint8_t *buf_in, uint8_t **buf, int *size) | |
2660 | { | |
2661 | ByteIOContext *pb; | |
2662 | - int ret = av_format_ctx->url_open_dyn_buf(&pb); | |
2663 | + int ret = av_format_ctx->avio_open_dyn_buf(&pb); | |
2664 | if (ret < 0) | |
2665 | return ret; | |
2666 | ||
2667 | avc_parse_nal_units(av_format_ctx, pb, buf_in, *size); | |
2668 | ||
2669 | av_util_ctx->av_freep(buf); | |
2670 | - *size = av_format_ctx->url_close_dyn_buf(pb, buf); | |
2671 | + *size = av_format_ctx->avio_close_dyn_buf(pb, buf); | |
2672 | return 0; | |
2673 | } | |
2674 | ||
2675 | @@ -770,26 +770,26 @@ | |
2676 | } | |
2677 | assert(sps); | |
2678 | ||
2679 | - av_format_ctx->put_byte(pb, 1); /* version */ | |
2680 | - av_format_ctx->put_byte(pb, sps[1]); /* profile */ | |
2681 | - av_format_ctx->put_byte(pb, sps[2]); /* profile compat */ | |
2682 | - av_format_ctx->put_byte(pb, sps[3]); /* level */ | |
2683 | - av_format_ctx->put_byte(pb, 0xff); /* 6 bits reserved (111111) + 2 bits nal size length - 1 (11) */ | |
2684 | - av_format_ctx->put_byte(pb, 0xe1); /* 3 bits reserved (111) + 5 bits number of sps (00001) */ | |
2685 | + av_format_ctx->avio_w8(pb, 1); /* version */ | |
2686 | + av_format_ctx->avio_w8(pb, sps[1]); /* profile */ | |
2687 | + av_format_ctx->avio_w8(pb, sps[2]); /* profile compat */ | |
2688 | + av_format_ctx->avio_w8(pb, sps[3]); /* level */ | |
2689 | + av_format_ctx->avio_w8(pb, 0xff); /* 6 bits reserved (111111) + 2 bits nal size length - 1 (11) */ | |
2690 | + av_format_ctx->avio_w8(pb, 0xe1); /* 3 bits reserved (111) + 5 bits number of sps (00001) */ | |
2691 | ||
2692 | - av_format_ctx->put_be16(pb, sps_size); | |
2693 | - av_format_ctx->put_buffer(pb, sps, sps_size); | |
2694 | + av_format_ctx->avio_wb16(pb, sps_size); | |
2695 | + av_format_ctx->avio_write(pb, sps, sps_size); | |
2696 | if (pps) | |
2697 | { | |
2698 | - av_format_ctx->put_byte(pb, 1); /* number of pps */ | |
2699 | - av_format_ctx->put_be16(pb, pps_size); | |
2700 | - av_format_ctx->put_buffer(pb, pps, pps_size); | |
2701 | + av_format_ctx->avio_w8(pb, 1); /* number of pps */ | |
2702 | + av_format_ctx->avio_wb16(pb, pps_size); | |
2703 | + av_format_ctx->avio_write(pb, pps, pps_size); | |
2704 | } | |
2705 | av_util_ctx->av_free(start); | |
2706 | } | |
2707 | else | |
2708 | { | |
2709 | - av_format_ctx->put_buffer(pb, data, len); | |
2710 | + av_format_ctx->avio_write(pb, data, len); | |
2711 | } | |
2712 | } | |
2713 | return 0; | |
2714 | @@ -1086,7 +1086,7 @@ | |
2715 | ByteIOContext *pb; | |
2716 | quicktime_esds_t *esds; | |
2717 | ||
2718 | - if (m_dllAvFormat->url_open_dyn_buf(&pb) < 0) | |
2719 | + if (m_dllAvFormat->avio_open_dyn_buf(&pb) < 0) | |
2720 | return false; | |
2721 | ||
2722 | esds = quicktime_set_esds(m_dllAvFormat, extradata, extrasize); | |
2723 | @@ -1095,7 +1095,7 @@ | |
2724 | // unhook from ffmpeg's extradata | |
2725 | extradata = NULL; | |
2726 | // extract the esds atom decoderConfig from extradata | |
2727 | - extrasize = m_dllAvFormat->url_close_dyn_buf(pb, &extradata); | |
2728 | + extrasize = m_dllAvFormat->avio_close_dyn_buf(pb, &extradata); | |
2729 | free(esds->decoderConfig); | |
2730 | free(esds); | |
2731 | ||
2732 | @@ -1152,7 +1152,7 @@ | |
2733 | // NAL reformating to bitstream format required | |
2734 | ||
2735 | ByteIOContext *pb; | |
2736 | - if (m_dllAvFormat->url_open_dyn_buf(&pb) < 0) | |
2737 | + if (m_dllAvFormat->avio_open_dyn_buf(&pb) < 0) | |
2738 | return false; | |
2739 | ||
2740 | m_convert_bytestream = true; | |
2741 | @@ -1161,7 +1161,7 @@ | |
2742 | // unhook from ffmpeg's extradata | |
2743 | extradata = NULL; | |
2744 | // extract the avcC atom data into extradata getting size into extrasize | |
2745 | - extrasize = m_dllAvFormat->url_close_dyn_buf(pb, &extradata); | |
2746 | + extrasize = m_dllAvFormat->avio_close_dyn_buf(pb, &extradata); | |
2747 | ||
2748 | // check for interlaced and get number of ref frames | |
2749 | if (!validate_avcC_spc(extradata, extrasize, &m_max_ref_frames)) | |
2750 | @@ -1301,17 +1301,17 @@ | |
2751 | if (m_convert_bytestream) | |
2752 | { | |
2753 | // convert demuxer packet from bytestream (AnnexB) to bitstream | |
2754 | - if(m_dllAvFormat->url_open_dyn_buf(&pb) < 0) | |
2755 | + if(m_dllAvFormat->avio_open_dyn_buf(&pb) < 0) | |
2756 | return VC_ERROR; | |
2757 | ||
2758 | demux_size = avc_parse_nal_units(m_dllAvFormat, pb, pData, iSize); | |
2759 | - demux_size = m_dllAvFormat->url_close_dyn_buf(pb, &demux_buff); | |
2760 | + demux_size = m_dllAvFormat->avio_close_dyn_buf(pb, &demux_buff); | |
2761 | sampleBuff = CreateSampleBufferFrom(m_fmt_desc, demux_buff, demux_size); | |
2762 | } | |
2763 | else if (m_convert_3byteTo4byteNALSize) | |
2764 | { | |
2765 | // convert demuxer packet from 3 byte NAL sizes to 4 byte | |
2766 | - if (m_dllAvFormat->url_open_dyn_buf(&pb) < 0) | |
2767 | + if (m_dllAvFormat->avio_open_dyn_buf(&pb) < 0) | |
2768 | return VC_ERROR; | |
2769 | ||
2770 | uint32_t nal_size; | |
2771 | @@ -1320,13 +1320,13 @@ | |
2772 | while (nal_start < end) | |
2773 | { | |
2774 | nal_size = VDA_RB24(nal_start); | |
2775 | - m_dllAvFormat->put_be32(pb, nal_size); | |
2776 | + m_dllAvFormat->avio_wb32(pb, nal_size); | |
2777 | nal_start += 3; | |
2778 | - m_dllAvFormat->put_buffer(pb, nal_start, nal_size); | |
2779 | + m_dllAvFormat->avio_write(pb, nal_start, nal_size); | |
2780 | nal_start += nal_size; | |
2781 | } | |
2782 | ||
2783 | - demux_size = m_dllAvFormat->url_close_dyn_buf(pb, &demux_buff); | |
2784 | + demux_size = m_dllAvFormat->avio_close_dyn_buf(pb, &demux_buff); | |
2785 | sampleBuff = CreateSampleBufferFrom(m_fmt_desc, demux_buff, demux_size); | |
2786 | } | |
2787 | else | |
2788 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Video/VAAPI.cpp xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Video/VAAPI.cpp | |
2789 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Video/VAAPI.cpp 2012-03-21 23:07:50.000000000 +0100 | |
2790 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Video/VAAPI.cpp 2012-11-08 23:16:03.533072250 +0100 | |
2791 | @@ -223,7 +223,6 @@ | |
2792 | } | |
2793 | ||
2794 | pic->type = FF_BUFFER_TYPE_USER; | |
2795 | - pic->age = 1; | |
2796 | pic->data[0] = (uint8_t*)wrapper; | |
2797 | pic->data[1] = NULL; | |
2798 | pic->data[2] = NULL; | |
2799 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Video/VDPAU.cpp xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Video/VDPAU.cpp | |
2800 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDCodecs/Video/VDPAU.cpp 2012-03-21 23:07:50.000000000 +0100 | |
2801 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDCodecs/Video/VDPAU.cpp 2012-11-08 23:16:03.533072250 +0100 | |
2802 | @@ -1197,14 +1197,12 @@ | |
2803 | ||
2804 | if(pic->reference) | |
2805 | { | |
2806 | - pic->age = pA->ip_age[0]; | |
2807 | pA->ip_age[0]= pA->ip_age[1]+1; | |
2808 | pA->ip_age[1]= 1; | |
2809 | pA->b_age++; | |
2810 | } | |
2811 | else | |
2812 | { | |
2813 | - pic->age = pA->b_age; | |
2814 | pA->ip_age[0]++; | |
2815 | pA->ip_age[1]++; | |
2816 | pA->b_age = 1; | |
2817 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDDemuxers/DVDDemuxFFmpeg.cpp xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDDemuxers/DVDDemuxFFmpeg.cpp | |
2818 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDDemuxers/DVDDemuxFFmpeg.cpp 2012-03-21 23:07:50.000000000 +0100 | |
2819 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDDemuxers/DVDDemuxFFmpeg.cpp 2012-11-08 23:16:03.533072250 +0100 | |
2820 | @@ -160,7 +160,7 @@ | |
2821 | #define g_demuxer (*((CDVDDemuxFFmpeg**)g_tls.Get())) | |
2822 | #endif | |
2823 | ||
2824 | -static int interrupt_cb(void) | |
2825 | +static int interrupt_cb(void* unused) | |
2826 | { | |
2827 | if(g_demuxer && g_demuxer->Aborted()) | |
2828 | return 1; | |
2829 | @@ -178,7 +178,7 @@ | |
2830 | ||
2831 | static int dvd_file_read(void *h, uint8_t* buf, int size) | |
2832 | { | |
2833 | - if(interrupt_cb()) | |
2834 | + if(interrupt_cb(NULL)) | |
2835 | return -1; | |
2836 | ||
2837 | CDVDInputStream* pInputStream = (CDVDInputStream*)h; | |
2838 | @@ -192,7 +192,7 @@ | |
2839 | */ | |
2840 | static offset_t dvd_file_seek(void *h, offset_t pos, int whence) | |
2841 | { | |
2842 | - if(interrupt_cb()) | |
2843 | + if(interrupt_cb(NULL)) | |
2844 | return -1; | |
2845 | ||
2846 | CDVDInputStream* pInputStream = (CDVDInputStream*)h; | |
2847 | @@ -236,6 +236,7 @@ | |
2848 | m_speed = DVD_PLAYSPEED_NORMAL; | |
2849 | g_demuxer = this; | |
2850 | m_program = UINT_MAX; | |
2851 | + const AVIOInterruptCB int_cb = { interrupt_cb, NULL }; | |
2852 | ||
2853 | if (!pInput) return false; | |
2854 | ||
2855 | @@ -246,10 +247,6 @@ | |
2856 | ||
2857 | // register codecs | |
2858 | m_dllAvFormat.av_register_all(); | |
2859 | - m_dllAvFormat.url_set_interrupt_cb(interrupt_cb); | |
2860 | - | |
2861 | - // could be used for interupting ffmpeg while opening a file (eg internet streams) | |
2862 | - // url_set_interrupt_cb(NULL); | |
2863 | ||
2864 | m_pInput = pInput; | |
2865 | strFile = m_pInput->GetFileName(); | |
2866 | @@ -284,14 +281,14 @@ | |
2867 | // try mmsh, then mmst | |
2868 | CStdString strFile2; | |
2869 | strFile2.Format("mmsh://%s",strFile.substr(6,strFile.size()-6).c_str()); | |
2870 | - result = m_dllAvFormat.av_open_input_file(&m_pFormatContext, strFile2.c_str(), iformat, FFMPEG_FILE_BUFFER_SIZE, NULL); | |
2871 | + result = m_dllAvFormat.avformat_open_input(&m_pFormatContext, strFile2.c_str(), iformat, NULL); | |
2872 | if (result < 0) | |
2873 | { | |
2874 | strFile = "mmst://"; | |
2875 | strFile += strFile2.Mid(7).c_str(); | |
2876 | } | |
2877 | } | |
2878 | - if (result < 0 && m_dllAvFormat.av_open_input_file(&m_pFormatContext, strFile.c_str(), iformat, FFMPEG_FILE_BUFFER_SIZE, NULL) < 0 ) | |
2879 | + if (result < 0 && m_dllAvFormat.avformat_open_input(&m_pFormatContext, strFile.c_str(), iformat, NULL) < 0 ) | |
2880 | { | |
2881 | CLog::Log(LOGDEBUG, "Error, could not open file %s", strFile.c_str()); | |
2882 | Dispose(); | |
2883 | @@ -301,24 +298,16 @@ | |
2884 | else | |
2885 | { | |
2886 | unsigned char* buffer = (unsigned char*)m_dllAvUtil.av_malloc(FFMPEG_FILE_BUFFER_SIZE); | |
2887 | - m_ioContext = m_dllAvFormat.av_alloc_put_byte(buffer, FFMPEG_FILE_BUFFER_SIZE, 0, m_pInput, dvd_file_read, NULL, dvd_file_seek); | |
2888 | + m_ioContext = m_dllAvFormat.avio_alloc_context(buffer, FFMPEG_FILE_BUFFER_SIZE, 0, m_pInput, dvd_file_read, NULL, dvd_file_seek); | |
2889 | m_ioContext->max_packet_size = m_pInput->GetBlockSize(); | |
2890 | if(m_ioContext->max_packet_size) | |
2891 | m_ioContext->max_packet_size *= FFMPEG_FILE_BUFFER_SIZE / m_ioContext->max_packet_size; | |
2892 | ||
2893 | if(m_pInput->Seek(0, SEEK_POSSIBLE) == 0) | |
2894 | - m_ioContext->is_streamed = 1; | |
2895 | + m_ioContext->seekable = 0; | |
2896 | ||
2897 | if( iformat == NULL ) | |
2898 | { | |
2899 | -#if defined(USE_EXTERNAL_FFMPEG) && LIBAVFORMAT_VERSION_INT < AV_VERSION_INT(52,98,0) | |
2900 | - // API added on: 2011-02-09 | |
2901 | - // Old versions of ffmpeg do not have av_probe_input_format, so we need | |
2902 | - // to always probe using the lower-level functions as well. | |
2903 | - const bool legacyProbing = true; | |
2904 | -#else | |
2905 | - const bool legacyProbing = false; | |
2906 | -#endif | |
2907 | // let ffmpeg decide which demuxer we have to open | |
2908 | ||
2909 | bool trySPDIFonly = (m_pInput->GetContent() == "audio/x-spdif-compressed"); | |
2910 | @@ -331,7 +320,7 @@ | |
2911 | // want to probe for spdif (DTS or IEC 61937) compressed audio | |
2912 | // specifically, or in case the file is a wav which may contain DTS or | |
2913 | // IEC 61937 (e.g. ac3-in-wav) and we want to check for those formats. | |
2914 | - if (legacyProbing || trySPDIFonly || (iformat && strcmp(iformat->name, "wav") == 0)) | |
2915 | + if (trySPDIFonly || (iformat && strcmp(iformat->name, "wav") == 0)) | |
2916 | { | |
2917 | AVProbeData pd; | |
2918 | BYTE probe_buffer[FFMPEG_FILE_BUFFER_SIZE + AVPROBE_PADDING_SIZE]; | |
2919 | @@ -341,7 +330,7 @@ | |
2920 | pd.filename = strFile.c_str(); | |
2921 | ||
2922 | // read data using avformat's buffers | |
2923 | - pd.buf_size = m_dllAvFormat.get_buffer(m_ioContext, pd.buf, m_ioContext->max_packet_size ? m_ioContext->max_packet_size : m_ioContext->buffer_size); | |
2924 | + pd.buf_size = m_dllAvFormat.avio_read(m_ioContext, pd.buf, m_ioContext->max_packet_size ? m_ioContext->max_packet_size : m_ioContext->buffer_size); | |
2925 | if (pd.buf_size <= 0) | |
2926 | { | |
2927 | CLog::Log(LOGERROR, "%s - error reading from input stream, %s", __FUNCTION__, strFile.c_str()); | |
2928 | @@ -350,10 +339,7 @@ | |
2929 | memset(pd.buf+pd.buf_size, 0, AVPROBE_PADDING_SIZE); | |
2930 | ||
2931 | // restore position again | |
2932 | - m_dllAvFormat.url_fseek(m_ioContext , 0, SEEK_SET); | |
2933 | - | |
2934 | - if (legacyProbing && !trySPDIFonly) | |
2935 | - iformat = m_dllAvFormat.av_probe_input_format(&pd, 1); | |
2936 | + m_dllAvFormat.avio_seek(m_ioContext , 0, SEEK_SET); | |
2937 | ||
2938 | // the advancedsetting is for allowing the user to force outputting the | |
2939 | // 44.1 kHz DTS wav file as PCM, so that an A/V receiver can decode | |
2940 | @@ -424,7 +410,10 @@ | |
2941 | ||
2942 | ||
2943 | // open the demuxer | |
2944 | - if (m_dllAvFormat.av_open_input_stream(&m_pFormatContext, m_ioContext, strFile.c_str(), iformat, NULL) < 0) | |
2945 | + m_pFormatContext = m_dllAvFormat.avformat_alloc_context(); | |
2946 | + m_pFormatContext->pb = m_ioContext; | |
2947 | + | |
2948 | + if (m_dllAvFormat.avformat_open_input(&m_pFormatContext, strFile.c_str(), iformat, NULL) < 0) | |
2949 | { | |
2950 | CLog::Log(LOGERROR, "%s - Error, could not open file %s", __FUNCTION__, strFile.c_str()); | |
2951 | Dispose(); | |
2952 | @@ -432,8 +421,11 @@ | |
2953 | } | |
2954 | } | |
2955 | ||
2956 | + // set the interrupt callback, appeared in libavformat 53.15.0 | |
2957 | + m_pFormatContext->interrupt_callback = int_cb; | |
2958 | + | |
2959 | // analyse very short to speed up mjpeg playback start | |
2960 | - if (iformat && (strcmp(iformat->name, "mjpeg") == 0) && m_ioContext->is_streamed) | |
2961 | + if (iformat && (strcmp(iformat->name, "mjpeg") == 0) && m_ioContext->seekable == 0) | |
2962 | m_pFormatContext->max_analyze_duration = 500000; | |
2963 | ||
2964 | // we need to know if this is matroska or avi later | |
2965 | @@ -447,8 +439,8 @@ | |
2966 | m_pFormatContext->max_analyze_duration = 500000; | |
2967 | ||
2968 | ||
2969 | - CLog::Log(LOGDEBUG, "%s - av_find_stream_info starting", __FUNCTION__); | |
2970 | - int iErr = m_dllAvFormat.av_find_stream_info(m_pFormatContext); | |
2971 | + CLog::Log(LOGDEBUG, "%s - avformat_find_stream_info starting", __FUNCTION__); | |
2972 | + int iErr = m_dllAvFormat.avformat_find_stream_info(m_pFormatContext, NULL); | |
2973 | if (iErr < 0) | |
2974 | { | |
2975 | CLog::Log(LOGWARNING,"could not find codec parameters for %s", strFile.c_str()); | |
2976 | @@ -471,7 +463,7 @@ | |
2977 | m_pFormatContext->flags |= AVFMT_FLAG_NONBLOCK; | |
2978 | ||
2979 | // print some extra information | |
2980 | - m_dllAvFormat.dump_format(m_pFormatContext, 0, strFile.c_str(), 0); | |
2981 | + m_dllAvFormat.av_dump_format(m_pFormatContext, 0, strFile.c_str(), 0); | |
2982 | ||
2983 | UpdateCurrentPTS(); | |
2984 | ||
2985 | @@ -510,20 +502,12 @@ | |
2986 | ||
2987 | if (m_pFormatContext) | |
2988 | { | |
2989 | - if (m_ioContext) | |
2990 | + if (m_ioContext && m_pFormatContext->pb && m_pFormatContext->pb != m_ioContext) | |
2991 | { | |
2992 | - if(m_pFormatContext->pb && m_pFormatContext->pb != m_ioContext) | |
2993 | - { | |
2994 | - CLog::Log(LOGWARNING, "CDVDDemuxFFmpeg::Dispose - demuxer changed our byte context behind our back, possible memleak"); | |
2995 | - m_ioContext = m_pFormatContext->pb; | |
2996 | - } | |
2997 | - m_dllAvFormat.av_close_input_stream(m_pFormatContext); | |
2998 | - if (m_ioContext->buffer) | |
2999 | - m_dllAvUtil.av_free(m_ioContext->buffer); | |
3000 | - m_dllAvUtil.av_free(m_ioContext); | |
3001 | + CLog::Log(LOGWARNING, "CDVDDemuxFFmpeg::Dispose - demuxer changed our byte context behind our back, possible memleak"); | |
3002 | + m_ioContext = m_pFormatContext->pb; | |
3003 | } | |
3004 | - else | |
3005 | - m_dllAvFormat.av_close_input_file(m_pFormatContext); | |
3006 | + m_dllAvFormat.avformat_close_input(&m_pFormatContext); | |
3007 | } | |
3008 | m_ioContext = NULL; | |
3009 | m_pFormatContext = NULL; | |
3010 | @@ -773,19 +757,12 @@ | |
3011 | { | |
3012 | stream->duration = duration; | |
3013 | duration = m_dllAvUtil.av_rescale_rnd(stream->duration, (int64_t)stream->time_base.num * AV_TIME_BASE, stream->time_base.den, AV_ROUND_NEAR_INF); | |
3014 | - if ((m_pFormatContext->duration == (int64_t)AV_NOPTS_VALUE && m_pFormatContext->file_size > 0) | |
3015 | + if ((m_pFormatContext->duration == (int64_t)AV_NOPTS_VALUE) | |
3016 | || (m_pFormatContext->duration != (int64_t)AV_NOPTS_VALUE && duration > m_pFormatContext->duration)) | |
3017 | m_pFormatContext->duration = duration; | |
3018 | } | |
3019 | } | |
3020 | ||
3021 | - // check if stream seem to have grown since start | |
3022 | - if(m_pFormatContext->file_size > 0 && m_pFormatContext->pb) | |
3023 | - { | |
3024 | - if(m_pFormatContext->pb->pos > m_pFormatContext->file_size) | |
3025 | - m_pFormatContext->file_size = m_pFormatContext->pb->pos; | |
3026 | - } | |
3027 | - | |
3028 | pPacket->iStreamId = pkt.stream_index; // XXX just for now | |
3029 | } | |
3030 | m_dllAvCodec.av_free_packet(&pkt); | |
3031 | @@ -923,19 +900,6 @@ | |
3032 | if (!m_pFormatContext) | |
3033 | return 0; | |
3034 | ||
3035 | - /* apperently ffmpeg messes up sometimes, so check for negative value too */ | |
3036 | - if (m_pFormatContext->duration == (int64_t)AV_NOPTS_VALUE || m_pFormatContext->duration < 0LL) | |
3037 | - { | |
3038 | - // no duration is available for us | |
3039 | - // try to calculate it | |
3040 | - int iLength = 0; | |
3041 | - if (m_iCurrentPts != DVD_NOPTS_VALUE && m_pFormatContext->file_size > 0 && m_pFormatContext->pb && m_pFormatContext->pb->pos > 0) | |
3042 | - { | |
3043 | - iLength = (int)(((m_iCurrentPts * m_pFormatContext->file_size) / m_pFormatContext->pb->pos) / 1000) & 0xFFFFFFFF; | |
3044 | - } | |
3045 | - return iLength; | |
3046 | - } | |
3047 | - | |
3048 | return (int)(m_pFormatContext->duration / (AV_TIME_BASE / 1000)); | |
3049 | } | |
3050 | ||
3051 | @@ -987,8 +951,8 @@ | |
3052 | st->iBitRate = pStream->codec->bit_rate; | |
3053 | st->iBitsPerSample = pStream->codec->bits_per_coded_sample; | |
3054 | ||
3055 | - if(m_dllAvFormat.av_metadata_get(pStream->metadata, "title", NULL, 0)) | |
3056 | - st->m_description = m_dllAvFormat.av_metadata_get(pStream->metadata, "title", NULL, 0)->value; | |
3057 | + if(m_dllAvUtil.av_dict_get(pStream->metadata, "title", NULL, 0)) | |
3058 | + st->m_description = m_dllAvUtil.av_dict_get(pStream->metadata, "title", NULL, 0)->value; | |
3059 | ||
3060 | break; | |
3061 | } | |
3062 | @@ -1077,8 +1041,8 @@ | |
3063 | if(pStream->codec) | |
3064 | st->identifier = pStream->codec->sub_id; | |
3065 | ||
3066 | - if(m_dllAvFormat.av_metadata_get(pStream->metadata, "title", NULL, 0)) | |
3067 | - st->m_description = m_dllAvFormat.av_metadata_get(pStream->metadata, "title", NULL, 0)->value; | |
3068 | + if(m_dllAvUtil.av_dict_get(pStream->metadata, "title", NULL, 0)) | |
3069 | + st->m_description = m_dllAvUtil.av_dict_get(pStream->metadata, "title", NULL, 0)->value; | |
3070 | ||
3071 | break; | |
3072 | } | |
3073 | @@ -1089,7 +1053,7 @@ | |
3074 | { | |
3075 | std::string fileName = "special://temp/fonts/"; | |
3076 | XFILE::CDirectory::Create(fileName); | |
3077 | - AVMetadataTag *nameTag = m_dllAvFormat.av_metadata_get(pStream->metadata, "filename", NULL, 0); | |
3078 | + AVDictionaryEntry *nameTag = m_dllAvUtil.av_dict_get(pStream->metadata, "filename", NULL, 0); | |
3079 | if (!nameTag) { | |
3080 | CLog::Log(LOGERROR, "%s: TTF attachment has no name", __FUNCTION__); | |
3081 | break; | |
3082 | @@ -1138,7 +1102,7 @@ | |
3083 | // API added on: 2010-10-15 | |
3084 | // (Note that while the function was available earlier, the generic | |
3085 | // metadata tags were not populated by default) | |
3086 | - AVMetadataTag *langTag = m_dllAvFormat.av_metadata_get(pStream->metadata, "language", NULL, 0); | |
3087 | + AVDictionaryEntry *langTag = m_dllAvUtil.av_dict_get(pStream->metadata, "language", NULL, 0); | |
3088 | if (langTag) | |
3089 | strncpy(m_streams[iId]->language, langTag->value, 3); | |
3090 | #else | |
3091 | @@ -1248,7 +1212,7 @@ | |
3092 | // API added on: 2010-10-15 | |
3093 | // (Note that while the function was available earlier, the generic | |
3094 | // metadata tags were not populated by default) | |
3095 | - AVMetadataTag *titleTag = m_dllAvFormat.av_metadata_get(m_pFormatContext->chapters[chapterIdx-1]->metadata, | |
3096 | + AVDictionaryEntry *titleTag = m_dllAvUtil.av_dict_get(m_pFormatContext->chapters[chapterIdx-1]->metadata, | |
3097 | "title", NULL, 0); | |
3098 | if (titleTag) | |
3099 | strChapterName = titleTag->value; | |
3100 | diff -urN xbmc-11.0/xbmc/cores/dvdplayer/DVDDemuxers/DVDDemuxFFmpeg.h xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDDemuxers/DVDDemuxFFmpeg.h | |
3101 | --- xbmc-11.0/xbmc/cores/dvdplayer/DVDDemuxers/DVDDemuxFFmpeg.h 2012-03-21 23:07:50.000000000 +0100 | |
3102 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/cores/dvdplayer/DVDDemuxers/DVDDemuxFFmpeg.h 2012-11-08 23:16:03.533072250 +0100 | |
3103 | @@ -128,7 +128,7 @@ | |
3104 | #define MAX_STREAMS 100 | |
3105 | CDemuxStream* m_streams[MAX_STREAMS]; // maximum number of streams that ffmpeg can handle | |
3106 | ||
3107 | - ByteIOContext* m_ioContext; | |
3108 | + AVIOContext* m_ioContext; | |
3109 | ||
3110 | DllAvFormat m_dllAvFormat; | |
3111 | DllAvCodec m_dllAvCodec; | |
3112 | diff -urN xbmc-11.0/xbmc/DllPaths_generated.h.in xbmc-11.0-ffmpeg-1.0/xbmc/DllPaths_generated.h.in | |
3113 | --- xbmc-11.0/xbmc/DllPaths_generated.h.in 2012-03-21 23:07:50.000000000 +0100 | |
3114 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/DllPaths_generated.h.in 2012-11-08 23:15:55.399739205 +0100 | |
3115 | @@ -74,13 +74,13 @@ | |
3116 | #define DLL_PATH_LIBMAD "@MAD_SONAME@" | |
3117 | ||
3118 | /* ffmpeg */ | |
3119 | -#define DLL_PATH_LIBAVCODEC "special://xbmcbin/system/players/dvdplayer/avcodec-52-@ARCH@.so" | |
3120 | -#define DLL_PATH_LIBAVCORE "special://xbmcbin/system/players/dvdplayer/avcore-0-@ARCH@.so" | |
3121 | -#define DLL_PATH_LIBAVFORMAT "special://xbmcbin/system/players/dvdplayer/avformat-52-@ARCH@.so" | |
3122 | -#define DLL_PATH_LIBAVUTIL "special://xbmcbin/system/players/dvdplayer/avutil-50-@ARCH@.so" | |
3123 | -#define DLL_PATH_LIBPOSTPROC "special://xbmcbin/system/players/dvdplayer/postproc-51-@ARCH@.so" | |
3124 | -#define DLL_PATH_LIBSWSCALE "special://xbmcbin/system/players/dvdplayer/swscale-0-@ARCH@.so" | |
3125 | -#define DLL_PATH_LIBAVFILTER "special://xbmcbin/system/players/dvdplayer/avfilter-1-@ARCH@.so" | |
3126 | +#define DLL_PATH_LIBAVCODEC "special://xbmcbin/system/players/dvdplayer/avcodec-53-@ARCH@.so" | |
3127 | +#define DLL_PATH_LIBAVFORMAT "special://xbmcbin/system/players/dvdplayer/avformat-53-@ARCH@.so" | |
3128 | +#define DLL_PATH_LIBAVUTIL "special://xbmcbin/system/players/dvdplayer/avutil-51-@ARCH@.so" | |
3129 | +#define DLL_PATH_LIBPOSTPROC "special://xbmcbin/system/players/dvdplayer/postproc-52-@ARCH@.so" | |
3130 | +#define DLL_PATH_LIBSWSCALE "special://xbmcbin/system/players/dvdplayer/swscale-2-@ARCH@.so" | |
3131 | +#define DLL_PATH_LIBAVFILTER "special://xbmcbin/system/players/dvdplayer/avfilter-2-@ARCH@.so" | |
3132 | +#define DLL_PATH_LIBSWRESAMPLE "special://xbmcbin/system/players/dvdplayer/swresample-0-@ARCH@.so" | |
3133 | ||
3134 | /* cdrip */ | |
3135 | #if defined(_LINUX) && !defined(__APPLE__) | |
3136 | diff -urN xbmc-11.0/xbmc/DllPaths_win32.h xbmc-11.0-ffmpeg-1.0/xbmc/DllPaths_win32.h | |
3137 | --- xbmc-11.0/xbmc/DllPaths_win32.h 2012-03-21 23:07:50.000000000 +0100 | |
3138 | +++ xbmc-11.0-ffmpeg-1.0/xbmc/DllPaths_win32.h 2012-11-08 23:15:55.399739205 +0100 | |
3139 | @@ -58,13 +58,13 @@ | |
3140 | #define DLL_PATH_LIBRTMP "special://xbmcbin/system/players/dvdplayer/librtmp.dll" | |
3141 | ||
3142 | /* ffmpeg */ | |
3143 | -#define DLL_PATH_LIBAVCODEC "special://xbmcbin/system/players/dvdplayer/avcodec-52.dll" | |
3144 | -#define DLL_PATH_LIBAVCORE "special://xbmcbin/system/players/dvdplayer/avcore-0.dll" | |
3145 | -#define DLL_PATH_LIBAVFORMAT "special://xbmcbin/system/players/dvdplayer/avformat-52.dll" | |
3146 | -#define DLL_PATH_LIBAVUTIL "special://xbmcbin/system/players/dvdplayer/avutil-50.dll" | |
3147 | -#define DLL_PATH_LIBAVFILTER "special://xbmcbin/system/players/dvdplayer/avfilter-1.dll" | |
3148 | -#define DLL_PATH_LIBPOSTPROC "special://xbmcbin/system/players/dvdplayer/postproc-51.dll" | |
3149 | -#define DLL_PATH_LIBSWSCALE "special://xbmcbin/system/players/dvdplayer/swscale-0.dll" | |
3150 | +#define DLL_PATH_LIBAVCODEC "special://xbmcbin/system/players/dvdplayer/avcodec-53.dll" | |
3151 | +#define DLL_PATH_LIBAVFORMAT "special://xbmcbin/system/players/dvdplayer/avformat-53.dll" | |
3152 | +#define DLL_PATH_LIBAVUTIL "special://xbmcbin/system/players/dvdplayer/avutil-51.dll" | |
3153 | +#define DLL_PATH_LIBAVFILTER "special://xbmcbin/system/players/dvdplayer/avfilter-2.dll" | |
3154 | +#define DLL_PATH_LIBPOSTPROC "special://xbmcbin/system/players/dvdplayer/postproc-52.dll" | |
3155 | +#define DLL_PATH_LIBSWSCALE "special://xbmcbin/system/players/dvdplayer/swscale-2.dll" | |
3156 | +#define DLL_PATH_LIBSWRESAMPLE "special://xbmcbin/system/players/dvdplayer/swresample-0.dll" | |
3157 | ||
3158 | /* cdrip */ | |
3159 | #define DLL_PATH_LAME_ENC "special://xbmcbin/system/cdrip/lame_enc.dll" |